please helm me

A circular piece of metal has a radius of 3.5 meters.
The metal sells for $3.25 per square meter.

What is the total cost of the circular piece of metal?



A.
$11.38


B.
$38.47


C.
$71.44


D.
$125.01,

Answers

Answer 1
Area of circular metal=πr^2 =3.14 x 3.5 x 3.5 m^2 now, total cost=area x rate =3.14 x 3.5 x 3.5 x 3.25 $ =125.01 $
Answer 2

Answer:

The answer would be $125.01

Step-by-step explanation:

I took the test.


Related Questions

Write a real word problem that involves classifying a quadrilateral

Answers

Joe had a farm. He planted all his crops in that one rectangular farm. What type of shape is his farm.

Maybe this helps or at least take ideas from this for me it wasn’t good but at least its something

Alice needs to classify her garden quadrilateral to determine if it is suitable for a specific species of flowers. She finds the sides equal in length and consecutive angles supplementary, which leads her to conclude the garden plot is a rhombus, meeting the criteria for her flowers.

Alice designs a garden plot in the shape of a quadrilateral. She knows that for a certain species of flower to grow optimally, her garden must have a specific shape: it needs to be a parallelogram with equal sides but not necessarily equal angles. In order to classify the quadrilateral of her garden, she begins by measuring the sides and finds that they are all of equal length. Then she measures the angles and finds that consecutive angles are supplementary, which means their measures add up to 180 degrees.

To determine if the quadrilateral meets the criteria for the species of flowers, she must classify her garden plot based on her measurements. Is Alice's garden a rectangle, a square, a rhombus, or a parallelogram with unequal angles?

Since the sides of the quadrilateral are all equal and the consecutive angles are supplementary, Alice can conclude that her garden plot is a rhombus, which is a type of parallelogram with all sides equal in length and opposite angles equal. Thus, it fulfills the requirements for her special species of flowers.

A support beam to be placed at a 28° angle of elevation so that the top meets a vertical beam 1.6 meters above the horizontal floor. Thanks vertical beam meets the floor at a 90° angle.
Law of sin: sin(A)/a=sin(B)/b=sin(C)/c
Approximately how far the vertical beam should the lower end of the support be placed along the horizontal floor



A)3.0 meters
B)3.4 meters
C)3.9 meters
D)4.4 meters

Answers

1.6/sin(28)
The answer is B

Answer:

B.

Step-by-step explanation:

Math help!!!!!!!!!!!!!!!!!!!!!!!!!!!

Answers

6,023 
6,032
6,407
6,704
From least to greatest:

6,023; 6,032; 6,407; and 6,704.
From this list, the most accurate answer choice is the first one, A.

I hope this helps!

Find the area of the triangle. Round the answer to the nearest tenth.

A.
68.4 square units
B.
75.3 square units
C.
84.5 square units
D.
136.7 square units

Answers

The answer is A. 68.4 square units. If you need an explanation I can write it down.

Answer:

Option A. 68.4 square units.

Step-by-step explanation:

Since sides ED = EF = 13 units

So the given triangle is an isosceles triangle and in an isosceles triangle EFD, perpendicular drawn from E to DF, will be perpendicular bisector of DF.

Moreover, to this perpendicular bisector to DF will be the height of the triangle.

Now Area of a triangle of [tex]\frac{1}{2}[/tex] × base × height.

Sin 63 =  [tex]\frac{Height}{Hypotenuse}[/tex] =  [tex]\frac{h}{13}[/tex]

h = 13 sin 63 = 13 ( 0.891) = 11.583 units

Cos 63 =  [tex]\frac{Base}{Hypotenuse}[/tex] =  [tex]\frac{Base}{13}[/tex]

Base = 13 cos 63 = 13 × (0.454)

                            = 5.90 units

Since DF = 2 × base = 2 × 5.90

                                 = 11.80 units

Now area of EDF =  [tex]\frac{1}{2}[/tex] × 11.80 × 11.583

                             = 68.86 ≈ 68.40 square units.

Option A. 68.4 square units.

Solve the following inequality. 2x < 8

Answers

2x < 8
2x / 2 < 8/2
  x < 4

hope it helps

The required solution of the given inequality 2x < 8 is x < 4.

What is inequality?

The relation between two expressions that are not equal, employing a sign such as ≠ ‘not equal to’, > ‘greater than’, or < ‘less than’.

Given:

The given  inequality is

2x < 8

According to given question we have

Write inequality

2x < 8

Divide both sides by 2 we get,

x < 4

Therefore, the required solution of the given inequality 2x < 8 is x < 4.

Learn more details about inequality here:

https://brainly.com/question/20383699

#SPJ2

[100 POINTS]

Question 1)
The graph for the equation y = 2x - 2 is shown below.
If another equation is graphed so that the system has one solution, which equation could that be?
A) y = 2(x+1)
B) y = 2(x-1)
C) y = 2(x-2)
D) y = -2(x+1)

Question 2)
Solve the inequality and then graph its solution.
1/5(x-2) > -1

a) x > -7
b) x < -3
c) x > -3
d) x > 3

Answers

Question 1)

D

The answer is D because every other option has the same slope (2), and even if the intercepts are different, the lines would only be parallel, whereas in D, the slope is -2, which has one solution.

Question 2)

C

You would multiply everything by 5 to get rid of the fraction. Then, you can simplify and get the answer.

The first question is D, because when graphed, intercepts with the slope of 3, the only with the solution.

The second question is C, because u can multiple the LHS and RHS to get x-2 is greater than -5. Add 5 to get x is greater than -3

What is the quotient of
13
÷
8
? Leave your answer as a mixed number

Answers

1 and 5/8 is the correct answer
 
the answer is 1 and 5/8

Solve for w.
1/7 = -3/2w -4/5 Simplify your answer as much as possible.

Answers

1/7 = -3/2w -4/5
add 4/5 to both sides
1/7 + 4/5= -3/2w
change to common denominator; 5 & 7 go into 35
(1*5)/35 + (4*7)/34= -3/2w
5/35 + 28/35= -3/2w
33/35= -3/2w
divide by -3/2 on both sides; multiply by the reciprocal of -3/2
33/35 * -2/3= w
-66/105= w
simplify by 3
-22/35= w

CHECK:
1/7 = -3/2w - 4/5
1/7= -3/2(-22/35) - 4/5
1/7= 66/70 - 4/5
1/7= 66/70 - 56/70
1/7= 10/70
1/7= 1/7

ANSWER: w= -22/35

Hope this helps! :)

Answer:

7 on k-12

Step-by-step explanation:

7(w+1)7w+77w+77w+7−7w7217=======5(2w−3)+110w−15+110w−1410w−14−7w3w−143wwDistribute on each side.Simplify the right side.Subtract 7w from each side.Combine like terms.Add 14 to each side.Divide each side by 3.

Which of the following is the solution to the equation 25^(z + 2) = 125?

Answers

Answer:

z = -0.5

Step-by-step explanation:

Using exponent rule:

[tex]x^a = x^b[/tex] then a = b

Given the equation:

[tex]25^{z+2} = 125[/tex]

We can write 25 and 125 as:

[tex]25 = 5 \cdot 5 = 5^2[/tex]

[tex]125 = 5 \cdot 5 \cdot 5 = 5^3[/tex]

then;

[tex]5^{2(z+2)}= 5^3[/tex]

Apply the rule:

[tex]2(z+2) = 3[/tex]

using distributive property [tex]a \cdot (b+c) = a\cdot b+ a\cdot c[/tex]

[tex]2z+4 = 3[/tex]

Subtract 4 from both sides we have;

[tex]2z = -1[/tex]

Divide both sides by 2 we have;

z = -0.5

Therefore, the solution for the given equation is, z = -0.5



The graph shows the path of a rider on a ride at an amusement park.

What does the x-coordinate of the vertex represent?



The rider’s minimum height above the ground is 25 ft.
The rider travels a total distance of 25 ft.
The difference between the rider’s maximum and minimum’s height above the ground is 25 ft.
The rider is closest to the ground when he is 25 ft from the left side of the ride.

https://static.k12.com/nextgen_media/assets/8090397-NG_AL1_O_07_U12_Quiz_08.png

Answers

The rider is closest to the ground when he is 25 ft from the left side of the ride.

Answer:

D. The rider is closest to the ground when he is 25 ft from the left side of the ride.

Step-by-step explanation:

The vertex of x-coordinate represents the distance from the from the origin of the pendulum, which is the closest to the ground when he is 25 ft away from 0.

Hope this will helpful.

Thank you.

What is the first step to be done when solving this equation: 3(x-2+3) + 5 = 25

Answers

3x-6+9+5=25 is the first step
What is the first step to be done when solving this equation:
 3(x - 2 + 3) + 5 = 25

Ok, so the first step is to distribute the parentheses:

3(x - 2 + 3) = 3x - 6 + 9 <<< answer

Next step: 

plug it in the equation

3x - 6 + 9 + 5 = 25

Simplify,

3x + 8 = 25

Then,
subtract 8 from both sides

3x = 25 - 8

so, 3x = 17

Divide both sides by 3

x = 17/3

there are four brands of smartphones that are most popular in the united states . the number of people in the united states that have each brand is given.
brand A; 4.48x104;
brand b : 3.84 x107; brand c : 6.4x10^6; brand d: 1.50 x107
what is the order of these brands from most to least popular?

Answers

Brand B; brand D; Brand C; Brand A

For this case we must write the numbers from highest to lowest.

We observe that the numbers are written in exponential notation.

Therefore, by rewriting we have:

Brand A:

[tex] 4.48 * 10 ^ 4 = 44,800
[/tex]

Brand B:

[tex] 3.84 * 10 ^ 7 = 38,400,000
[/tex]

Brand C:

[tex] 6.4 * 10 ^ 6 = 6,400,000
[/tex]

Brand D:

[tex] 1.50 * 10 ^ 7 = 15,000,000
[/tex]

Ordering from highest to lowest we have:

[tex] 3.84 * 10 ^ 7 = 38,400,000

1.50 * 10 ^ 7 = 15,000,000

6.4 * 10 ^ 6 = 6,400,000

4.48 * 10 ^ 4 = 44,800
[/tex]

Answer:

The order of these brands from most to least popular is:

Brand B

Brand D

Brand C

Brand A

Sarah draws a rectangle with an area of 4,875 square units and a length of 65 units. What is the width of the rectangle? 70 units 75 units 85 units 95 units

Answers

To calculate area of a rectangle you multiply the length and width together so to find the width you divide the area by the length: 4875÷65=75 so the width is 75 units.

urgent help needed!

write y = (-5/8)x + 3 in standard form using integers.
a. 5x + 8y = -24
b. 5x + 8y = 24
c. 5x - 8y = 24
d. -5x + 8y = 24

Answers

To write this in standard form, you need to eliminate the fraction in the coefficient of variable x. You can do this by multiplying 8 to the two sides of the equation:

8(y) = 8[(-5/8)x + 3]

8y = -5x + 24

Transpose the variable x to the other side:

5x + 8y = 24        

 

 

In Washington, D.C., Constitution Ave. meets Pennsylvania Ave. at a 25° angle. What is the measure of the complementary angle to the angle formed by these two avenues?

Answers

By definition, the complementary angles are those that have a sum of 90° (Right angle). 

 The problem indicates that Constitution Avenue meets Pennsylvania Avenue at a 25° angle. Then, the complementary angle is:

Complementary angle=90°-25°
Complementary angle=65°

  What is the measure of the complementary angle to the angle formed by these two avenues?

 The answer is: The measure of the complementary angle to the angle formed by these two avenues is 65°. 

Let ​ f(x)=x2−3x−4​ .

What is the average rate of change from x = 7 to x = 10?



Enter your answer in the box.

Answers

to find rate of change, you find the change in the output values compared to the change in the input values and write it as a fraction

[tex] \frac{change \: in \: y}{change \: in \: x} [/tex]

f(7) is
[tex] {7}^{2} - 3(7) - 4[/tex]
[tex]49 - 21 - 4[/tex]
when x is 7, y=24

f(10) is
[tex] {10}^{2} - 3(10) - 4[/tex]
[tex]100 - 30 - 4[/tex]
when x is 10, y=66

the difference in the y values is 42 when the x values change by 3

[tex] \frac{66 - 24}{10 - 7} = \frac{42}{3} = 14[/tex]
the average rate of change is 14

Singing "row, row, row your boat," in a round (each group starting at a different time) would be considered which texture? music appreciation

Answers

Yuh, ooh, brr, brr
Gucci gang, ooh
(That's it right there, Gnealz)
Yuh, Lil Pump, yuh
Gucci gang, ooh
(Ooh, Bi-Big Head on the beat)
Yuh, brr

The complement of an angle is 8 times as large as the angle. find the measure of the complement

Answers

Answer:

80⁰

Step-by-step explanation:

Angle = x

Complement = 90 - x

Given:

8x = 90 - x

9x = 90

x = 10⁰

Complement = 90 - 10 = 80⁰

The complement of an angle is 8 times as large as the angle. The measure of other angle is 80⁰.

What are complementary angles?

The complement of an angle is the sum of angles which is equal to 90 degrees.

Let one Angle = x

Complement = 90 - x

The complement of an angle is 8 times as large as the angle.

so,

8x = 90 - x

9x = 90

x = 10⁰

Complement = 90 - 10

                     = 80⁰

Learn more about angles;

https://brainly.com/question/17289163

#SPJ2

What is the value of h when the function is converted to vertex form? Note: Vertex form is p(x)=a(x−h)^
2+k . p(x)=x^2−14x+29

Answers

The vertex form is given by:
p(x)=a(x-h)^2+k
p(x)=x^2-14x+29
c=(b/2)^2=(-14/2)^2=49
hence:
x^2-14x+49=-29+49
(x-7)^2=20
hence:
p(x)=(x-7)^2-20
thus, h=7

16. Which of the following are the measures of a right isosceles triangle?

a. 36°, 60°, 90°
b. 40°, 40°, 90°
c. 60°, 60°, 60°
d. 45°, 90°, 45°

17. Of the following triangles, which one is impossible to construct?

a. acute scalene
b. acute equilateral
c. obtuse scalene
d. obtuse equilateral

Answers

16. 
The angles of right isosceles triangle are such that there is the right angle, 90 degrees, and there are two identical angles that add up to 90.

17. 
It is impossible to have an obtuse equilateral because and obtuse triangle has an angle that is more than 90 but less than 190. The equilateral triangle has all the angles equaling the same; 60 degrees. 60 degrees isn't obtuse so it is impossible to have an obtuse equilateral triangle. 

Hope this helps :)

How to find side of triangle if two sides and one angle is known?

Answers

The Law of Cosines can be used.

If the given angle is opposite one of the given sides, the Law of Sines can be used.

Law of Cosines:
.. c^2 = a^2 +b^2 -2ab*cos(C) . . . . . for any permutation of sides a, b, c, and opposite angle C

Law of Sines:
.. a/sin(A) = b/sin(B) = c/sin(C)

Let A and B be two events in a sample space S such that
P(A)=.6 P(B)=.5 and P(A intersect B) =.2 Find
A) P(A|B)
B) P(B|A)
Please explain how to do this! Thank you

Answers

P(A|B)P(A intersect B) = 0.2 = P( B intersect A)

A) P(A intersect B) = P(A|B)*P(B)
Replacing the known vallues:
0.2=P(A|B)*0.5
Solving for P(A|B):
0.2/0.5=P(A|B)*0.5/0.5
0.4=P(A|B)
P(A|B)=0.4

B) P(B intersect A) = P(B|A)*P(A)
Replacing the known vallues:
0.2=P(B|A)*0.6
Solving for P(B|A):
0.2/0.6=P(B|A)*0.6/0.6
2/6=P(B|A)
1/3=P(B|A)
P(B|A)=1/3

The population of a town is 6500 and is increasing at a rate of 4% per year.at this rate, approximately what will the towns population be in 4 years

Answers

population = 6500
End of 1st year = 1.04 x 6500 = 6760
End of 2nd year = 1.04 x 6760 = 7030
End of 3rd year  = 1.04 x 7030 = 7312
End of 4th year  = 1.04 x 7312 = 7604

To find the town's population in 4 years with an initial population of 6500 and a 4% annual growth rate, we use the exponential growth formula, resulting in an estimated population of approximately 7609.

The population of a town is 6500 and is increasing at a rate of 4% per year. To calculate the town's population in 4 years, we will use the formula for exponential growth:

P(t) = P0(1 + r)^t

Where:

P(t) is the future population

P0 is the initial population

r is the growth rate (as a decimal)

t is the number of years

Step-by-step calculation:

Convert the growth rate from a percentage to a decimal: r = 4% = 0.04

Use the formula with t = 4 years, P0 = 6500, and r = 0.04:

P(4) = 6500(1 + 0.04)⁴

Calculate P(4) = 6500 * 1.04⁴

Approximate the future population after 4 years.

By performing the calculation, the town's population in 4 years will be approximately 7609.

First combined weight of three packages that weigh 5 1/2 pounds 4 7/16 pounds and 3 3/8 pounds

Answers

5 1/2 + 4 7/6= 9.9+3 3/8=13.37

find the roots of the equation x3-3x^2+x+5

Answers

x^3-3x^2+x+5=(x+1)(x^2-4x+5)

(x+1)(x^2-4x+5)=0
x+1=0→x+1-1=0-1→x=-1
x^2-4x+5 different to zero

The root of the equation is x=-1 

Sarah is shopping for groceries at the local supermarket. She paid for her groceries using a $100 bill recently issued by the US government. What type of money did Sarah use for this transaction? commodity money fiat money digital money representative money

Answers

It is not digital because that would something like applepay. It is also nt representative, since that would be something like food stamps. Commodity money is also a bad answer, since it is goods. You answer would be fiat money, which is paper tender issued by the government. Hope this helps.

Answer for number 5?

Answers

you should try to divide 192 by the 4 sides on the rectangle.
The first thing you should know is that the perimeter of a rectangle is given by:
 P = 2L + 2W
 Where,
 L: side
 W: width
 On the other hand we have that the ratio is:
 L / W = 5/3
 Clearing L we have:
 L = (5/3) * (W)
 Substituting in the expression of the perimeter:
 P = 2 ((5/3) * (W)) + 2W
 Rewriting:
 P = (16/3) W
 The perimeter is 192:
 192 = (16/3) W
 We cleared W:
 W = (3/16) * (192)
 W = 36
 Finally we substitute W in the expression for L:
 L = (5/3) * (W)
 L = (5/3) * (36)
 L = 60
 Answer: 
 The width and length are: 
 W = 36 yards 
 L = 60 yards


Hint: Omars equation doesn't work!
Identify his error and correct it by showing the steps Omar should have taken and determine the correct value of x.

Answers

His Error: He set the expressions 10x-1 and 59 equal to each other. Those two angles are not congruent. 

He should have added the two expressions to get 180
(10x-1) + (59) = 180
10x+(-1+59) = 180
10x+58 = 180
10x+58-58 = 180-58
10x = 122
10x/10 = 122/10
x = 12.2

Mia’s work to find the slope of a trend line through the points (3, 10) and (35, 91) is shown below.

Mia’s Work

Step 1: 3-35/10-91

Step 2: -32/-81

Step 3: 32/81


What was the first error that Mia made?



A: Mia simplified incorrectly and made the slope positive.

B: Mia subtracted in the wrong order.

C: Mia switched the numerator and the denominator.

D: Mia used subtraction instead of addition.

Answers

For this case the first thing you should know is that by definition the slope of the line is given by:
 m = (y2-y1) / (x2-x1)
 Where we have two ordered pairs:
 P1 = (x1, y1)
 P2 = (x2, y2)
 We observe then that according to the formula, the error of mine was to invert the numerator with the denominator.
 Answer: 
 C: Mia switched the numerator and the denominator.

Answer:

Answer:  

C: Mia switched the numerator and the denominator.

Step-by-step explanation:

just took the test

Anslee is designing a doll house shaped like a rectangular prism. The doll house is 8 feet long, 2 feet wide and 3 feet high. What is the surface area of the doll house?

Answers

we know that
L=8 ft
W=2 ft
H=3 ft
[surface area of the doll house]=2*[W*H]+2*[L*H]+2*[W*L]
[surface area of the doll house]=2*[2*3]+2*[8*3]+2*[2*8]
[surface area of the doll house]=2*[6]+2*[24]+2*[16]
[surface area of the doll house]=12+48+32--------> 92 ft²

the answer is 92 ft²
Other Questions
Resistors in parallel together contain less resistance than resistors in series together. Create an analogy to explain this phenomena and post it here. What is the equation of the line that contains the points (3, 6) and (3, 0)?A.y = x 3B.y = x 3C.y = x + 3D.y = x + 3 What is the condition in which the patient's pupils are normally unequal? why can't astronomers measure the parallax of a star that is a million light years away? A nurse is providing education to a client with polycystic kidney disease (pkd). what are the four (4) disease management areas to review with this client? 40 g of calcium reacts with 71 g of chlorine to produce _____ g of calcium chloride What conclusion can you draw based on the data in the scatterplot? Which of the following statements is not true about reflections? The image faces the same direction as the pre-image. The image is the same shape as the pre-image. The image is the same size as the pre-image. Points on the pre-image are the same distance from the line of reflection as the corresponding points on the image. Which of the following changes will always be true for a spontaneous reaction? (3 points) + delta G+ delta S- delta G- delta H The ice rink sold 95 tickets for the afternoon skating session, for a total of $828. General admission tickets cost $10 each and youth tickets cost $8 each. How many general admission tickets and how many youth tickets were sold? In another country why does the doctor tell the narrator he will be able to play football again Of the world's population of 6.7 billion people, _________ are scraping by on incomes that average less than $2 per day. omg delete thhis queston plzliiiiiiiiiiiikkkkke hlpbruh Often Scyld Scefing seized mead-benches from enemy troops, from many a clan; he terrified warriors, even though first he was found a waif, helpless. For that came a remedy, he grew under heaven, prospered in honors until every last one of the bordering nations beyond the whale-road had to heed him, pay him tribute. He was a good king! The author most likely uses this setting to develop which themes? A.The importance of life and death, destiny, and honor. B.The struggles of loss and sorrow, old age, and defeat. C.The questions, mystery, and challenges of life. D.The cycle of rulers and servants, poverty, and treasure. Please help me i cant do it thank you from the contex of the paragraph, which word BEST describes the uncle who is the official in the Treasury In the previous problem, how does the angle of depression from the top of the taller building relate to the angle of elevation from the top of the shorter building? You might have heard your grandmother say, When I was your age, candy bars cost a nickel. Like candy bars, the price of fast food has increased over time. In 1957, the year Burger King introduced its Whopper, the price was $0.37. In 2015, a Whopper costed $3.99.Suppose the CPI in 1957 was 28, and the CPI in 2015 was 240. The base year for the CPI is 1983.If the price of a Whopper had kept up with the rate of inflation, its price in 2015 would have been $ senor ruiz par favor la verdad Gina earns $19,750 annually and has 20% of her gross earnings withheld. What is the net amount of her paycheck each pay period if she is paid biweekly? a. $607.69 b. $658.33 c. $14,000 d. $134.62 ANSWER ASAP AND GET BRAINEST