Round 919,827 to each place value in the table

Round 919,827 To Each Place Value In The Table

Answers

Answer 1

Nearest 1000: 920,000

Nearest 100: 919,800

Nearest 10: 919,830

Answer 2

Answer:

nearest 1000- 10,000

nearest 100- 800

nearest 10- 30


Related Questions

What is the reason for each step in the solution of the equation?
-5(x – 6) = 10x
Drag and drop the reasons into the boxes to correctly complete the table.​

Answers

Answer:

Step-by-step explanation:

-5(x – 6) = 10x

-5x+30=10x

-5x-10x = -30

-15x = -30

x= -30/-15 = 2

How do you find the product of -2(3.1)

Answers

Answer:

- 6.2

Step-by-step explanation:

The product of - 2 (3.1) is - 6.2.

Brackets mean to multiply so we have to multiply the - 2 by 3.1 which gives a result of - 6.2.

The coordinates of the verticals of JKL are J(-2,1), K(-1,3) and L(-3,4). Can someone please check my answer?

Answers

Your answer is correct

If y(x) = 3(x+5) +-, what is
a + 2)?

Answers

Answer:

f(a + 2) = 3a + 21

Step-by-step explanation:

f(x) = 3(x+5)

x = a + 2

f(a + 2) = 3(a + 2 + 5)

f(a + 2) = 3(a + 7)

f(a + 2) = 3a + 21

Please answer this correctly

Answers

Answer:

Kang

Step-by-step explanation:

Janelle ran longer than Kang

Janelle>Kang

Janelle ran shorter than Annette

Annette>Janelle>Kang

Janelle ran longer than John and John ran longer than Kang

Annette>Janelle>John>Kang

Kang will be the answer :DD

Assume that a bacteria population doubles every second. Which of the following tables of data, with X representing time in seconds and y representing the count of bacteria, could represent the bacteria population with respect for time?
(answers in the pic)​

Answers

Answer: Table A

Step-by-step explanation:

Because it doubles every second. At 0s, its 3. Then at 1s, it doubles which means 3x2=6, which is in table. then at 2s, that doubles to 6x2=12....and so on

I can’t do math someone help me out lol 6.51-9.32+h=1.02

Answers

Answer:

h = 3.83

Step-by-step explanation:

Solve for h:

h - 2.81 = 1.02

Add 2.8100000000000005` to both sides:

h + (-2.81 + 2.81) = 2.81 + 1.02

2.81 - 2.81 = 0:

h = 1.02 + 2.81

1.02 + 2.81 = 3.83:

Answer: h = 3.83

Donnie and Tania are math tutors. The amount Donnie charges for a session h hours long is represented by the function D(h) = 40h + 10. Tania charges a flat fee of $30 plus $15 an hour. Write a function, T(h), that represents the amount in dollars that Tania charges for h hours of tutoring. Graph both functions on the same coordinate grid, and label each line. Compare the slopes and y-intercepts of the graphs.

Answers

Answer:

Step-by-step explanation:

Answer:

[tex]T(h)=15h+30[/tex]

The graph is shown below.

Step-by-step explanation:

The amount Donnie charges for a session h hours long is represented by the function

[tex]D(h)=40h+10[/tex]

Tania charges a flat fee of $30 plus $15 an hour. The amount in dollars that Tania charges for h hours of tutoring is represented by the function

[tex]T(h)=15h+30[/tex]

Slope intercept form of a line is y=mx+b, where m is slope and b is y-intercept.

For Donnie:

Slope = 40 and y-intercept = 10

For Tania:

Slope = 15 and y-intercept = 30

It means slope of Donnie is greater than Tania and y-intercept of Tania is greater than Donnie.

Table of values for Donnie:

x      y

0     10

1     50

2     90

Table of values for Tania:

x      y

0     30

1     45

2     60

Plot these ordered pair on same coordinate plane and connect them to draw both functions.

The graph is shown below.

Need help ASAP 3 question. WILL GIVE BRAINLIEST

Answers

Answer:

Exact form: 11/125

Decimal Form: 0.088

Step-by-step explanation:

It took Reza 2 hours to edit 6 math
problems. At that rate, how many math
problems could Reza edit in 45 hours?

Answers

Answer:

135

Step-by-step explanation:

My method 45 hours - 1  so i could divide by 2 because its 2 hours every 6 problems and 1 hour would be 3 math problems we can add that to the total

44 / 2 = 22, 22 * 6 = 132, 132 + 3 = 135

Alternate method

45 * 3 = 135

135
45/2 =22.5x 6 = 135

What type of number is -5.41? 1. Whole number 2. integer 3. Rational 4. Irrational

Answers

3. it’s rational ...........
Final answer:

The number -5.41 can be classified as a Rational number because it can be expressed as a fraction where both the numerator (-541) and the denominator (100) are integers and it's not a whole number or an integer because it's negative and has a decimal part.

Explanation:

The number -5.41 is a type of number classified as a Rational number. Rational numbers are numbers that can be written as a fraction, where both the numerator and the denominator are integers (whole numbers), and the denominator is not zero. They can also be positive, negative, or zero, and they can be represented as decimals that terminate (like 0.2 or -1.75) or repeat (like 0.333... or -0.666...).

The number -5.41 is not a positive whole number nor an integer because it is negative and has a decimal part, which disqualifies it from both categories. An irrational number, on the other hand, is a number that cannot be expressed as a simple fraction, which clearly does not apply to -5.41 as it can be easily expressed by the fraction -541/100.

Learn more about Rational Numbers here:

https://brainly.com/question/24398433

#SPJ3


50 grams/Centimeters = kilograms/meters

Answers

Answer:

50g/cm is equal to 5 kg/m

Step-by-step explanation:

as we know that:

10g/cm = 1 kg/m

so,

50g/cm = 5kg/m

10g/cm = 1kg/m
50g/cm = ?? Kg/m
?? Kg/m = 50/10 = 5
So 10g/cm = 5 kg/m

Solve for x: 2/3(x − 2) = 4x.

A. x = -2/5
B. x = -5/2
C. x = 2/5
D. x = −2

Answers

Answer:

a

Step-by-step explanation:

Answer:

[tex]\large\boxed{A.\ x=-\dfrac{2}{5}}[/tex]

Step-by-step explanation:

[tex]\dfrac{2}{3}(x-2)=4x\qquad\text{multiply both sides by 3}\\\\3\!\!\!\!\diagup^1\cdot\dfrac{2}{3\!\!\!\!\diagup_1}(x-2)=(3)(4x)\\\\2(x-2)=12x\qquad\text{divide both sides by 2}\\\\\dfrac{2\!\!\!\!\diagup^1(x-2)}{2\!\!\!\!\diagup_1}=\dfrac{12\!\!\!\!\!\diagup^6x}{2\!\!\!\!\diagup_1}\\\\x-2=6x\qquad\text{subtract}\ x\ \text{from both sides}\\\\x-x-2=6x-x\\\\-2=5x\qquad\text{divide both sides by 5}\\\\\dfrac{-2}{5}=\dfrac{5\!\!\!\!\diagup^1x}{5\!\!\!\!\diagup_1}\\\\-\dfrac{2}{5}=x\to x=-\dfrac{2}{5}[/tex]

What is the lower quartile of 27,5,11,13,10,8,14,18,7 a. 7 b. 7.5 c. 8 d. 8.5

Answers

Answer:

Lower Quartile = 7.

Step-by-step explanation:

Given  : 27,5,11,13,10,8,14,18,7

To find : What is the lower quartile .

Solution : We have given 27, 5, 11, 13, 10, 8,  14 , 18 , 7.

Step 1 : Arrange in order

5 , 7 ,8 ,10 ,11, 13 , 14 ,18 , 27.

Step 2 : divide in to Quartile

Lower Q1 = 5 ,7 ,8

Middle Q2 = 10, 11 , 13.

Highest Q3 = 14 ,18 , 27.

Hence Lower Quartile = 7.

Therefore, Lower Quartile = 7.

Answer:

A=7!

Step-by-step explanation:

HELP ASAP PLEASE ONLY #4,6,8,10,12,14,16​

Answers

Answer:

Step-by-step explanation:

Oof, all 6?  That's not fun.  

I'm going to show you one for the first bunch, (4-12) and hopefully you can get the rest.  If not let me know and I can more carefully work you through some others on here.

4)  So first we need the angle.  How do we find that?  Well, we know it's somewhere between 270 and 360 degrees (or 3pi/2 and 2pi radians) since it's in the fourth quadrant.    The method to finding the angle is ifferent for each quadrant, but it's nice to know around where you'll get.  Anyway,, if we take 360 and subtract that little space  that is unlabeled  we will know  the rest.    Hopefully that makes sense, but let me know if not, it's important to understand.  Maybe think of what happens if you add the two together, you get around the whole circle then.  

Anyway, to find that little sliver, we are going to construct a right triangle wherethe x axis is one side.  If you draw a line connecting point p and the x axis you have this right triangle.  I am going to call this sliver we don't know s.  ANyway, now we use trig here.  

s = arcsin(3/5) (you can find 5 pretty easily but let me know if you don't see it.)

You may think to use -3 instead of 3, and  it wouldn't be a huge mistake, it will just give you the negative version of what we want.  

Anyway, now we know theta is 360-s (or 2pi-s).  You can solve s or leave it as arcsin(3/5) so you don't have to round.

Now we can solve the trig functions.  If you don't know the sum and difference trig identities  you will have to round.  They are pretty simple formula though.  For instance, sin(2pi - arcsin(3/5)) = sin(2pi)cos(arcsin(3/5))-cos(2pi)sin(arcsin(3/5)) = 0 - 3/5 = -3/5  You will also want to know that s = arcsin(3/5) = arccos(4/5) = arctan(3/4).  ROunding will get you close but not exact.

Again, let me know ifyou need any more help, they should just be a lot of doing the same thing over and over and over again though.  

14)  For 14 and 16 you just need to know how the graphs of sin, cos and tan look.  Is this something you have trouble with?  Like could you draw the graphs at the intervals of increasing/ decrasing and all.  if not I can give a quick explanation.

The center is open for 11 hours each day. Each party takes three hours what is the maximum number of parties the Center can host in a day

Answers

it can host three party’s a day

The maximum number of parties the Center can host in a day is 12.

What is equation?Equations are mathematical statements with two algebraic expressions flanking the equals (=) sign on either side. It demonstrates the equality of the relationship between the expressions printed on the left and right sides. We have LHS = RHS (left-hand side = right-hand side) in every mathematical equation. To determine the value of an unknown variable that represents an unknown quantity, equations can be solved. A statement is not an equation if it has no "equal to" sign. It will be regarded as a phrase.Mathematicians refer to equations with a degree of 1 as linear equations. The largest exponent of terms in these equations is 1, which equals. These can also be broken down into linear equations with one variable, two variables, three variables, etc. A linear equation with the variables X and Y has the conventional form aX + bY - c = 0, where a and b are the corresponding coefficients of X and Y and c is the constant.

Given, the center is open for 11 hours each day and each party takes three hours. There are 4 rooms.

Therefore, 11 ÷ 3 = 3 (approx)

Each room can host 3 parties each day.

=3 × 4 = 12

The center can host up to 12 parties in a day.

To learn more about equation, refer to

https://brainly.com/question/25976025

#SPJ2

If every 9 Points Equals 1 Dollar How Many Points Do I Need To Make One Thousand Dollars?


First One To Answer Correctly Gets Brainliest!


It has to be correct.

pls hurry

Answers

Since 9 points is a dollar and you need a thousand dollars multiply 1000 by 9

9*1000=9000

Answer: 9,000$

Step-by-step explanation: if 9 = $1

You multiply 9 by $1,000 and get 9,000

Evaluate 2x^2 – 1 when x=3

Answers

Answer:

17

Step-by-step explanation:

Given: 2x² – 1

when x=3

2(3)² – 1

= 2(9) -1

= 18 - 1

= 17

Answer:

17 .

Step by step explanation:

Substitute the value of x into the equation and square it.

the equation then becomes 2(3)^2- 1

but 3^2 =3×3 =9

So the equation is changed to 2(9)-1 after the simplification

given you 18-1

=17

what is 25 ties 3 divited by 19

Answers

Answer:3.9

Step-by-step explanation:

Answer: 25 x 3 divided by 19 is 3.94736842105

What are the solutions of the following equation?
4|x -9| +9 = -3|x -9| +9 4∣x−9∣+9=−3∣x−9∣+9

Answers

Answer:

x = 9

Step-by-step explanation:

4∣x−9∣+9 = −3∣x−9∣+9

cancel equal terms on both sides of the equation

4∣x−9∣+9 = −3∣x−9∣+9

the statement is true but only if both sides equal 0

4∣x − 9∣= −3∣x − 9∣4 x | x - 9| = 0−3∣x − 9∣= 0

solve the equation for x

4x |x -9| = 0

divide both sides of the equation by 4

|x-9| = 0

when the absolute value of x - 9 equals 0, then x - 9 = 0

x - 9 = 0

move the constant to the right side and change it´s sign

x - 9 = 0x = 9

so the answer would be x = 9

Answer: it's x=9

Step-by-step explanation:

Use complete sentences to describe what it means to prove a statement in Geometry.

Answers

Answer:

Step-by-step explanation:

To use the information and to show, using work, how to step by step solve a problem.

Answer:

He's correct.

Step-by-step explanation:

A pond is being drained through an outlet pipe, then will be filled through an inlet pipe. If the inlet pipe can fill the pond in 9 hours and the outlet pipe can empty the pond in 15 hours, how long would it take to fill the pond if the outlet pipe was left open?

Answers

Answer:

22.5 hours

Step-by-step explanation:

I am using "1 pond" to mean the volume of water that fits in the pond.

The inlet pipe fills the pond in 9 hours.

The filling rate is (1 pond)/(9 hours) = 1/9 pond/hour

The outlet pipe empties the pond in 15 hours.

The emptying rate is (1 pond)/(15 hours) = 1/15 pond per hour

The difference in rates is the net rate at which the pond is filling up.

1/9 pond/hour - 1/15 pond/hour =

= 5/45 pond/hour - 3/45 pond /hour

= 2/45 pond/hour

The pond is filling at a rate of 2/45 pond/hour.

To find the time it takes to fill the pond, we divide 1 pond by the rate.

(1 pond)/(2/45 pond/hour) = 45/2 hour = 22.5 hours

what is 80 + 80 equals 80 + 80 * 80 equals ​

Answers

Answer:

80+80=160  

80+80+80=240

240 >160

so no it is not equal

thank you for your time!

Step-by-step explanation:

Final answer:

In Mathematics, the order of operations (BOMDAS or BIDMAS) dictates that multiplication operations should be performed before addition. Hence, in the mathematical expression '80 + 80 equals 80 + 80 * 80 equals', the multiplication operation (80*80) is performed first, resulting in '80 + 6400 = 6480'. Therefore, 80 + 80 equals 6480.

Explanation:

In Mathematics, the operation order matters, this order is known by the acronym BOMDAS or BIDMAS, which stands for Brackets, Orders, Multiplication and Division, and Addition and Subtraction. it is used to clarify which procedures should be performed first in a given mathematical expression.

In your question, '80 + 80 equals 80 + 80 * 80 equals', we have both addition and multiplication operations. According to BIDMAS rules, we perform multiplication first before addition. Hence, the given expression is equivalent to 80 + 80 equals 80 + (80 * 80), where (80*80) should be calculated first.

Putting this into practice, we get: 80 + (80 * 80) = 80 + 6400 = 6480. Therefore, 80 + 80 equals 6480, based on the principles of BIDMAS or BOMDAS.

Learn more about Mathematical Operations here:

https://brainly.com/question/8959976

#SPJ12

help please and thank you!!!

Answers

Hello!

So, let's go over some information we know. We know that all the interior angles of a triangle add up to 180 degrees. We know that a line measures 180 degrees. We, therefore, know that angles which make up a line are supplementary, and must add up to 180 degrees.

So, first, we can find angle ABC. We can find this because angle ABC and ABT add up to 180 degrees, and we know the measure of ABT to be 125 degrees. Therefore:

ABC + 125 = 180

ABC = 55 degrees

Now, we can find angle ACB. We can find this as we have angle ABC and CAB, and angle ACB + ABC + CAB = 180 degrees (as they are the three interior angles of triangle ABC). ABC measures 55 degrees, and CAB 60 degrees. Therefore:

55 + 60 + ACB = 180

115 + ACB = 180

ACB = 65 degrees

Finally, we can find angle ACR based off of ACB, as ACB and ACR make up one line, and, therefore, add up to 180 degrees. ACB measures 65 degrees.

ACR + 65 = 180

ACR = 115 degrees

Therefore, your answer is choice 2, or 115 degrees.

Hope this helps!

Answer:

115°

Step-by-step explanation:

m∠ABC = 180° - 125° = 55° (angles in a straight line add up to 180°)

Given that m∠CAB = 60°,

Then m∠ACR = m∠CAB + m∠ABC (exterior angle is equal to the sum of opposite interior angles).

m∠ACR = 60° + 55° = 115°

in the diagram below, <AFB = <EFD. if m<EFD = (5x+6)°, m<DFC = (19x-15)°, and m<EFC = (17x+19)°, find m<AFE​

Answers

Answer:

m<AFE​ =  128°.

Step-by-step explanation:

Step 1: Find the value of x

Angle EFD + Angle DFC = Angle EFC

5x + 6 + 19x - 15 = 17x + 19

24x - 9 = 17x + 19

7x = 28

x = 4

Step 2: Find all angles

Angle AFB=Angle EFD= 5x + 6

5(4) + 6 = 26°

Angle DFC = 19x - 15

19(4) - 15 = 61°

Step 3: Find angle AFE

Line BD is a straight line and all angles on a straight line are equal to 180°.

Angle AFB + Angle AFE + Angle EFD = 180°

26 + BFC + 26 = 180°

BFC = 180 - 52

BFC = 128°

Therefore, m<AFE​ is equal to 128°.

!!

The measure of m<AFE  if m<EFD = (5x+6)°, m<DFC = (19x-15)°, and m<EFC = (17x+19)° is 128degrees

Angle is the point where two or more lines meet. From the given diagram:

m<EFC = m<EFD + m<DFC

Given the following:

m<EFC = 17x + 19

m<EFD = 5x+6

m<DFC = 19x - 15

Substitute the given values into the expression

17x + 19 = 5x + 6 + 19x - 15

17x - 5x - 19x = -19 - 9

12x - 19x = -28

-7x = - 28

x = 28/7

x= 4

Get the angle m<AFE

m<AFE  + m<ABF + m<EFD = 180

Since  <AFB = <EFD

m<AFE  + m<EFD + m<EFD = 180

m<AFE + 2m<EFD = 180

m<AFE + 2(5x+6) = 180

m<AFE + 2(5(4) + 6) = 180

m<AFE +2(26) = 180

m<AFE + 52 = 180

m<AFE = 180 - 52

m<AFE = 128 degrees

Hence the measure of m<AFE is 128degrees

Learn more here: https://brainly.com/question/16686601

Find the sum. Write the addition property you used. 28+29+42=

Answers

Step-by-step explanation:

28+29=57

57+42=99 so 99 should be your answer

Answer:

Step-by-step explanation:

First your gonna brake up each number and seperate them for example

28

29

42

then your going to add up the ones side, 8,9,2, to get 19.

Then your going to add the tens side, 2,2,4, to get 8.

take the one from 19 and put it in the tens place to get 9 in the tens and 9 in the ones.

put 9 and 9 together to get 99.

Fill in the table using this function rule.
y=28 - 3x
X Y
1
3
4
6

Answers

Answer:

So, you just end up plugging in your numbers.

y = 28 - 3(1)

y = 28-3

y = 25

Y = 28 - 3(3)

y = 28 - 9

y = 19

y = 28 - 3x

y = 28 - 3(4)

y = 28 - 12

y = 16

y = 28 - 3x

y = 28 - 3(6)

y = 28 - 18

y = 10

Step-by-step explanation:

The completed table is:

X   Y

1   25

3   19

4   16

6   10

How to fill the table

To fill in the table using the function rule y = 28 - 3x, we can substitute the given values of x into the equation to find the corresponding values of y.

X Y

1 28 - 3(1) = 28 - 3 = 25

3 28 - 3(3) = 28 - 9 = 19

4 28 - 3(4) = 28 - 12 = 16

6 28 - 3(6) = 28 - 18 = 10

So, the completed table is:

X Y

1 25

3 19

4 16

6 10

For each value of x, we substituted it into the function rule and performed the necessary calculations to determine the corresponding value of y.

Learn more about function rule at

https://brainly.com/question/30139621

#SPJ6

In which pair of numbers is the first number a multiple of the second number?

Group of answer choices

27, 9

25, 6

8, 72

52, 3

Answers

Answer:

27,9

Step-by-step explanation:

9x3=27

To do such problems we need to know the concept of multiple of a number.

A multiple is a number that is the result of multiplying a number by an integer (not a fraction).

Given options,

a.)  27, 9

We can write 27 as 9 x 3, therefore, we can see that 27 is a multiple of 9.

b.)  25, 6

We can write 25 as 5 x 5, we can see that 25 is not a multiple of 6.

c.) 8, 72

We can write 8 as 2 x 2 x 2, we can see that 8 is not a multiple of 72.

d.)  52, 3

We can write 52 as 2 x 2 x 13, we can see that 52 is not a multiple of 3.

Learn more about Multiple:

https://brainly.com/question/1562995

Your water is 5/6 full. After Tennis Practice, the bottle is 3/8 full. How much water did you drink?

Answers

Answer: 11/24

Step-by-step explanation:

5/6 - 3/8 = 11/24

What is 40% of $20 show the work too please :)

Answers

Answer:

$8

Step-by-step explanation:

Convert 40% into decimal  form: 0.4

Multiply it by 20.

=0.4 * 20

Simplify 0.4 * 20

= 8

Other Questions
Extra pairs of shoes and music downloads are examples of A regular polygon has 24 sides. What's the measure of each exterior angle?A. 18B. 15C. 20D. 16 Mason is restoring a car and has already spent $3500 on the restoration. He could sell the car now for $2800. However, if Mason does an additional $2000 of work, the car would be worth $5000 to potential buyers. What should Mason do? 100.0 kg of liquid methanol and 100.0 kg of liquid water are mixed in a stirred tank. Assuming volume additivity of methanol and water, determine the moles and volumes of the two substances in the mixture. M(l) W(l) MW (kg / kmol) 32.04 18.01 rho (kg / L) .791 1.00 1. kmol of methanol? 2. kmol of water? 3. Liters of methanol? 4. L of water? Before the industrial revolution in 1800 the concentration of carbon in Earths atmo- sphere was 280 ppm. The concentration in 2015 was 399 ppm. What is the percent increase in the amount of carbon in the atmosphere? Please help me idk this Blood viscosity is highly variable in healthy individuals under resting conditionsa. Trueb. False List and describe the function of each of the four components of blood. The decisions concerning an organization's goals and future plans are called a. tactical decisions. b. strategic decisions. c. operational decisions. d. financial decisions. Which of the following identifies the structural hierarchy that makes up the pulmonary system in order of increasing complexity? A pulmonary system, lung tissue, lung, lung cell B lung cell, lung tissue, lung, pulmonary system C pulmonary system, lung tissue, lung cell, lung D lung tissue, lung, lung cell, pulmonary system complete 2x+21= using only the communtative property of addition When Venus is 45,000,000 kilometers from Earth, it has an angular size of 55 arc seconds. From this, what is the diameter of Venus, in kilometers? Mark earned $240 in the first week and earns $680 in the fifth week. How much will he earn in the 20th week (suppose his earnings each week have the same increase) Plan to spend approximately 30 minutes to complete this activity. The market value of the equity of Ginger, Inc., is $635,000. The balance sheet shows $39,000 in cash and $215,000 in debt, while the income statement has EBIT of $96,400 and a total of $168,000 in depreciation and amortization. What is the enterprise valueEBITDA multiple for this company? The market value of the equity of Ginger, Inc., is $635,000. The balance sheet shows $39,000 in cash and $215,000 in debt, while the income statement has EBIT of $96,400 and a total of $168,000 in depreciation and amortization. What is the enterprise valueEBITDA multiple for this company What do think the possible reason that Islam didnt spread to more areas in Europe write 1.888... as a mixed number Ocean water is sinking at the North Atlantic Buoy Station. What happens when water of a high density sinks? A project has earnings before interest and taxes of $14,600, fixed costs of $52,000, a selling price of $29 a unit, and a sales quantity of 16,000 units. All estimates are accurate within a plus/minus range of 3 percent. Depreciation is $12,000. What is the base case variable cost per unit? Explain how a testcross can provide evidence for or against linkage. Which of the following statements about resonance are correct? Which of the following statements about resonance are correct? Atoms can move between different resonance structures. Resonance generally involved lone pairs, pi bonds, and formal charges. Each resonance structure must be a valid Lewis structure. Resonance structures are separated by a double-headed arrow: OElectrons can move between different resonance structures. Resonance often involves sp3 hybridized carbon atoms. The actual molecular structure will alternate between all possible resonance structures.