what is the best approximation of the volume, in cubic units, of a cone of diameter 20 and height 13

Answers

Answer 1
Hello!

to solve this, use the following equation:
divide the diameter by 2 to get the radius

π[tex] r^{2} [/tex][tex] \frac{h}{3} [/tex]

and you will have:
1361.36 cubic units

I hope this helps, and have a nice day!
Answer 2

The best approximation for the volume of the cone in cubic units is 1361.357 units³.

What is Volume?

Volume of a three dimensional shape is the space occupied by the shape.

Given that,

Diameter of the cone = 20

Radius of the cone, r = Half of diameter

                                = 20/2 = 10

Height of the cone, h = 13

Volume of the cone = 1/3 π r² h

                                  = 1/3 π (10)² (13)

                                  = 1361.357 units³

Hence the volume is 1361.357 units³.

Learn more about Volume here :

https://brainly.com/question/29767724

#SPJ2


Related Questions

one serving of crackers is 3/10 of the whole box of crackers. bella ate 3 servings last week. what fractonof the box did she eat?

Answers

Well, if she ate 3 servings and one serving equals 3/10 then Bella ate 9/10 of the box of crackers.

plz help me!!!!!!! 

Instructions: Select the correct answer from each drop-down menu. When p2 – 4p is subtracted from p2 + p – 6, the result is . To get p – 9, subtract from this result.



 -3p-6.       4p+3
5p-6           4p-15
4p+6.          4p+12

Answers

When p2 – 4p is subtracted from p2 + p – 6, the result is:
p2+p-6-(p2-4p)=p2+p-6-p2+4p=5p-6

To get p – 9, subtract from this result x:
5p-6-x=p-9
Solving for x:
5p-6-x+x-p+9=p-9+x-p+9
4p+3=x
x=4p+3

Answer:
1) When p2 – 4p is subtracted from p2 + p – 6, the result is 5p-6
2) To get p – 9, subtract from this result 4p+3

I need step by step instructions on how to get the y-intercept for the following function:

f(x)=x^3-18x^2+107x-210.

Answers

luktdkilfdiykfg;oizxkuilouyk7it8rl,kvkuc kugc ulv lug 

How long does it take for a letter to get from orlando to los angeles?

Answers

On average 2 to 3 days :)

The area of a sector of a circle is given by the formula below. What is the solution for S?

Answers

So we have the formula for the area of a sector of a circle: [tex]A= \pi r^2( \frac{s}{360} )[/tex]
where
[tex]A[/tex] is the area of the sector
[tex]s[/tex] is the central angle

To solve for [tex]s[/tex], we are going to divide both sides of the equation by [tex] \pi r^2[/tex], and then we are going to multiply both sides of the equation by 360°:
[tex]A= \pi r^2( \frac{s}{360} )[/tex] 
[tex] \frac{A}{\pi r^2} = \frac{ \pi r^2( \frac{s}{360} )}{\pi r^2} [/tex]
[tex] \frac{s}{360}= \frac{A}{\pi r^2} [/tex]
[tex]\frac{s}{360}(360)= \frac{A}{\pi r^2} (360)[/tex]
[tex]s= \frac{360A}{\pi r^2} [/tex]

We can conclude that the solution for s is: [tex]s= \frac{360A}{\pi r^2} [/tex]

Find the fifth roots of 32(cos 280° + i sin 280°).


Answers

I) Let z = 32 (cos 280 degrees + i sin 280 degrees) 
= 32 (cos (k* 360 + 280) + isin (k*360 + 280)), where k = integer
II) z^ (1/5) = (32 (cos (k*360 + 280) + i sin (k*360 + 280))) ^ (1/5)
then,
z^ (1/5) = 2(cos ((k*360 + 280)/5) + i sin((k*360 + 280)/5))
We apply De Moivre's theorem:
z^ (1/5) = 2(cos(72k + 56) + i sin (72k +56))
We can get the five roots by assigning k = 0, 1, 2, 3, and 4
When K = 0, 1st root = 2 + i sin (cos 56 + i sin 56)k = 1, 2nd root = 2 (cos 128 + i sin 128)k = 2, 3rd root = 2 (cos 200 + i sin 200)k = 3, 4th root = 2 (cos 272 + i sin 272)k = 4, 5th root = 2 (cos 344 + i sin 344)

The fifth root is 5th root = 2 (cos 344 + i sin 344)

Correct Answer:

z1= 2(cos 56 deg + i sin 56 deg)

z2= 2(cos 128 deg + i sin 128 deg)

z3 = 2(cos 200 deg + i sin 200 deg)

z4 = 2(cos 272 deg+ i sin 272 deg)  

z5 = 2(cos 344 deg+ i sin 344 deg)

Step-by-step explanation:

De Moivre's Theorem--> e^i theta = cos theta + i sin theta

The fifth root of 32 is 2 and 280/5 is 56

z1= 2(cos 56 deg + i sin 56 deg)

360deg/ 5 = 72 deg

(If it was asking for cubed root u would do 360/3. whatever the root is you divide that by 360)

z2= 2(cos 56 + 72) + (i sin 56 + 72)

z2= 2(cos 128 deg + i sin 128 deg)

z3 = 2(cos 128 + 72) + ( i sin 128 + 72)

z3 = 2(cos 200 deg + i sin 200 deg)

z4 = 2(cos 200 + 72) + (i sin 200 + 72)

z4 = 2(cos 272 deg + i sin 272 deg)  

z5 = 2(cos 272 + 72) + (i sin 272 + 72)

z5 = 2(cos 344 deg + i sin 344 deg)

deg means degrees

Simplify i^41. (2 points) i −1 −i 1

Answers

Answer:

[tex]\large\boxed{i^{41}=i}[/tex]

Step-by-step explanation:

[tex]i=\sqrt{-1}\\\\i^2=-1\\\\(-1)^2=1\\\\\text{Use}\ a^n\cdot a^m=a^{n+m}\ \text{and}\ (a^n)^m=a^{nm}:\\\\i^{41}=i^{40+1}=i^{40}\cdot i=i^{2\cdot20}\cdot i=(i^2)^{20}\cdot i=(-1)^{20}\cdot i=1\cdot i=i[/tex]

Answer:

i

I got this right on the test!!

At the start of the year northern lights had $8000 worth of merchandise. What do we know about northern lights?

A. The company ended with a net income last year

B. It’s a retail business

C. The company ended with a net loss last year

D. It’s a service business

Answers

Answer:

B. It's a retail Business

Step-by-step explanation:

Just by knowing that they have money worth in merchandise, you can say that they sell as a retail business, the first option A. is not posible because they dont have an income they just have inventory worth money. the C. is not possible because having $ 8000 positive value does not constitute loss and D. it's a service business, could be but the merchandise does not suffice all information.

A town has a population of 5000 and grows at 2% every year. What will be the population after 5 years, to the nearest whole number?

Answers

((((5000*1,02)*1,02)*1,02)*1,02)*1,02 = 5000*1,02^5 = 5520

The population of a town with an intial population of 5000, that grows at 2% every year would be 5520 after 5 years

What is an equation?

An equation is an expression that shows the relationship between two or more variables and numbers.

Let y represent the population of the town after x years.

The population of 5000 grows at 2% every year. Hence:

100%+2% = 1.02, this gives:

y = 5000(1.02)ˣ

After 5 years:

y = 5000(1.02)⁵ = 5520

The population of a town with an intial population of 5000, that grows at 2% every year would be 5520 after 5 years

Find out more on equation at: https://brainly.com/question/2972832

What is the standard deviation of the data set? 29, 36, 41, 53, 45, 30, 60

Answers

The standard deviation for the set of number will be found as follows:
mean=( 29 + 36 + 41 + 53 + 45 + 30 + 60)/5=294/7=42
next:
sum of (x-mean)^2=[(29-42)^2+(36-42)^2+(41-42)^2+(53-42)^2+(45-42)^2+(30-42)^2+(60-42)^2]
=804
thus the variance will be:
var=(804)/(7-1)=134
thus the standard deviation will be:
σ=√134=11.576

There is a spinner with 15 equal areas, numbered 1 through 15. If the spinner is spun one time, what is the probability that the result is a multiple of 5 or a multiple of 3?

Answers

Answer:

1/15

Step-by-step explanation:

Final answer:

The probability of spinning a number on a spinner with 15 equal areas that is a multiple of 5 or a multiple of 3 is 7/15, as there are 7 favorable outcomes (3, 5, 6, 9, 10, 12, 15) out of 15 possible results.

Explanation:

The question asks for the probability of spinning a number that is either a multiple of 5 or a multiple of 3 on a spinner with 15 equal areas numbered 1 through 15. To solve this, we need to identify the multiples of each within the range of numbers on the spinner and then use the principles of probability to find the chances of landing on one of those multiples when the spinner is spun once.

The multiples of 5 between 1 and 15 are 5, 10, and 15. The multiples of 3 are 3, 6, 9, 12, and 15. Note that 15 is a multiple of both 5 and 3, so it should only be counted once. To avoid overcounting, we will list each multiple only once, which gives us the numbers 3, 5, 6, 9, 10, 12, and 15. The probability of landing on any specific number on the spinner is 1 out of 15 because there are 15 equally likely outcomes.

Since we have 7 such favorable outcomes, the probability is calculated as the number of favorable outcomes over the total number of possible outcomes, which is 7/15. So, the probability of spinning a number that is a multiple of 5 or a multiple of 3 on one spin is 7/15.

Learn more about Probability here:

https://brainly.com/question/32117953

#SPJ3

Given that f(x) = x2 − 4x − 3 and g(x) = the quantity of x plus three, over four, solve for f(g(x)) when x = 9. 



−6

3

6

9

Answers

Hello! To find the composition of functions we want to take all the x values in f(x) and replace them with g(x). Then to solve for a specific value, we plug in that value for x. Let's look at the steps below
[tex] f(x)=x^{2} -4x-3[/tex]
[tex]g(x)=\frac{x+3}{4}[/tex]

So we find
[tex]f(g(x))=f(g(9))=(\frac{9+3}{4})^2 - 4(\frac{9+3}{4})-3[/tex]
[tex] =3^2 - 4(3)-3 [/tex]
[tex]= 9-12-3=-6[/tex]
Now we want to find the solution when x is 9 so we plug in a 9 whenever we see an x




Final answer:

The solution to f(g(x)) when x = 9 is -6.

Explanation:

In mathematics, a function is a relation between a set of inputs (called the domain) and a set of possible outputs (called the codomain), where each input is related to exactly one output.

Given:

f(x) = x2 - 4x - 3, g(x) = (x + 3) / 4

To find f(g(x)) when x = 9:

Calculate g(9): Substitute x = 9 into g(x) to get (9 + 3) / 4 = 12 / 4 = 3Substitute g(9) into f(x): Substitute g(9) = 3 into f(x) to get f(3) = 32 - 4(3) - 3 = 9 - 12 - 3 = -6

Therefore, f(g(x)) when x = 9 is -6.

Which of the following shows the true solution to the logarithmic equation 3log2(2x)=3
A.x=-1
B.x=1
C. x=-1 and x=1
D. x0 x=-1 and x=1

Answers

Answer:

Option B is correct.

Step-by-step explanation:

Given logarithmic equation,

[tex]3log_2(2x)=3[/tex]

[tex]log_2(2x)=\frac{3}{3}[/tex]

[tex]log_2(2x)=1[/tex]

since base of the log function is 2.

we take power of 2 on both sides.

[tex]2^{log_2(2x)}=2^1[/tex]

2x = 2

x = 1

Therefore, Option B is correct.

6. Food Express is running a special promotion in which customers can win a free gallon of milk with their food purchase if there is a star on their receipt. So far, 147 of the first 156 customers have not received a star on their receipts. What is experimental probability of winning a free gallon of milk?

A. 11/156
B. 49/52
C. 2/39
D. 3/52*****?

Answers

if you take 156 and subtract 147 you get nine and 9/156 simplifies down to 3/52

The experimental probability of winning a free gallon of milk will be calculated as under -

It is given that, total number of outcomes = 156

Non-winning customers = 147 (it is given in the question)

Thus, the winning customers will be = Total outcomes - Non-winning customers

Expected winning customers = 156 - 147 = 9

The probability is calculated as -

Probability (Winning customer) = [tex] \frac{Winning Customers}{Total Customers} [/tex]

Probability (Winning customer) = [tex] \frac{9}{156} [/tex] = [tex] \frac{3}{52} [/tex]

99 POINTS
suppose that the weight (in pounds) of an airplane is a linear function of the amount of fuel (in gallons) in its tank. When carrying 12 gallons of fuel, the airplane weighs 2176 pounds. when carrying 46 gallons of fuel, it weighs 2399 pounds. how much does the airplane weigh if it is carrying 54 gallons of fuel?

Answers

find the difference in gallons and the difference in the weights

46 - 12 = 34 gallons

2399 - 2176 = 223 pounds
 so 34 gallons of gas weighs 223 pounds

find weight per pound: 223 pounds / 34 gallons = 6.5588 pounds per gallon
 round to 6.6 pounds per gallon

54 gallons - 46 gallons = 8 gallons

 8 gallons x 6.6 pounds per gallon = 52.8 pounds, round to 53 pounds

2399 + 53 = 2452 weight of plane with 54 gallons




For the triangle above, find sin A. a. 36° c. 0.9323 b. 50° d. 0.385

Answers

the picture in the attached figure

we know that
in the right triangle ABC
sin A=opposite side angle A/hypotenuse

in this problem
opposite side angle A=BC-----> 10
hypotenuse=AB-----> 26
so
sin A=10/36------> sin A=0.3846------> sin A=0.385

the answer is
the option d. 0.385

statement must be true??

Answers

Given that AB is the bisector of DC. The third options of all the options are True.

B is the midpoint of DC.

In geometry, to bisect an entity means to disassociate it into two equal parts. A bisector is a line, ray, or segment that divides an entity into two equal parts. For illustration, a line that bisects an angle divides the angle into two angles with equal measures. A segment that bisects a line segment divides the line segment into two segments with equal lengths. A ray that bisects an angle extends from the vertex of the angle and divides the angle into two angles with equal measures.

As it is given that AB is the bisector of DC,

therefore, B, being the foot of AB on CD is the midpoint of DC.

Since DC is bisected by AB,

therefore, [tex]\angle[/tex] ABD = [tex]\angle[/tex] ABC.

Learn more about bisector here:

https://brainly.com/question/31893955

#SPJ4

PLEASE HELP ME!! How much greater is the median number of employees at Restaurant A than the median number of employers at Restaurant B?

Answers

The median is visually the vertical line inside the box (of the box and whisker plot). 

Median of Restaurant A is 35
Median of Restaurant B is 25
Subtract the values: 35-25 = 10

Answer: 10

Which expression is equivalent to 2m(3/2m+1)+3(5/3m-2)?

Answers

c is the answer. Distribute the terms and combine like terms.

The expression is equivalent to [tex]\rm 3m^2+7m-6[/tex].

Given

Expression; [tex]\rm 2m \left (\dfrac{3}{2}m+1 \right )+3\left ( \dfrac{5}{3}m-2\right )[/tex]

How to find the equivalent expression to the given expression?

To find the equivalent expression first multiply by term then combine like terms and simplify.

Therefore,

The expression is equivalent to;

[tex]\rm =2m \left (\dfrac{3}{2}m+1 \right )+3\left ( \dfrac{5}{3}m-2\right )\\\\=2m \times 3m + 1\times 2m + 5m \times 1-3\times 2\\\\=3m^2+2m+5m-6\\\\= 3m^2+7m-6[/tex]

Hence, the expression is equivalent to [tex]\rm 3m^2+7m-6[/tex].

To know more about Expression click the link given below.

https://brainly.com/question/10628562

A safe has a 4-digit lock code that does not include zero as a digit and no digit is repeated. What is the probability of a lock without all even digits? There to get a lock code with all even digits. There are 3,024 different 4-digit lock codes. There are to get a lock code without all even digits. The probability of a 4-digit lock code without all even digits is

Answers

Answer:

it's 24, 3000, and 3000/3024

Step-by-step explanation:

Final answer:

The probability for a 4-digit lock code using numbers 1-9 with no repeats and not all even is 2,904/3,024.

Explanation:

To solve this, we need to find the total number of possible 4-digit lock codes using digits 1-9 with no repeats and not all even, then divide it by the total number of 4-digit lock codes using digits 1-9 with no repeats. Specifically, the lock code includes 5 different even numbers (2,4,6,8), and 4 different odd numbers (1,3,5,7,9). If the lock code is all even, we will have 5*4*3*2 = 120 possibilities. However, the total possibilities for 4-digit lock codes are 9*8*7*6 = 3,024. Thus the number of codes that are not all even digits is 3,024 - 120 = 2,904. Therefore, the probability for a 4-digit lock code not having all even digits is 2,904/3,024.

Learn more about Probability here:

https://brainly.com/question/22962752

#SPJ12

The mean of a set of five numbers is 4.8. Given that the sixth number is x and the mean of these six numbers is 5.5, find the value of x.

Answers

Given that the mean of the five numbers is 4.8, the total of the numbers will be:
5×4.8
=24
after adding x, the total will be:
(24+x)
the mean will be:
(24+x)/6=5.5
solving for x we get:
24+x=33
hence
x=33-24
x=9

The sixth number is 9

In p.
e. A parachute is laid out on the gym floor. The parachute has a radius of 16 feet. Which measurement is closest to the circumference of the parachute in feet.

Answers

The circumference by definition is given by:
 C = 2 * pi * r
 Where,
 r: radius of the circle.
 Substituting values we have:
 C = 2 * 3.14 * 16
 C = 100.48 feet
 Answer:
 
A measurement that is closest to the circumference of the parachute in feet is:
 
C = 100.48 feet

The circumference of the parachute is Option A (100.48 feet).

To find the circumference of the parachute, we use the circumference formula for a circle:

C = 2πr

Given the radius (r) is 16 feet, we substitute it into the formula:

C = 2π(16) = 32π

Using the approximate value of π (3.1416), we get:

C ≈ 32 × 3.1416 = 100.48 feet

Thus, the measurement closest to the circumference of the parachute in feet is 100.48 feet (Option A).

Complete question:

In PE a parachute is laid out on the gym floor. The parachute has a radius of 16 feet. Which measurement is closest to the circumference of the parachute in feet?

A. 100.48ft

B. 198.4ft

C. 49.6ft

D. 803.84ft

The sum of the digits of a two-digit number is 16. if the digits are reversed, the new number is 18 less than the original number. find the original number.

Answers

Equation
Let one digit be x
Let the other digit = y

x + y = 16
Let the original number = 10x + y
Let the reverse number = 10y + x

10x + y - 18 = 10y + x

Comment
Bring the letters to the left and the number 18 to the right.
10x - x + y - 10y = 18      Combine like terms.
9x - 9y = 18                     Divide both sides by 9
x - y = 2

Set up a set of equations and add.
x + y = 16
x - y = 2  Now add
2x = 18   Divide by 2
x = 18/2
x = 9

x + y = 16
9 + y = 16 Subtract 9 from both sides.
y = 16 - 9
y = 7

Check
Original number = 97 
Reversed number 79
Difference             18 and it checks.

y = 2f(g(x))
dy/dx = 2f'(g(x)) * g'(x)
Differentiate again:
d^2y/dx^2 = 2f''(g(x)) * g'(x) * g'(x) + 2f'(g(x)) * g''(x)
d^2y/dx^2 = 2f''(g(x)) * (g'(x))^2 + 2f'(g(x)) * g''(x)
Am I correct in saying answer D?

Answers

Yes you used the chain rule properly to follow the correct steps to get the right answer. Great job.

If you wanted, you can come up with examples for f(x) and g(x) to help confirm the answer. A quick way to do this is to use something like GeoGebra to help graph the two expressions and you'll notice that the curves match up perfectly (indicating equivalent expressions). Note: GeoGebra can handle derivatives through the Derivative[] comand or you can type the function in the input bar with a tickmark after it to tell GeoGebra to derive the function.

How do u find the height of the base??

Answers

[tex]\bf \textit{height of an equilateral triangle}\\\\ h=\cfrac{s\sqrt{3}}{2}\qquad \begin{cases} s=length~of\\ \qquad a~side\\ ------\\ s=12 \end{cases}\implies h=\cfrac{12\sqrt{3}}{2}\implies h=6\sqrt{3}\\\\ -------------------------------\\\\ \textit{area of an equilateral triangle}\\\\ A=\cfrac{s^2\sqrt{3}}{4}\qquad \begin{cases} s=length~of\\ \qquad a~side\\ ------\\ s=12 \end{cases}\implies A=\cfrac{12^2\sqrt{3}}{4}\implies A=36\sqrt{3}[/tex]

and of course as you already know the volume of the prism is just the area of the base times the length, namely A * 20.

What is the value of x?

Answers

straight line = 180, so 180-100=80, a triangle = 180, x equals to 180-(70+80) =30, the answer is a
This is actually a relatively simple problem, but because the other angle is missing, it seems complex.

The angle adjacent to the 100 degree outside the triangle is 80 degrees. We know this because it is a supplementary angle, or an angle that, when added along with another angle’s measurement, makes 180 degrees. The line is straight, so the other angle must be 80 degrees to add up with the 100 to make 180 degrees.

Now that we know the other unknown angle, we can use the fact that the sum of angles within a triangle make 180 degrees. The two angles inside the triangle that we know make 150 degrees (80 plus 50), so the final angle ‘x’ must be 30 degrees (180-150=30).

can someone please explain how to do this.

Answers

set the to equal:

x^2 - 4x+4 = 2x-4
 solve for X

subtract 2x from each side:
x^2 -6x + 4 = -4

subtract 4 from each side:

x^2 -6x = -8

add 8 to both sides:

x^2 -6x +8 = 0

factor the polynomial:

x = 4 and x = 2

using the line equation replace x with 2 and 4 and solve for y

y = 2(2) - 4 = 0
y = 2(4)-4 = 4

so the 2 points the line  crosses the curve is (2,0) and (4,4)

using those 2 points you can calculate the length:
 distance = sqrt((x2-x1)^2 +(y2-y1)^2

distance = sqrt( (4-2)^2 + (4-0)^2)

distance = sqrt (2^2 + 4^2)
 distance = sqrt (4+16)
= sqrt 20 
= 2 sqrt(5)  EXACT LENGTH


Which is the correct form of the quadratic formula? A) x = b ± b2 - 4ac a B) x = b ± b2 - 4ac 2a C) x = - b ± b2 - 4ac a D) x = - b ± b2 - 4ac 2a

Answers

Hello!

The quadratic formula is 

[tex]x = \frac{-b +- \sqrt{ b^{2}-4ac } }{2a} [/tex]

So the answer is D

Hope this helps!

The correct form of the quadratic formula is x = (-b±√(b² - 4ac)) / (2a).

Hence, option D) is the correct answer.

What is a Quadratic Equation?

Quadratic equation is simply an algebraic expression of the second degree in x. Quadratic equation in its standard form is;

ax² + bx + c = 0

Where x is the unknown

To solve for x using the quadratic formula;

x = (-b±√(b² - 4ac)) / (2a)

The correct form of the quadratic formula is x = (-b±√(b² - 4ac)) / (2a).

Hence, option D) is the correct answer.

Learn more about quadratic equations here: brainly.com/question/1863222

#SPJ2


PLLLLLLZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZ HELPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPP
Find the value of n.

Answers

The answer to this question is 23. How you get this is by adding all the sides like this: 2n+6+135+151+140+63=540. Then you just solve the equation.

An average infant is 20 inches long and weighs 7.6 pounds. if the child grows to 80 inches and keeps the same proportions,how much will the child weigh

Answers

he will weight 30.4 pounds cause 7.6 times 4 is 30.4
Other Questions
in the diagram below bc is an altitude of abd.to the nearest whole unit.what is the length of cd Identify the missing coefficient in the balanced equation and classify the type of reaction. 2Cl2 + 2KI _____KCl2 + I2 Simplify the questions that aren't crossed on the attachment, thank you "you are exercising doing aerobics or a stair climber at your fitness center. as you increase to a high intensity of exercise, you would expect the tidal volume to ______________ and the frequency of respiration to _____________." Refer to Explorations in Literature for a complete version of this story. Which statement best explains how Gold Teeths culture affects how she views her husbands illness in "My Aunt Gold Teeth"? She knows the power of her husbands religious status will heal him. She thinks his illness is a medical condition and counts on medicine to cure it. She believes religious practices have little effect on serious diseases. She believes her interest in Christian practices or evil spirits caused his illness. What were the last 2 captured south cities during the civil war Why scientists from various disciplines are able to work in field of volcanolgy The sides of a rectangle are in the ratio of 4:5. If the width is 28 in., find the length, the perimeter, and the area of this rectangle. Write x2 2x 3 = 0 in the form (x a)2 = b, where a and b are integers. A.(x 4)2 = 3B.(x 3)2 = 2C.(x 2)2 = 1D.(x 1)2 = 4 What is the molality of a solution made by dissolving 14.7 g of c6h12o6 into 150.0 ml of water? assume the density of water is 1.00 g/ml? All of the following are true statements about the European Recovery Program EXCEPT which one?A.It was often referred to as the Marshall Plan.B.It was denounced by the Soviet Union as a capitalist imperial plot.C.It was designed to give aid to Allied, neutral, and former Axis nations.D.It was rejected by the people of Germany in a nationwide vote. Pamela has started to take antibiotics, which kills most of the helpful and harmful bacteria in her body. Her doctor suggested she eat yogurt containing helpful bacteria to reestablish the bacteria in her digestive tract. Why is this important? imagine you are in a cafe wright out the following conversation between you and the waiter you greet each other you order your food and beverage he brings them to you How does a phylogenetic tree indicate major evolutionary events within a lineage? One of the mutually exclusive results of an activity conditional probability 2. a combination of one or more outcomes independent events 3. a measure of likelihood of a given result event 4. compound events whose outcomes do not affect each other outcome 5. events involving two or more activities compound events 6. probability of one event given that another has occurred probability What inmformation did presidant truman keep from stalin at the potsdam conferance? BRAINLIEST!!PLS HELP! Question 19 UnsavedAnn office building has the same number and size of office units per floor. If there are 21 units on the first 3 floors, then what is the total number of offices in the 10 story building?Question 19 options:7246370 The proper way to wash hands when handling foods is to: what are the solutions to the equation [tex] {x}^{2} = 625[/tex] In the 1980s, the US worked with neighboring countries to end the drug trafficking out of __________; by the 2000s, the fight had moved to __________.A.Colombia . . . MexicoB.Mexico . . . CanadaC.Canada . . . GuatemalaD.Guatemala . . . Colombia