what is the standard notation of the isotope H-2

Answers

Answer 1
Deutirium is the name of H-2 isotope

Related Questions

In what way is the planet Uranus unique

Answers

it is unique for many many ways: 
1.)Unlike the other planets of the solar system, Uranus is tilted so far that it essentially orbits the sun on its side, with the axis of its spin nearly pointing at the star. This unusual orientation might be due to a collision with a planet-size body, or several small bodies, soon after it was formed

is H2CO3 and Na2CO3 a buffer

Answers

Yes it is a buffer because it is a combination of weak acid and it’s conjugate salt

Answer:

No

Explanation:

A buffer solution is a combination of a weak acid and its conjugate base; for instance, carbonic acid (H2CO3) and sodium bicarbonate (NaHCO3), not sodium carbonate (Na2CO3). Buffer solutions are used as a means of keeping pH at a nearly constant value in a wide variety of chemical applications.

Can you please answer number 8 thanks

Answers

A day is added to February every four tears as a corrective measure. The Earth does not exactly revolve around the sun for 365 days. There is a small offset that is corrected by adding a day to February. This happens every four years and it is called Leap year.


Which of the following occurs when an electron moves from a higher energy shell to a lower energy shell?

A. A neutron is always lost.
B. A proton is always gained.
C. Energy is released in the form of radiation.
D. The electron must be transferred to another atom.

Answers

The answer would be C: energy is released to form radiation.

Answer: Option (C) is the correct answer.

Explanation:

When energy is supplied to an electron then on absorption of energy it tends to move from a lower energy level to higher energy level.

And, when this electron moves from higher energy level to lower energy level then excess of energy absorbed by it is released in the form of visible light or radiation.

This emission of energy is also responsible for imparting color to a compound.

Thus, we can conclude that energy is released in the form of radiation occurs when an electron moves from a higher energy shell to a lower energy shell.

Which material is the most dense?

Answers

Osmium is the most densest substance 

Which of the following solution is more dilute and explain why?a)1M b)2M c)0.1M or d)0.009M

Answers

The correct answer is option D, 0.009M

Concentration is defined as the amount of solute in a solution.

Noting the following points about concentration is helpful;

The more the amount of solute present in a solution, the more concentrated the solution is. The lesser the amount of solute present in the solution, the lower the concentration of the solution.

A high numerical value of concentration indicates that there is a higher amount of solute in the solution while a lower value of concentration indicates that there is a lesser amount of solute in the solution.

Hence, a solution with lesser concentration is said to be dilute. If the solution has a concentration of 0.009M, then it is a dilute solution.

https://brainly.com/question/1416865

what characteristic of carbon atoms helps to explain the wide variety of organic compounds ???

Answers

The characteristic is that carbon atoms can form up to 4 single covalent bonds.
Carbon atoms have 4 valence electrons, so they can gain or lose 4 electrons, or even bond with 4 more atoms

You observe heat, light, and sound released by a chemical reaction. This reaction is (2 points)

absorbing energy
consuming energy
exothermic
endothermic

Answers

exothermic reaction.

Number 10 plz :D tysm!!!

Answers

The answer is B because as plates made of oceanic crust pull apart, a crack in the ocean floor appears. Magma then oozes up from the mantle to fill in the space between the plates, forming a raised ridge called a mid-ocean ridge.

Hi!
Answer:
B) Two tectonic plates pullaway from each other, forming a rift valley or midocean ridge.
Hope this helps u! ;)
-Ari.

In swimming, you apply a force to the water to move yourself forward. The greater the water pressure, the faster you can swim. This can best be explained by one of newton's laws of motion that states A) for every force on an object that object exerts an equal and opposite force back. B) a body in motion will continue in motion unless acted upon by an outside force. C) the net force equals the mass times the acceleration of and object. D) energy cannot be created or destroyed on changed forms.

Answers

i believe the most reasonable answer is A.

In swimming, you apply a force to the water to move yourself forward. This can best be explained by one of newton's laws of motion that states for every force on an object that object exerts an equal and opposite force back. Thus option A is correct.

What is Newton's law of motion?

Newtons law of motion is three fundamental laws of classical mechanics that describe the relationship between an object's motion and the forces acting on it.

The three basic laws can be expressed as

Unless acted upon by a force, a body remains at rest or in motion at a constant speed in a straight line.When a body is acted upon by a force, its momentum's time rate of change equals the force.When two bodies exert forces on each other, the magnitude of the forces is the same but the directions are opposite.

Thus, in swimming, you apply a force to the water to move yourself forward. This can best be explained by one of newton's laws of motion that states for every force on an object that object exerts an equal and opposite force back. Thus option A is correct.

To learn more about newton's laws of motion, refer to the link below:

https://brainly.com/question/974124

#SPJ5

Can you please answer 12 and 13 thanks

Answers

12. When the sun is farthest north or south of the equator, the even is called solstice. When it is farthest to the north, it is called summer solstice and when it farthest to the south it is called winter solstice .

13. When neither hemisphere is tilted toward nor away form the sun, it is called equinox. At this time, daylight and night time is as long as each other, or they are both 12 hours long in both hemisphere. 

The escape velocity required for gas molecules to overcome the Earth’s gravity and go off to outer space is 1.12 x 103 m/s at 15oC. Calculate the molar mass of a species with that velocity. Would you expect to find He and H2 molecules in the Earth’s atmosphere? How about argon atoms?

Answers

Let us calculate the average energy of a molecule at such a temperature. The formula that gives it is E=3/2(kT) where k is the Boltzmann constant and T is the temperature in Kelvin. This formula holds for atoms, not substances with 2 or more atoms, but it is a good approximation (same order of magnitude) for other cases too. T=15+273=288K and k=1.38 × 10^(-23) J/K. Substituting, the energy is 3.97*10^(-21) Joules. The kinetic energy of an atom is also:
E=(1/2)mv*v where v is its speed and m is its mass. We know the speed, we are given to assume that it is the escape velocity and we have calculated E. Solving for m, we get:
[tex]m= \frac{2E}{v^2} [/tex]. Substituting we have that m=6.34*10^(-27) kg.
We now have to look up some mass values at a table. The most characteristic one is the mass of the hydrogen atom which is around 1.68*10^(-27) kg. We have thus that the mass of the hydrogen atom is lower than what we calculated. The mass of the He atom has around 4 times the mass, so it is around 6.7*10^(-27) kg. We thus have that the hydrogen atoms have a speed higher than the escape velocity due to their thermal motion (their mass is below the threshold that we calculated). A lot of helium atoms must be gone from the atmosphere too since the value of the mass is very close to the threshhold; if the temperature was 30C then helion could possibly leave the atmosphere. Finally, argon is much heavier than both these elements and hence its speed is going to be much smaller (mass is inversely proportional to the square of the speed when the temperature is constant). Hence, we expect a lot of the argon that was initially in the atmosphere to have stayed.

wat energy transformation occurs as the chicken cooks ?

Answers

Final answer:

The energy transformation that occurs as chicken cooks is a conversion of chemical energy from the heat source into thermal energy, which cooks the chicken. Not all of the energy converts to thermal energy for cooking, as some is lost to the environment.

Explanation:Energy Transformation in Cooking Chicken

As chicken cooks, there is an important transformation of energy that occurs. The heat from the stove is transferred to the pot and the chicken itself. This process is an example of thermal energy transfer. Specifically, chemical energy from the heat source (like gas or electricity) is converted into thermal energy, which is then absorbed by the chicken, causing the temperature of the chicken to rise and cook through.

In the kitchen, this conversion of energy type is critical in cooking all types of food, not just chicken. The energy transfer process ensures that the food changes from a raw state to a cooked state by the increased thermal energy breaking down proteins and killing bacteria, making the chicken safe to eat and more digestible.

It's important to note that during this energy transformation, not all energy is directly converted into thermal energy for cooking; some of it is lost to the environment. This demonstrates the concept of energy efficiency and that not all systems are 100% efficient.

Final answer:

The energy transformation happening as the chicken cooks is the conversion of electrical or chemical energy into thermal energy, which then cooks the chicken by denaturing its proteins.

Explanation:

The energy transformation that occurs as the chicken cooks involves converting electrical energy (if using an electric stove) or chemical energy (if using a gas stove) into thermal energy. This thermal energy is then transferred from the heat source to the chicken. As the heat is applied, the thermal energy cooks the chicken by breaking down its proteins and fats, causing a physical and chemical change in the chicken's structure. This transfer and transformation of energy are part of why the cooking process takes place.

To be more precise, when you turn on your stove, electrical energy or the chemical energy from natural gas is transformed into heat energy by the stove's heating element or burner. Then, as you place the chicken on the stove, energy is transferred as heat from the hot stove element to the cooler pot or pan, and eventually to the chicken itself. The heat cooks the chicken through processes such as denaturation of proteins, which alters the texture and flavor of the meat.

How can we find the volume of this fish tank? Please I needed but Good

Answers

Answer:

The correct answer is find the number of 1 foot cubes that fill the fish tanks.

Explanation:

Volume is defined as amount of space occupied by an object.

Number of 1 foot cubes lying on the length of fish tank ,l= 5 feet

Number of 1 foot cubes lying on the width of fish tank,w = 3 feet

Number of 1 foot cubes lying on the height of fish tank ,h= 3 feet

Volume of the cuboid fish tank will be :

The volume of fish tanks id 45 cubic feet.

Explanation:

To find the fish tank's volume, multiply its length, width, and height, represented by: Volume = Length × Width × Height, which is 5 multiplied by 3 multiplied by 3, which yields 45 cubic feet.

To determine the volume of the fish tank, envision it as a rectangular prism and determine the dimensions based on the arrangement of 1-foot cubes. The length, width, and height are given as 5 cubes, 3 cubes, and 3 cubes, respectively. By multiplying these dimensions, you calculate the total volume of the tank.

Each dimension represents the number of cubes stacked along that axis, illustrating how they fill the three-dimensional space. This multiplication reflects the total number of cubic feet the tank can contain. Once multiplied, the result represents the volume of the fish tank, providing insight into its capacity in cubic feet.

Which statement correctly describes the conservation of matter in a chemical reaction?

A. Different types of atoms may form during the change, but the total mass remains constant.

B. The number of molecules is conserved, so the total mass does not change.

C. Different numbers of atoms may form during the change, but the total mass is unchanged.

D. Atoms of each element are conserved, so the total mass does not change

Answers

Hello there!

The (best) statement that would practically describe the conservation of matter in a chemical reaction would be of that atoms of each element are conserved, so the total mass does not change.

Sense these element would be (conserved), because of this, this would practically make the balance of mass neutral. Thus, because if this, the mass wouldn't change a bit.

A. Different types of atoms may form during the change, but the total mass remains constant.

B. The number of molecules is conserved, so the total mass does not change.

C. Different numbers of atoms may form during the change, but the total mass is unchanged.

D. Atoms of each element are conserved, so the total mass does not change.

I hope this helps you!

Considering the definition of the Law of Conservation of Matter, the correct answer is option D. Atoms of each element are conserved, so the total mass does not change.

The Law of Conservation of Matter is also called the law of conservation of mass or the Law of Lomonósov-Lavoisier. This law postulates that "the mass is not created or destroyed, only transformed."  

This means that the reagents interact with each other and form new products with physical and chemical properties different from those of the reagents because the atoms of the substances are ordered differently. But the amount of matter or mass before and after a transformation (chemical reaction) is always the same, that is, the quantities of the masses involved in a given reaction must be constant at all times, not changing in their proportions when the reaction ends.  

In other words, then the mass before the chemical reaction is equal to the mass after the reaction. The exception to the rule is nuclear reactions, in which it is possible to convert mass into energy and vice versa.

Taking into account the above, the correct answer is option D. Atoms of each element are conserved, so the total mass does not change.

Learn more:

https://brainly.com/question/5248140?referrer=searchResultshttps://brainly.com/question/9434062?referrer=searchResults

Organisms can pass on genetic information through asexual or sexualreproduction.Which if the following statements best describes how asexual reproduction differs sexual reproduction

Answers

Final answer:

Asexual reproduction involves one parent and produces genetically identical offspring, while sexual reproduction involves the combination of genetic material from two parents to produce genetically varied offspring. Asexual reproduction allows many offspring to be produced quickly, whereas sexual reproduction provides genetic diversity, potentially increasing offspring survival rates in changing environments.

Explanation:

The main difference between asexual and sexual reproduction lies in the biological processes and resulting offspring. Asexual reproduction involves one parent and produces offspring that are genetically identical to that parent, while in sexual reproduction, genetic material from two parents combine to create offspring with genetic variation. Asexual reproduction methods include fission, budding, and fragmentation, making it possible for a single individual to quickly produce a large quantity of offspring that are ideally adapted to a stable environment.

In contrast, sexual reproduction creates a greater genetic diversity in offspring, providing them a higher chance of survival in changing or unpredictable environments. It typically includes processes such as internal or external fertilization of the female's eggs by the male's sperm. However, species that reproduce sexually need to maintain two types of individuals, males and females, which could be a disadvantage compared to asexual reproduction, especially when considered in terms of population growth and colonization of new habitats.

Learn more about Asexual and Sexual Reproduction here:

https://brainly.com/question/29764208

#SPJ12

A substance with a hardness of 8 will scratch a substance with a hardness of 7.

Answers

Answer:
True

Explanation:
Hardness is defined as the ability of a substance to resist being scratched. It can be described using Moh's scale

From the given, we can note that the material with hardness 8 has more resistance to being scratched that a material with hardness 7.

This means that if these two substances came in contact, the more hard substance will scratch the less hard substance.

Hope this helps :)

Answer:

- Hardness

Hardness is a mineral’s ability to resist being scratched. Minerals that are not easily scratched are hard. You test the hardness of a mineral by scratching its surface with a mineral of a known hardness. Mineralogists use the Mohs Hardness Scale, shown in Table below, as a reference for mineral hardness. The scale lists common minerals in order of their relative hardness. You can use the minerals in the scale to test the hardness of an unknown mineral.

Mohs Hardness Scale

As you can see, diamond is a 10 on the Mohs Hardness Scale. Diamond is the hardest mineral; no other mineral can scratch a diamond. Quartz is a 7. It can be scratched by topaz, corundum, and diamond. Quartz will scratch minerals that have a lower number on the scale. Fluorite is one. Suppose you had a piece of pure gold. You find that calcite scratches the gold. Gypsum does not. Gypsum has a hardness of 2 and calcite is a 3. That means the hardness of gold is between gypsum and calcite. So the hardness of gold is about 2.5 on the scale. A hardness of 2.5 means that gold is a relatively soft mineral. It is only about as hard as your fingernail.

Mohs Scale

Hardness Mineral

1 Talc

2 Gypsum

3 Calcite

4 Fluorite

5 Apatite

6 Orthoclase feldspar

7 Quartz

8 Topaz

9 Corundum

10 Diamond

sorry im so late -_-ll

Which are the products in this chemical reaction? 2C4H10 + 13O2 8CO2 + 10H2O

Answers

In the chemical reaction; 2C₄H₁₀ + 13O₂ → 8CO₂ + 10H₂O. The products of the reaction are; 8 molecules of carbon dioxide (CO₂), and 10 molecules of water (H₂O)

This chemical equation represents the combustion of butane (C₄H₁₀) with oxygen (O₂). Combustion is a type of chemical reaction where a substance reacts rapidly with oxygen, releasing energy in the form of heat and light. In the given equation, two molecules of butane (C₄H₁₀) react with 13 molecules of oxygen (O₂).

Breaking down the reaction:

On the left side (reactants):

2 molecules of butane (C₄H₁₀): C₄H₁₀ +C₄H₁₀

13 molecules of oxygen (O₂): 13O₂

On the right side (products):

8 molecules of carbon dioxide (CO₂): 8CO₂

10 molecules of water (H₂O): 10H₂O

The balanced chemical equation indicates that for every 2 molecules of butane reacting, it requires 13 molecules of oxygen. After the reaction, 8 molecules of carbon dioxide and 10 molecules of water are produced as products.

This balanced equation demonstrates the conservation of mass. The total number of atoms of each element on the left side of the arrow (reactants) is equal to the total number of atoms of each element on the right side of the arrow (products). This is a fundamental principle in chemical reactions, ensuring that matter is neither created nor destroyed, only rearranged to form new substances.

To know more about chemical reaction here

https://brainly.com/question/34137415

#SPJ6

What evidence is there that energy is conserved?

Answers

The law of conservation 

Hope this helps

~ Jordan ~

Which statement correctly describes what happens when water turns to steam in terms of energy?
A. the water absorbs energy which causes chemical bonds to break, changing water to steam.
B. the water releases energy which causes chimical bonds to break, changing water to steam.
C. the water absorbs energy which causes the water molecules to have more kinetic and potential energy, changing their configuration from a liquid to a gas. D. the water absorbs energy which causes the water molecules to have less kinetic and potential energy, changing their configuration from a liquid to a gas.

Answers

the correct answer is c
The reasonable answer is C, because when water changes to steam you are heating the substance. Therefore it is absorbing heat of energy 

PLEASE HELP ME!!!!!
The tires on Adrian's classic corvette tires are at 120kPa and 27L of air after going to California. Before he started, the tires had 20L of air. Choose the correct statement.

Question 6 options:

The original pressure must be more than 120kPa because when P increases, V decreases.


The original pressure must be less than 120kPa because when P increases, V decreases.


The original pressure must be more than 120kPa because when P increases, V increases.


The original pressure must be less than 120kPa because when P increases, V increases

Answers

the second one is correct im pretty sure

According to Boyle's law:

Pressure of given mass of ideal gas is inversely proportional to its volume at a constant temperature.

That can be represented as:

PV=Constant

Where P represents pressure, V represents volume.

Here as the volume increases that is from 20 L to 27 L, So pressure must decreases, so the original pressure must be greater than 120 kPa.

So the answer is "The original pressure must be more than 120kPa because when P increases, V decreases".

PLEASE HELP ME
Tyler found his iguana playing with a soccer ball in the basement that contained 400kPa of pressure, held 3L and was at 300K. Devin took the ball in the garage where the pressure in the ball became 350kPa and the temperature was 250K. How much space did the ball take up? Question 14 options:
1. 2.9 L
2. 2.0 L
3. 2.8 L
4. 2.5 L
5. 2.7 L

Answers

Hello!

The ball took up 2,9L

To solve this problem, we should apply the ideal gas law and clear for n (the number of moles), as this value doesn't change when Devin takes the ball to the garage:

[tex]n= \frac{P1*V1}{RT1}=\frac{P2*V2}{RT2}[/tex]

Now, we should clear this equation to find V2, as this is the value we are looking for:

[tex]V2= \frac{P1*V1*T2}{P2*T1}= \frac{400kPa*3L*250K}{350kPa*300K}=2,857L[/tex]≈2,9L

Have a nice day!

How many unpaired electrons does niobium have

Answers

Final answer:

Niobium has five unpaired electrons, with one electron from the 5s orbital and four electrons from the 4d orbitals, following Hund's rule.

Explanation:

The student asked about the number of unpaired electrons in niobium. Niobium (Nb) has the atomic number 41, which means its electron configuration is [Kr]4d45s1. In the niobium atom, there are five electrons in its outermost d and s orbitals, out of which one can be found in the 5s orbital and four in the 4d orbitals. According to Hund's rule, which states that every orbital in a subshell is singly occupied before any orbital is doubly occupied and all electrons in singly occupied orbitals have the same spin, we can expect at least one unpaired electron in niobium due to its electron configuration.

To determine the exact number of unpaired electrons, we need to look more closely: the single electron in the 5s orbital is unpaired, and within the 4d subshell, which can hold up to 10 electrons, there are four electrons. These will occupy the first four orbitals singly before pairing up, resulting in four unpaired electrons from the 4d subshell. Therefore, niobium has a total of five unpaired electrons, one from the 5s orbital and four from the 4d orbitals.

Which motion is the best model to use to illustrate passive transport?
Going over a hill
Going around a carousel
Going down a slide
Going through a tunnel

Answers

i assume with going down a slide since u urself are applying no force to move its just gravity

Answer: going down a slide.


Justification:


The term passive transport is used to the describe the movement of particles in circumsantaces that do not require the use of energy.


It is mainly used for some physical process related to particles like diffusion or osmosis.


For illustrative purposes. it is compared with the movment of an object down a hill (or a slide as in the case of this question) as the object will go from high to low without requiring the use of energy.


Please I need help with questions 1-4 and it’s very hard and I’m struggling with it and can you check if I did the punnet square label good or not and if I didn’t do it good then help me fix it and read the directions carefully

Answers

the first one you did wrong on the side its GG not GgThe second one is wrong to on the side it its Tt not TTthe third one is wrong to on the side its tt, not TTthe last one is wrong to is wrong to the top is RR and the side is rr  P.S i did this 1 year ago  :PPPP
that the one  i did to 
Read more on Brainly.com - https://brainly.com/question/9198144#readmore

HELP PLEASE What is chemical equation

A.substance present after a reaction
B.reaction in which substances combine to form a more complex compoud
C.principle that states that matter if not created of destroyed during a chemical rection
D. reaction in which one element replaces another in a compoud
E.substance present before a reaction
F.number telling how many molecules of a substance are involved in a chemical reaction
G.reaction in which compounds are broken down into simpler substances
H.uses symbols and formulas to show chemical reactions.

Answers

Chemical equation depict the number of molecules present in a substance in a chemical reaction.

Which BEST explains why people see carrots as orange?
A) The carrots reflect only orange light.
B) The carrots absorb orange light from the Sun.
C) Orange light changes direction when it hits the carrots.
D) The carrots are opaque and do not allow orange light through.

Answers

the carrots reflect only orange light

Answer:

Option A

Explanation:

Carrots are composed by a large proportion of carotenoids. These are pigments that can absorb most of the light spectrum, peaking between 450-550nm, and falling at the yellow-orange range which is around 600nm and above. Therefore, the yellow-orange light that is not absorbed reflects towards our eyes.

Will mark as Brainliest.


For the balanced equation shown below, how many moles of O2 will react with 0.3020 moles of CO2?
2C2 H5 OH + 6O2 → 4CO2 + 6H2O
Question options:

0.151 moles O2

0.201 moles O2

0.302 moles O2

0.453 moles O2

Answers

You always balance the equation first, which is done.
Set up a proportion: the answer comes out of the balanced equation.
6 mols O2:4 mols CO2:: x : 0.3020 mols CO2
6/4 = x / 0.3020 You could reduce this, but why bother. Calculators to the rescue.
Cross multiply
0.3020 *6 = 4*x
1.812 = 4x Divide by 4
1.812/4 = x
x = 0.4530 to 4 places.
D <<<< answer


Please I need help with questions 1-4 and
Question 1: Explain why scientists named the new pigment YInMn?
Question 2: How do we get pigments that are used to color materials like paint and plastics
Question 3: Do pigments of the same color have all of the same properties?
Question 4: What are two characteristics of YInMn that make it more advantageous to use than cobalt blue? Explain why these characteristic are important?
And it’s very hard and I’m struggling with it and if you need to see the picture big then click on it and it will be big

Answers

1. Scientist named the new pigment YInMn because it contains yttrium, indium and manganese elements. The symbol for yttrium is Y, indium is In and that for manganese is Mn thus, to reflect the chemical composition of pigment it is named YInMn.

2. The pigment that is used in coloring materials like paint and plastics was discovered accidently by scientists in an experiment due to mixing and heating of chemicals while manufacturing electronics. An intense blue colored compound results due to chemical combination of two or more elements.

3. No, pigments with same color do not have all the same properties. YInMn blue and cobalt blue, both are same in color, but they have different manufacturing process and YInMn is more durable than cobalt because it gets fade over time.

4. The two characteristics of YInMn are good pigment and use of nontoxic ingredients in manufacturing. It is difficult to find the blue pigments in nature, it is also difficult to manufacture them therefore, the mentioned characteristics are important.

helpppp me plzz....

Answers


2.a) warm air is lighter than cold air so thats why it's warmer upstairs than downstairs
3.d) Conduction is the process by which heat energy is transmitted through contact with neighboring molecules 
4.d) the lamp radiates heat throughout the plants 
Other Questions
1.The ordered pair ( 1, 2 ) lies in which quadrant?Quadrant IQuadrant IVQuadrant IIQuadrant III2.Find the difference. 86 - ( -17 )69-69103-1033.Simplify the expression 14 2 7.-4-1044.Write a variable expression for the word phrase, "five less than a number m".M + 55 - mM - 55 m5.Identity the expression as a numerical expression or a variable expression. 50xNumerical expression Variable expression6. the set of whole numbers and their opposites are known as ________.Absolute ValuesPositive numbersIntegersNegative numbers7.Use , or = to complete the statement. -55 ____ -56Evaluate 4( 6 ) + 7(5 - 3).118801038Find the -5 + (-6).-11-1111 Which algebraic expression represents this phrase? the product of 86 and the depth of the river El brazo de Julio le duele mucho. El mdico dice que el brazo est ---. (3 points) Question 1 options: 1) muy bien 2) roto 3) rota 4) enfermo Save Question 2 (20 points) Question 2 Unsaved Match the following with the most logical answers. (20 points) Question 2 options: Los Rayos x El tecnlogo El paciente Las muletas Le duele Grave Enfermo El molde El hospital La sala de ciruga 1.Hay muchas personas enfermas o heridas en _________. 2.________ ayudan a las personas a andar. 3.Toman ___________ en la sala de radiografa. 4.Si el paciente est muy grave, entra en _________________ . 5.Si tienes un hueso roto, te ponen __________. 6.Paco tiene un hueso roto y __________ mucho. 7.Cuando alguien est herido a causa de un accidente_____, l llega en una ambulancia 8.Cuando el paciente est _______, el mdico receta las pastillas. 9._________toma el rayo X. 10.La persona que necesita ayuda del mdico es ____________. Elton mayo's famous experiment at the hawthorne plant concluded ________. robotics has been highly successful in work environments because workers find socialization at work to be highly toxic people who perceive that management permits them to contribute to work decisions might be more productive a physical environment with dark rooms can particularly decrease productivity because it puts workers to sleep there was a human side to the work environment that essentially gets in the way and most often jeopardizes productivity What theme other than class, marriage, pride, and prejudice did you notice in your reading of chapters 1-12 of Pride and Prejudice? How does this theme relate to the four themes already discussed in the lesson and listed above? Choose at least one other theme to analyze and relate it to a theme already discussed in the lesson. Compare the ways that Austen chooses to portray both themes. Which model of urbanization did Edward ullman develop All of the following are true of the Wade-Davis Bill EXCEPT: A.The bill was written by the moderate Republicans in Congress. B.The bill made it nearly impossible for the Southern states to rejoin the Union. C.The bill contained an iron-clad oath that required that one had never born arms against the United States nor supported the Confederacy. D.The bill was pocket-vetoed by President Abraham Lincoln. What is the current in a series circuit with a resistance of 30 ohms and a potential difference of 120 volts? Mrs. Bell has a rain gauge outside. On a very rainy day, the gauge measured 2.5 inches. The actual amount of rain that fell was 2.3 inches. To the nearest tenth, what is the percent error in Mrs. Bell's measurement? sin(76)cos(31)-cos(76)sin(31) John h. harland company is a large company with 5,200 employees and almost $800 million in annual sales. the company is best known for printing personal and business checks. harland analytical services is a technology company that produces software that enables banks to gauge the behavior of their customers by tracking their spending habits. in addition, harland owns scantron, a computerized testing and assessment company. the ________ for john h. harland company includes its check-printing business, its financial software business, and its testing and assessment business. a dos las termina la clase invert to question put the subject at the end When bill is alone with sally, he apologizes by saying, "i'm sorry about getting angry yesterday. i should have informed you sooner that i rescheduled my appointments." bill's apology could be even stronger if he had included? Why do you think Chopin does not elaborate more about Mrs.Mallard death? What is the solution set for 3x>6? What is one property of a wave that determines how much it will diffract when it encounters an obstacle?-speed-amplitude-polarization-wavelengthSuppose two waves collide, and the temporary combined wave that results is smaller than the original waves. What term best describes this interaction?-diffraction-destructive interfernce-standing wave formation-constructive interfernceThe formation of a standing wave requires-the traveling of a wave for a long distance-constructive interference between two waves of slightly different frequencies-that refraction and diffraction occur at the same time in a wave-interference between incoming and reflected waves In what way are Georgia's ports and Hartsfield-Jackson International Airport similar?Question 10 options:They both operate at a fiscal loss each year.They both are operated by the Federal government.They each receive imported goods and they both export goods.They each are located in the Coastal Plain Region of Georgia. While standing on a roof, you drop a hamner. The function y=16-64t^2 represents the height y (in feet) of the hammer t seconds after it is dropped. After how many seconds does the hammer land on the ground? Michael bought a $25.00 gift for a friend. After he bought the gift, Michael had $176.89. Write and solve an equation to calculate how much money Michael had before he bought the gift. Just want to know if this is right...