Which factor cause these cooler temperatures? Check all that apply.

Which Factor Cause These Cooler Temperatures? Check All That Apply.

Answers

Answer 1

The factor that causes cooler temperatures are being closer to the ocean and ocean current bringing cooler air.

What is temperature?

Temperature can be defined as a scalar quantity that shows the degree of hottest or coldness of a body. It is measured in C⁰ or F⁰.

In the physical environment, the degree of it's coolness depends on the surroundings.

When they moved from Tennessee to California it became cooler due to the environment being closer to the ocean and ocean current bringing cooler air

Answer 2

Cooler temperatures in California compared to Tennessee may be influenced by being closer to the ocean, ocean currents bringing cooler air, and mountain ranges.

The observed cooler temperatures in California, following a move from Tennessee, can be attributed to a combination of geographical and climatic factors. Firstly, being closer to the ocean tends to have a cooling effect on the climate. The proximity to large bodies of water, such as the Pacific Ocean in the case of California, moderates temperatures by preventing extreme heat in summers and maintaining milder conditions in winters.

Secondly, ocean currents play a crucial role. If ocean currents are bringing cooler air, it further contributes to the overall cooling of the coastal areas. The movement of air masses over the ocean can bring lower temperatures, influencing the climate of the adjacent land.

Lastly, the presence of mountain ranges, which is characteristic of California's topography, can also contribute to cooler temperatures. As air ascends the windward side of mountains, it cools and releases moisture, resulting in cooler and more moderate temperatures on the leeward side of the mountains.

In combination, these factors create a climate in California that is noticeably cooler than that of Tennessee, providing a diverse range of environmental conditions shaped by the state's geographical features and its proximity to the Pacific Ocean.


Related Questions

what can cause granite to break down into soil over time​

Answers

it is because of expansion and contract of the stone in night and expand in day

well granite can be worn down over time through erosion and through abrasion (i.e.) running water of high winds carrying sand or dirt particles. but that would take many years.

Is 28.5 qualitative or quantitative data?

Answers

28.5 is quantitative data

Quantitative because it is a number

How do the onion molecules naturally come distributed throughout the room?

Answers

osmosis.

That is how it spreads.

in ______, water enters cracks in rocks and freezes. water ______ when it freezes and makes the cracks larger.

Answers

ice wedging, expands

Final answer:

Freeze-thaw weathering happens when water enters cracks in rocks and freezes, expanding and enlarging the cracks. The water expands because in its solid state (ice), the molecules are more spread apart than in liquid state. This spread-out molecular structure causes the ice to increase in volume and exert pressure on the rock.

Explanation:

In the process known as freeze-thaw weathering, water enters cracks in rocks and freezes. Water expands when it freezes, which makes the cracks in the rocks larger. Water's unusual behavior when it freezes is due to its molecular structure. As temperatures drop, there's less energy to break the hydrogen bonds between water molecules. These bonds stay intact and form a rigid, lattice-like structure known as ice. The ice is less dense than liquid water because the molecules are farther apart. This expansion puts pressure on the surrounding rock and can make the crack larger.

Learn more about Freeze-Thaw Weathering here:

https://brainly.com/question/16703140

#SPJ3

Which of the following is an example of a response to an internal stimulus?
A.
An animal responds to a ringing bell.
B.
A person vomits after eating spoiled food.
C.
A person pulls her hand away from a hot surface.
D.
An animal jumps when it hears a sudden, loud noise.
Reset Submit

Answers

Answer:

The answer would be B) A person vomits after eating spoiled food

Explanation: Since the question is talking about internal stimulus think about what happens inside someone, the other options are examples of External stimulus which happens outside someone like using your external senses (hearing, sight and touch)

Hope this helps

Final answer:

The correct response to an internal stimulus is B: A person vomits after eating spoiled food. The vomiting reflex is triggered internally by the body in response to toxins, making it a reaction to an internal stimulus.

Explanation:

The question is asking for an example of a response to an internal stimulus. An internal stimulus comes from inside an organism and causes a response that is internally regulated. In this case, the correct answer is B: A person vomits after eating spoiled food. This is a defensive response triggered by the body's internal detection of toxins in the spoiled food. Vomiting is a mechanism that the body uses to expel these toxins and protect itself.

Other options mentioned in the question, such as an animal responding to a ringing bell (Pavlov's experiment) or a person pulling their hand away from a hot surface, are responses to external stimuli. These are reactions prompted by environmental factors outside the body. The distinction between internal and external stimuli is crucial for understanding how organisms, including humans, respond to changes in their environments.

Learn more about Response to an Internal Stimulus

https://brainly.com/question/12346603

#SPJ2

is the energy used by cells for work. It is produced within the_(organelle)
and is made through the process of_12 words)

Answers

Answer:

ATP, Mitochondria, Cellular respiration.

Explanation:

The Krebs cycle of, cellular respiration, in the mitochondria results to the an accumulation of protons in the inter-membrane space of the organelle. This proton motive force is harnessed in the electron transport chain by ATP synthase to generate ATPs.

As you descend through the atmosphere, what would you expect the outside pressure to do?

A. Increase/ decrease
B. Increase/increase
C. Decrease/decrease
D. Decrease/ increase

Answers

Final answer:

Descending through the atmosphere causes an increase in outside pressure due to the increasing weight of the air above. Pressure in the atmosphere is related to the altitude, with higher pressure at lower altitudes. So the correct option is B.

Explanation:

As you descend through the atmosphere, the outside pressure is expected to increase. This is because pressure is a measure of the force exerted by the weight of air above you. At higher altitudes, there is less air above you, thus lower pressure. When you descend, more air is above you, and the weight and pressure increase accordingly.

For instance, when a scuba diver descends into the ocean, which is similar in principle to descending through the atmosphere, the water pressure increases significantly at greater depths due to the weight of the water above. In the context of the atmosphere, air molecules are pulled toward Earth by gravity, so the closer you are to the surface, the more compressed the air molecules are, leading to higher pressure. This concept is also explained by air pressure decreasing with altitude due to fewer air molecules being present.

Final answer:

Descending through the atmosphere results in an increase in the outside pressure due to the greater mass of air above you exerting pressure, following the principles of atmospheric pressure and gas behavior.

Explanation:

As you descend through the atmosphere, the outside pressure would be expected to increase. This is because as altitude decreases, the amount of air above you that is exerting pressure increases due to gravity, hence compressing the air molecules closer together. The relationship between altitude and atmospheric pressure is that pressure increases as you move from higher to lower altitudes.

The relevant concepts from the provided information that relate to gas pressure include understanding the behavior of a gas inside a hot air balloon. When the total pressure of an atmosphere increases, as in the case of descending towards the Earth's surface, the pressure on the gas inside the balloon would also increase. This follows the general gas laws where, in a closed system, a decrease in volume and an increase in atmospheric pressure would cause an increase in the gas's pressure.

Select the correct answer.
Other than the quality of meat, livestock is also graded on
A. the ratio of meat to bone.
B.
the overall weight of the animal.
C.
the popularity of that type of livestock.
D. the physical appearance of the animal.

Answers

A. is the answer.

Livestock in not graded on the weight of the animal, its popularity, and definitely not its appearance.

Other than the quality of meat, livestock is also graded on : (A) The ratio of meat to bone

Livestock grading

Livestock is graded based of certain qualities such as the quality of the meat and its importance to human health. Livestock can also be graded based on the ratio of meat to bone. The popularity of the livestock is not a criteria used for grading or quantifying livestock because certain popular livestock might have low quality of meat. weight and appearance of the animal have no effect on livestock grading.

Hence we can conclude that Other than the quality of meat, livestock is also graded on The ratio of meat to bone.

Learn more about livestock grading : https://brainly.com/question/14394953

#SPJ2

Which is an example of a chemical reaction

Answers

C6H12O6 (glucose) + O2 (oxygen) -> CO2 (carbon dioxide) + H2O (water) + sunlight energy (ATP). The reaction is called cellular respiration and it is used in plants and animals to break down sugars into usable energy to complete bodily functions.

Explanation:

A chemical reaction is defined as the process in which one or more substances reacts to form one or more products which are chemically transformed means the constituent atoms of the reactants are rearranged unlike physical reactions. No new atoms are  created or destroyed, bonds between the atoms in the reactants are broken and the atoms rearrange themselves and form new bonds to make the product.  For example iron and oxygen combine to form rust, sodium acetate is formed by the combination of vinegar and baking soda etc.

A large white and gray log that smells like pine is burned in a fire pit. After being completely burned, all that remains of the log is a small pile of soft white-gray ashes that no longer smell of pine. Describe the evidence that a chemical change has occurred.

Answers

Answer:While the pile of ashes and log have similar colors, the change in size, odor, and hardness, and the difference in combustibility indicate that a chemical change has resulted in a substance with a different identity. Furthermore, the ashes cannot be converted back into a log.

The ash produced after burning is white in color while in the beginning it was greyish-white and smell of pine vanished after turning into ash provides an evidence that chemical change has occurred.

What is a chemical change?

Chemical changes are defined as changes which occur when a substance combines with another substance to form a new substance.Alternatively, when a substance breaks down or decomposes to give new substances it is also considered to be a chemical change.

There are several characteristics of chemical changes like change in color, change in state , change in odor and change in composition . During chemical change there is also formation of precipitate an insoluble mass of substance or even evolution of gases.

There are three types of chemical changes:

1) inorganic changes

2)organic changes

3) biochemical changes

During chemical changes atoms are rearranged and changes are accompanied by an energy change as new substances are formed.

Learn more about chemical change,here:

https://brainly.com/question/23693316

#SPJ2

What wavelengths of light are absorbed by chlorophyll? What wavelengths are reflected

Answers

Chlorophyll absorbs light in the red and the blue regions of the visible light spectrum. Green light is not absorbed but reflected, making the plant appear green.

hope this helps!

The wavelengths of light are absorbed by chlorophyll as it absorbs light in the red and the blue regions of the visible light spectrum. Green light is not absorbed but reflected, making the plant appear green.

What is wavelength?

Wavelength has been the distance between two identical or similar positions it means that it is the distance between crests or trough in the adjacent cycle of the waveform.

Wavelength is denoted by (lambda).

It is measured in meter, or centimeter, or millimeters.

Mathematically,

Wavelength is equal to velocity divided by frequency,

So,

Wavelength (lambda) = Velocity/frequency.

Velocity is in meter per second.

Frequency is in 1/second.

Prism is a transparent object in which if  sunlight is passed then it will be split in a VIBGYOR

where V = vilot, I = indigo, B = blue, G = green, Y = Yellow, O = orange, R = red.

In this series wavelength of red is higher and violet is smaller and frequency of violet is higher and red is smaller.

Therefore, The wavelengths of light are absorbed by chlorophyll as it absorbs light in the red and the blue regions of the visible light spectrum. Green light is not absorbed but reflected, making the plant appear green.

Learn more about wavelengths on:

https://brainly.com/question/12924624

#SPJ2

What are all the biological processes in the carbon cycle?

Answers

The biological carbon cycle. Through photosynthesis, green plants use solar energy to turn atmospheric carbon dioxide into carbohydrates (sugars). Plants and animals use these carbohydrates (and other products derived from them) through a process called respiration, the reverse of photosynthesis.

Final answer:

The biological processes in the carbon cycle involve the intake of carbon dioxide by autotrophs to form organic compounds, consumption of autotrophs by heterotrophs which use the organic compounds for energy and exhale CO2, the biological carbon pump process, and the storage and release of carbon in and from various carbon reservoirs.

Explanation:

The biological processes in the carbon cycle primarily involve autotrophs (like plants and algae) and heterotrophs (like animals). The cycle begins with autotrophs, which take carbon dioxide (CO2) from the atmosphere or dissolved form in water bodies to form organic compounds like glucose. This process, known as photosynthesis, requires energy from the sun and results in the release of oxygen as a byproduct.

Next, heterotrophs ingest the autotrophs and break down the organic compounds for energy through the process of respiration, releasing carbon dioxide back into the atmosphere or water bodies. A process known as the biological carbon pump involves autotrophs fixing inorganic carbon which then fall to the sea floor as they die, preventing the consumption and return of their CO2 to the atmosphere by saprobes.

Another important process in the carbon cycle is the long-term, geological storage of carbon in carbon reservoirs, such as atmosphere, oceans, ocean sediment, soil, fossil fuels, and the Earth's interior. Over time, human activities like fossil fuel burning have accelerated the return of stored carbon to the atmosphere, leading to increased atmospheric CO2 levels and concerns about climate change.

Learn more about Biological Carbon Cycle here:

https://brainly.com/question/8633931

#SPJ3

Explain what is epistasis and how is it different from dominance?

Answers

Final answer:

Epistasis is a form of genetic interaction where one gene masks the expression of another gene, which differs from simple dominance which occurs when a dominant allele masks the expression of a recessive allele within the same gene. In the context of the shepherd's purse plant, epistasis results in triangular seeds unless both genes are homozygous recessive, leading to a 15:1 phenotypic ratio when two heterozygotes are crossed.

Explanation:

Epistasis is a genetic phenomenon where one gene interferes with or masks the expression of another gene. The term epistasis comes from Greek roots meaning "standing upon." An epistatic gene that does the masking is referred to as epistatic, while the gene whose expression is masked is called hypostatic. This relationship can profoundly affect the phenotypic ratios seen in genetic crosses, different from the simple dominant-recessive relationships seen in Mendelian inheritance. The biochemical basis for epistasis often involves gene pathways where one gene's function is necessary for another gene further down the pathway to be expressed.

Dominance vs. Epistasis

While dominance refers to the interaction between different alleles of the same gene, with the dominant allele masking the expression of a recessive allele, epistasis involves interactions between different genes. Epistasis can be complex, with multiple gene interactions leading to variations in phenotype that are not predictable by simple dominance. For instance, in shepherd's purse plants (Capsella bursa-pastoris), the presence of a dominant allele in any of two genes results in triangular seeds, overriding the seed shape that would be produced by the other gene. A phenotype of ovoid seeds only occurs when there are two homozygous recessive genes (aabb). Hence, crossing two heterozygotes for each gene (AaBb x AaBb) yields a phenotypic ratio of 15 triangular to 1 ovoid.

Final answer:

Epistasis is a genetic interaction where one gene's phenotype expression masks another gene's expression, differing from dominance that occurs between alleles of the same gene. Examples include the coat color of mice and seed shape in the shepherd's purse plant.

Explanation:

Epistasis is a genetic interaction where the phenotype effect of one gene (epistatic) masks or suppresses the expression of another gene (hypostatic). This is different from dominance, which refers to the interaction between alleles at the same gene locus, with dominant alleles expressing their effects over recessive ones. An example of epistasis is in the coat color of mice, where a mouse with a certain genotype (cc) will always be albino, regardless of the alleles at another locus related to fur color.

Physiological epistasis and statistical epistasis are two concepts related to these genetic interactions. Physiological epistasis involves the actual biological interaction between gene products, while statistical epistasis refers to the measured deviation from the expected genetic ratios in a population. In contrast, dominance only describes the relationship between alleles at a single locus, not interactions across different loci.

Understanding Epistasis through Examples

In the shepherd's purse plant, seed shape demonstrates dominant epistasis. When both genes A and B are present in dominant form with any combination other than homozygous recessive (aabb), the seeds will always be triangular. This genotypic relationship modifies the phenotypic ratio from the standard 9:3:3:1 of a dihybrid cross to 15 triangular:1 ovoid upon crossing heterozygotes for both genes (AaBb x AaBb).

An object in motion has __________ energy. (4 points) magnetic kinetic possible chemical

Answers

An object in motion has Kinetic energy

Match each vocabulary word to the correct definition. 1. Mitochondrial DNA 2. Genes 3. Mitochondria 4. Hybridization 5. Polymerase chain reaction (PCR a. Binds together DNA with a complimentary DNA sequence. b. The basic and fundamental part of heredity. c. Creates strands of DNA from small samples of DNA at crime scenes. d. The small structures in the cell that are responsible for creating energy and carry several pieces of DNA. e. Inherited from one’s mother and is found outside of the cell nucleus.

Answers

Mitochondrial DNA --> Inherited from one's mother and is found outside of the cell nucleus (E.)

Genes --> The basic and fundamental part of heredity (B.)

Mitochondria --> The small structures in the cell that are responsible for creating energy and carry several pieces of DNA (D.)

Hybridization -->  Binds together DNA with a complimentary DNA sequence (A.)

Polymerase chain reaction --> Creates strands of DNA from small samples of DNA at crime scenes (C.)

Hope this helps! Feel free to message me if you have more questions or need help! :)

Given these characteristics of life, which of the following objects is considered a living organism

Answers

People,animals and plants
Final answer:

A living organism must possess all six characteristics of life: It responds to the environment, grows and develops, produces offspring, maintains homeostasis, has complex chemistry, and consists of cells.

Explanation:

A living organism must possess all six characteristics of life:

It responds to the environment. For example, a plant growing towards sunlight.It grows and develops. For example, a seed germinating and growing into a tree.It produces offspring. For example, an animal giving birth to babies.It maintains homeostasis. For example, a human maintaining a stable body temperature.It has complex chemistry. For example, the metabolic processes in a cell.It consists of cells. For example, a bacteria is a single-celled organism.

Based on these characteristics, a tree would be considered a living organism as it exhibits all six traits.

Hunting lions has been banned in some parts of Africa. If this law is enforced, what can we expect to happen to the populations of small mammals in the same locations? A) The small mammal populations will decrease. B) The small mammals will become extinct on Earth. C) The small mammal populations will increase also. D) The small mammal populations will balance out and stay the same.

Answers

I would say D because both populations are constantly growing and it would be natural selection so it works out if humans just back off

A: The small mammal populations will decrease

This is true because lions will begin to repopulate the areas and need more food. The lions will begin to hunt the mammals and in turn will decrease the population. More mammals will be needed to feed more Lions.

Which development in plants has contributed to the evolution of large trees?

Answers

Answer:

Secondary vascular growth

Explanation:

Secondary growth in the plant allows them to be thicker, unlike primary growth that is apical. Secondary vascular cambium acts as a support for plants especially trees as they grow taller –allowing them to support their own weight. This is what is perceived as wood (secondary xylem) in a tree.

Please answer this 2 question!!!!!

Answers

Number 1 is B becuase when you are described an organism you usually recognize it by it's color or fur type. For instance, if you asked me what animal has brown fur, then you would imagin a bear.

Number 2 is B also because they both have nucleus in their cells.

Does mechanical waves travel faster or slower as density of matter increases

Answers

Answer:

Travel is faster as density of

matter increases

Explanation: This should be right not sure hopefully this helps!(Let me know in the comments plz!)

What happened after plants first became able to live on land?

Answers

After the plants became able to live on land, and the reason for that being the ability for higher glucose production, they managed to influence numerous things on the planet and change it drastically.

Some of the more marking things that happened because of the plants that started to live on land were the change in the composition of the gasses in the atmosphere, the formation of soils, and climate changes.

The plants perform a process called photosynthesis in order to make their own food. For this process they use carbon dioxide. The carbon is used, while the oxygen is a waste product that is released. Over time, through this process, the plants managed to significantly increase the oxygen levels on the Earth, making it suitable for the animals to move in as well on the land.

The increase of oxygen in the atmosphere resulted in climate changes, as the oxygen makes the climate cooler, thus in general the climate cooled off. Also, with their shade, the plants manage to reduce the temperature on the surface, the trees also being able to slow down and affect the low air movements...

The plants, as all organisms, eventually die. When they die, they decompose. In this manner they introduced the land with the first biomass, thus the rocks and the biomass started to mix. Over time this led to the formation of multiple types of different soils.

Answer:

Adaptive radiation spread them into many land niches

Explanation:

A.P.E.X

1)



Which plant cell organelle helps maintain the shape of the cell by helping to maintain turgor pressure?
A) cell membrane
B) cell wall
C) vacuole
D) cytoskeleton

Answers

The plant cell organelle that helps maintain shape of the cell by helping to maintain turgor pressure is

         B. Cell Wall

the answer is (D) the cytoskeleton helps maintain rigidity of the cell

What is the term that describes the size of a population that can be supported by a given ecosystem?

Answers

♫ - - - - - - - - - - - - - - - ~Hello There!~ - - - - - - - - - - - - - - - ♫

It is called the 'carrying capacity.'

Hope This Helps You!

Good Luck (:

Have A Great Day ^-^

↬ ʜᴀɴɴᴀʜ

Answer:

Carrying Capacity

Explanation:

All ecosystems are capable to support a certain number of organisms, beyond which the rate of consumption of their resources (by the increased population) will be  much  faster than the rate at which they are replenished and hence the ecosystem will destabilize.

This population which an ecosystem can sustain without any pressure on its resources thereby preserving them for future generations is called  the carrying capacity of an ecosystem.

The breakdown of large molecules by enzymes and the addition of water is known as a ____ reaction.
a.
oxidation
b.
decarboxylation
c.
hydrolysis
d.
condensation
e.
reduction

Answers

Answer: Hydrolysis

Explanation: It is hydrolysis. In hydrolysis, larger molecules, such as polymers, are broken down into their monomers by the action of an enzyme and the addition of a water molecule.

Final answer:

A hydrolysis reaction involves the breakdown of large molecules by enzymes and the addition of water.

Explanation:

The breakdown of large molecules by enzymes and the addition of water is known as a hydrolysis reaction. The term hydrolysis is derived from 'hydro-' which means water and '-lysis' which means to break down. In the process of hydrolysis, a water molecule is added to the substance, which causes the substance to separate into two parts. This is an important process in many biological systems, such as the digestion of food in the body.

Enzymes act as catalysts, facilitating this reaction by lowering the activation energy required for the hydrolysis to occur. Hydrolysis is essential for various biological processes, such as digestion, where complex carbohydrates, proteins, and fats are broken down into their constituent monomers like glucose, amino acids, and fatty acids. These monomers can then be absorbed and utilized by the body for energy production and various cellular functions.

Learn more about hydrolysis here:

https://brainly.com/question/33281313

#SPJ2

Which of the following best describes calcitonin? A. It's released by the adrenal medulla. B. It's released by the parathyroid gland. C. It functions to prevent hypercalcemia. D. It functions to prevent hypocalcemia.

Answers

the correct answer is B) its released by the parathyroid gland

A guinea pig with long hair (hh) is crossed with one that has short hair (HH).Set up a punnett square​

Answers

A cobaia tem 100% de nascer com cabelo curto, sendo Hh

HH is dominant, so short hair would be answer.

tp-37 who should you call first if you have an oil or fuel spil?​

Answers

Call the U.S. Coast Guard National Response Center.

Answer:

You should call the US Coast Guard National Response Center.

Explanation:

The Coast Guard is a national institution responsible for providing various maritime services, usually related to authority. The term refers to institutions with responsibilities that can vary widely, from country to country. Thus, depending on the country, the nature of its coastguard can range from a heavily armed military force with broad powers of police authority, to a simple organization of volunteers with functions limited to maritime search and rescue without any authority.

A certainty is that the Coast Guard is responsible for controlling or resolving possible marine disasters, so if an oil or fuel leak occurs, it is best to call the US Coast Guard National Response Center for this leak to be contained as soon as possible.

How are leaves and plants adapted to the tundra?

A. They are “needles” that stay on the trees.

B. They are large and tilt toward the sun

C. They make colores patterns on rocks

D. They are sponge-like to hold moisture

Answers

d they are sponge like to hold moisture

Answer:

They are large and tilt toward the sun.

Explanation:

xoxo

How many servings of soup would I need to consume 20% of my daily requirement of fiber

Answers

Chicken Noodle Soup-

1.If you were to eat the entire can of soup, how much sodium would you consume?

If you were to eat the entire can of soup, you would consume 2225gm. of sodium.

2.If the recommended amount of sodium for someone with high blood pressure is 1500 mg/day, how much more than the recommended amount is present in this entire can?

The entire can of soup would contain 725gm. past the recommended amount of sodium for a day.

3.How many servings of soup would I need to consume 20% of my daily requirement of fiber?

You would need to consume 5 servings of soup to consume 20% of your daily requirement of fiber.

4.How many calories would that be?

It would be 300 calories to consume 5 servings of soup.

Doritos-

1.How many calories would you consume if you ate the whole 16oz. bag?

The whole bag of Doritos includes 140 calories.

2.How many carbohydrates would you consume if you ate the whole bag?

The whole bag of Doritos includes 17g. of carbohydrates.

3.What percentage is this of your daily intake of carbohydrates?

The percentage is 6% of your daily intake of carbohydrates.

4.How much fat would you get from eating 5 servings of Doritos?

If you ate 5 servings of Doritos you would get 40g. of fat.

Cheerios-

1.How many calories are in 1 serving of your food item?

There are 100 calories in 1 serving of Cheerios.

2.How much sodium is in your food item?

There are 190mg. of sodium in Cheerios.

3.How much protein is in your food item?

There are 3g. of protein in Cheerios.

4.How much cholesterol is in your food item?

There are 0mg. of cholesterol in Cheerios.

In one serving of soup you will consume 2225 gm of sodium. The entire can of soup would contain 725 gm and past the recommended amount of sodium for a day to fulfill the requirement of fiber.

What is fiber?

Fiber has been also known as the roughage which has been derived from the portion of the plant in the form of food and it has been impossible to break down the fiber completely with the help of enzymes found in human beings.The main advantage of taking fiber is that it helps to normalise the bowel movement that lead to maintain health of bowel.

The main average percentage of the fiber is that a woman should add in her diet must be 21-25 grams of fiber in the single day and the food which has to be provided fiber are berries, popcorn, avocados, and beans. The main advantage of taking fiber has that it helps to normalise the bowel movement that lead to maintain health of bowel.

Therefore, In one serving of soup you will consume 2225 gm of sodium. The entire can of soup would contain 725 gm and past the recommended amount of sodium for a day to fulfill the requirement of fiber.

Learn more about fiber on:

https://brainly.com/question/18557913

#SPJ2

pleaseeee help ill give brainliestt and all points i have



A student makes a drawing of a carbon atom. Which of these should the student show in the nucleus of the atom? *
1 point
Ions
Protons
Electrons
Molecules
2. Which pair below describes isotopes of the same element? *
1 point
A) an atom with 6 protons and 8 neutrons - an atom with 8 protons and 6 neutrons
B) an atom with 6 protons and 6 neutrons - an atom with 6 protons and 7 neutrons
C) an atom with 8 protons and 8 neutrons - an atom with 7 protons and 8 neutrons
D) an atom with 7 protons and 6 neutrons - an atom with 6 protons and 6 neutrons
3. Which diagram best represents molecules of matter in the gas phase? *
1 point
A
B
C
D
4. All of the liquid from a test tube is poured into a beaker, as shown in the diagram below. Compared to the liquid that was in the test tube, the liquid in the beaker has *
1 point
Captionless Image
A. a different volume, but the same shape.
B. the same volume, but a different shape.
C. a different volume and a different shape.
D. the same volume and the same shape.
5. Color, shape, texture, and size are _____________ properties of matter. *
1 point
A) Chemical
B) liquid
C) physical
D) solid
6. Maggie recorded her observations of the baking soda used in lab today. Which observation indicated a chemical property of the baking soda? *
1 point
Captionless Image
A) Odor
B) Color
C) Texture
D) Bubbles
7. The pictures below represent changes observed: *
1 point
Captionless Image
A) Picture I shows a chemical change, because a new substance is formed.
B) Picture II shows a chemical change, because a new substance is formed.
C) Picture I shows a chemical change, because the same substance changes form.
D) Picture II shows a chemical change, because the same substance changes form.
8. The diagram below shows a portion of the Periodic Table of the Elements. Which element below has chemical properties similar to the chemical properties of fluorine (F)? *
1 point
Captionless Image
B
O
He
I
9. Which element below has chemical properties similar to the chemical properties of tin (Sn)? *
1 point
Captionless Image
As
In
Ge
Sb
10. Which of the following statements best explains why elements in the same family of the periodic table have similar bonding properties? *
1 point
A) The elements have similar atomic sizes.
B) The elements have similar atomic masses.
C) The elements have similar numbers of protons.
D) The elements have the same number of valence electrons.
11. When carbon and oxygen combine chemically, the mass of the product is *
1 point
A. greater than the mass of the carbon plus the mass of the oxygen.
B. equal to the mass of the carbon plus the mass of the oxygen.
C. equal to the mass of the carbon.
D. less than the mass of the carbon
12. After some wood has completely burned in a fire, some of the matter that made up the wood has been destroyed. Is the statement correct or incorrect? Explain. *
1 point
A) It is correct. The ashes weigh less than the original wood and this proves that some of the mass was destroyed.
B) It is incorrect. Ashes look different than wood but the mass of the ashes is the same as the mass of the original wood.
C) It is incorrect. Look at the ashes under the microscope. These particles will look exactly like the particles in the wood.
D) It is incorrect. Capture and collect all of the gases given off by the fire and combine these masses with the mass of the left over ashes. This should equal the mass of the original wood.
13. A copper sheet is heated in a furnace until it melts. The hot liquid copper is then cooled until it becomes solid again. Compare the mass of the copper before and after melting. *
1 point
A) The new solid copper is lighter than the original sheet.
B) The new solid copper is heavier than the original sheet.
C) The new solid copper is the same mass as the original sheet.
D) The molten copper was lighter than the sheet or the new solid.
14. Using the Law of Conservation of Matter, determine the number of grams of iron sulfide (FeS) that will be produced in this reaction.112g Fe + 64g S → _____ g FeS *
1 point
A. 48 grams
B. 64 grams
C. 112 grams
D. 176 gram
15. How many different elements are involved in the chemical reaction shown? *
1 point
Captionless Image
7
5
14
3
16. Use the diagram below to fill in each blank. Molecules of one type of compound _____ *
1 point
Captionless Image
A
B
C
D
E
Atoms of two different elements _____ *
1 point
Captionless Image
A
B
C
D
E
Molecules of two different compounds ______ *
1 point
Captionless Image
A
B
C
D
E
Mixture of one element and one compound _____ *
1 point
Captionless Image
A
B
C
D
E
Molecules of an element ______ *
1 point
Captionless Image
A
B
C
D
E
17. Which of the following is an example of a container that is filled with a pure substance rather than with a mixture? *
1 point
A) a tire filled with air
B) a jar filled with salt water
C) a balloon filled with helium
D) a glass filled with chocolate milk

Answers

1. proton

2.B

3.it will be the pic (ball were far away)

4.B

5.C

6.D

7.A

8.D

9.C

Answer:

1. proton

2.B

3.It is the photo, the ball is very far away.

4.B

5.C

6.D

7.A

8.D

9.C

Other Questions
I NEED BOTH URGENTLY!! the length and width of a rectangle are consecutive even integers. the area of the rectangle is 120 square units. what are the length and width of the rectangle An old greek superstition was that amethyst would protect those who. wore it from drunkennesswhich is why they called it amthystos,. meaning "not drunken."until the discovery of the large brazilian and. uruguayan deposits at the end of the nineteenth century, deep-colored. amethyst was highly prized. suppose a ray of Un the morning a farm worker packed 4 pints of strawberries every 5 minutes in the afternoon she packed 3 pints of strawberries ev ery 4 minutes what was the diference between her morning and afternoon packing rates in pints per hour 20pts!!!!!!!!!!!!!!!!!0 CLEAN: Wash produce. Rinse fresh fruits and vegetables in running tap water to remove visible dirt and grime. Remove and discard the outermost leaves of a head of lettuce or cabbage. Because bacteria can grow well on the cut surface of fruit or vegetable, be careful not to contaminate these foods while slicing them up on the cutting board, and avoid leaving cut produce at room temperature for many hours. Don't be a source of food-borne illness yourself. Wash your hands with soap and water before preparing food. Avoid preparing food for others if you yourself have a diarrheal illness. Changing a baby's diaper while preparing food is a bad idea that can easily spread illness. A student is preparing a class presentation based on the information contained in this document. What would be the most interesting and impressive way to share the information?A)outlineB)oral presentationC)multimedia presentationD)personal journal What was John f Kennedy famous for What is the standard form equation of the line shown below? Which function represents the sequence?11Question 11 options:f(n)=n+3f(n)=7n4f(n)=3n+7f(n)=n+7 if an object looks blue , it reflects_____ light What impact did the kkk have on life in america? Air pressure is caused by the density of gas molecules in the air. Please select the best answer from the choices provided T F Lana is about the right weight for her age and height. nevertheless, she is so preoccupied by her fear of becoming overweight that whenever she goes on an eating binge, she purges the excessive food intake by self-induced vomiting. it is likely that lana suffers from: Find the missing terms of the geometric sequence 81,____, _____ 3 Identify the graph of x^2-8y=0 for theta=90 and write and equation of the translated or rotated graph in general form. When developing a plan for a proof, it is important to look at the "given" information. True False Lions tend to prey on primary consumers like zebras and gazelles. if there were a sudden decline in a population of lions, which ecological imbalance would most likely occur in the habitat? Carrie started a 12 ounces of water when finish drinking she had 2 1/4 how much did she srink How will I adapt to post-school social routine to minimize the impact social pressure may have on work performance If a boy (m = 25 kg) at rest on skates is pushed by another boy who exerts a force of 500 N on him and if the first boy's final velocity is 20 m/s, what was the contact time? Practicing wellness Which activities appeal most to you why or why not is it good to do several of these activities