Which of the following materials is a conductor of electric current? a wooden spoon,a plastic game piece,a glass window,a copper wire

Answers

Answer 1
The answer to your question is A COPPER WIRE. Hope this helps!

Im going to eat lol! :)
Answer 2

its a copper penny hope this helps


Related Questions

which has a higher acceleration:a 10kg object acted upon with a net force of 20N or an 18kg object acted on by a net force of 20N

Answers

Answer: The acceleration of 10 kg object is greater than that of 18 kg object.

Explanation:
According to Newton's Second law:
F = ma --- (A)

Let's find the acceleration for both 10 kg and 18 kg objects!
The net force on both of these masses = F = 20N

(1) Acceleration of 10 kg object
Mass = m = 10 kg
Plug in the values in equation (A):
20 = 10 * a
Acceleration = a = 2 m/s^2

(2) Acceleration of 18 kg object
Mass = m = 18 kg
Plug in the values in equation (A):

20 = 18 * a
Acceleration = a = 1.11 m/s^2


2 > 1.11; therefore, 10 kg object has the higher acceleration compared to the acceleration of the 18 kg object.

Explanation:

The expression of the applied force in terms of mass and acceleration by using Newton's second law is as follows;

F= ma

Here, m is the mass of the object and a is the acceleration of the object.

Calculate the acceleration of a 10 kg object acted upon with net force of 20 N in the above expression.

Put m= 10 kg and F= 20 N in the above expression.

20= (10)a

a= 2 m/s^2

Calculate the acceleration of a 18 kg object acted upon with net force of 20 N in the above expression.

Put m= 18 kg and F= 20 N.

20= (18)a

a= 1.11 m/s^2

Therefore, the acceleration of a 10 kg object acted upon with net force of 20 N is greater than the acceleration of a 18 kg object acted upon with net force of 20 N.

What is the role of the respiratory system?
a.
to bring water into the body
b.
to bring oxygen into the body
c.
to bring carbon dioxide into the body
d.
none of the above

Answers

it is to bring oxygen to the body so B
It's B, to bring oxygen into the body.


Comment if the answer is right or wrong so other people that need this will be 100% sure. 

Explain why Earth and other planets were not solid when they formed during the beginning of the Precambrian, approximately 4,600 million years ago (MYA). What was this particular time period called, and why is this time period not really considered apart of Earth’s geological history?

Please help
I'll mark who ever comes up with the best answer brainliest

Answers

A) Earth was formed by accretion from the Solar nebula. That is that, at first, atoms and molecules started colliding, forming dust and debris; that debris started colliding with each other, slowly forming a protoplanet.
Due to natural radiation of the elements and to the various impacts of the debris, the temperature of the protoplanet was very high. 
At this kind of temperature rocks and all the other materials were fused in a homogeneous matter, which started to solidify when the temperature decreased. 

B) This particular period is called Hadean eon and it is the very beginning part of Precambrian.

C) The Hadean eon started when Earth started forming and ended with the solidification of the crust, the formation of the atmosphere (mostly carbon dioxide) and the condensation of water into seas and oceans. For these reasons it is not considered apart from Earth's geological history, even thou rocks dated so back in time are rare to find.


A) Earth was formed by accretion from the Solar nebula. That is that, at first, atoms and molecules started colliding, forming dust and debris; that debris started colliding with each other, slowly forming a protoplanet. Due to natural radiation of the elements and to the various impacts of the debris, the temperature of the protoplanet was very high.  At this kind of temperature rocks and all the other materials were fused in a homogeneous matter, which started to solidify when the temperature decreased.   B) This particular period is called Hadean eon and it is the very beginning part of Precambrian. C) The Hadean eon started when Earth started forming and ended with the solidification of the crust, the formation of the atmosphere (mostly carbon dioxide) and the condensation of water into seas and oceans. For these reasons it is not considered apart from Earth's geological history, even thou rocks dated so back in time are rare to find. A) Earth was formed by accretion from the Solar nebula. That is that, at first, atoms and molecules started colliding, forming dust and debris; that debris started colliding with each other, slowly forming a protoplanet. Due to natural radiation of the elements and to the various impacts of the debris, the temperature of the protoplanet was very high.  At this kind of temperature rocks and all the other materials were fused in a homogeneous matter, which started to solidify when the temperature decreased.   B) This particular period is called Hadean eon and it is the very beginning part of Precambrian. C) The Hadean eon started when Earth started forming and ended with the solidification of the crust, the formation of the atmosphere (mostly carbon dioxide) and the condensation of water into seas and oceans. For these reasons it is not considered apart from Earth's geological history, even thou rocks dated so back in time are rare to find. A) Earth was formed by accretion from the Solar nebula. That is that, at first, atoms and molecules started colliding, forming dust and debris; that debris started colliding with each other, slowly forming a protoplanet. Due to natural radiation of the elements and to the various impacts of the debris, the temperature of the protoplanet was very high.  At this kind of temperature rocks and all the other materials were fused in a homogeneous matter, which started to solidify when the temperature decreased.  

Darrell is trying to remove a nail from a board using the claw of a hammer, but the nail is stuck. Which of the following could Darrell do to make the job easier?
A.
Use a hammer with a longer handle.
B.
Use a heavier hammer.
C.
Use a hammer with a shorter handle.
D.
Use a hammer with a sharper claw.

Answers

It's C loves! I just got it right.

Answer: The answer is c

The cooled lava pools on the surface of a crater are called what?
1. Craters
2. Terrae
3. Maria
4. Reoglith

Answers

the answer i believe is craters
i believe its a maria

Technician A says that the burning of the air-and-fuel mixture in the cylinder is called fuel activation. Technician B says that the basic function of the upper-end components is to control the flow of air-and-fuel mixture into the engine and the flow of exhaust gases out of the engine after combustion. Who is right? A. Both Technicians A and B B. Technician A only C. Neither Technician A nor B D. Technician B only

Answers

The answer is A. Both Technicians A and B. Technician B is correct because the basic function of the upper-end components of an air-fuel mixture is to control the flow of it into the mixture. And also the statement of technician A is correct also.

How this answer can be Verifies if it's wrong!?!?!

Four balls are dropped from a platform, 20 meters high. Which ball will experience the GREATEST change in kinetic energy, from platform to ground?
10 kg
20 kg
30 kg
40 kg

Answers

The heaviest ball will have the most Potential Energy loss and Kinetic Energy gain, so your answer should be D

Answer:

D.) 40

Explanation: I toke the USA-Test-Prep interim for it and past. I do k12. the heavier the ball the more kinetic energy gained.

What is the difference between a constellation and an “asterism”? Name at least one commonly known asterism.

Answers

A "constellation" is the total, full, complete thing in the night sky ...
ALL of the stars that go together to make up the complete dog or
the queen or the fish or the bear, or whatever else the story of
that particular part of the sky involves.

An "asterism" is a small, easily recognized group of stars, that
can be spotted right away, although they're only a small part
of a constellation.

The Big Dipper, the Little Dipper, Orion's Belt, and the Great Square
are asterisms.  They're parts of the constellations of the Big Bear,
the Little Bear, Orion the Great and Mighty Hunter, and Pegasus,
respectively.
Final answer:

A constellation is a sector into which the sky is divided, while an asterism is a noticeable star pattern within a constellation. The Big Dipper is a commonly known asterism within the constellation of Ursa Major.

Explanation:

A constellation is one of the 88 sectors into which the sky is divided. Each point in the sky falls within a specific constellation. On the other hand, an asterism is an especially noticeable star pattern within a constellation. The Big Dipper, which is an asterism within the constellation of Ursa Major, is a commonly known example.

Learn more about difference between constellation and asterism here:

https://brainly.com/question/33444233

#SPJ12

Which of the following situations would cause light to refract? A. traveling through a vacuum B. passing from one glass block to another C. moving through the air D. moving from air to water

Answers

Light refraction occurs when light passes from one medium to another, leading to a change in its direction. In the given options, this phenomenon would be observed when light moves from air to water, causing it to slow down and bend. This refraction is what makes objects look distorted when viewed through water.

The correct option is D.

The phenomenon of light refraction occurs when light passes from one medium to another, causing a change in its direction. Due to the dissimilar densities of different media, the speed and direction of light are affected, leading to its refraction. Specifically, between the four options given, the situation that would cause light to refract is when light is moving from air to water (option D).

As demonstrated in figure 2.4 (a), when light transfers from air (a less dense medium) to water (a denser medium), it slows down and its path bends, resulting in refraction. This change of direction is why objects often appear distorted or misaligned when observed through water.

While light can also refract when passing from one glass block to another (option B), this situation wasn't presented in the original question. Similarly, reflected light differs from refracted light in that it bounces off surfaces while refracted light bends when transitioning between different media.

Hence The correct option is D.

Learn more about Light Refraction here:

https://brainly.com/question/32901065

#SPJ6

Refraction occurs when light moves from one medium to another with a different density, causing it to bend. The correct situation where refraction happens is when light moves from air to water. Examples of refraction include light passing through a prism and a bent appearance of a straw in water.

Refraction is the bending of light rays as they pass from one medium to another with a different density. This occurs due to a change in the speed of light between the two media, causing the light rays to change direction.

Among the given options, the situation that would cause light to refract is moving from air to water.

This phenomenon happens because light travels at different speeds in different media. When light passes from air (a less dense medium) into water (a denser medium), its speed decreases, and it bends towards the normal line at the boundary between the two media.

The correct answer is:

D. moving from air to water

Examples of Refraction:

1. When light passes through a prism, it refracts, separating into different colors.

2. A straw appears bent when partially submerged in water due to refraction.

In summary, D) moving from air water, causes would cause light to refract.

if a glacier is in equilibrium, where ablation is equal to the accumulation, what occurs in the terminus or 'snout'

Answers

The answer is : neither erosion nor deposition occurs.
If a glacier is in equilibrium, where ablation is equal to the accumulation,  either erosion nor deposition occurs in the terminus or 'snout'.  It stops depositing rocks, the snow would stop falling at the terminu, the temperature would rise, It is neither advancing nor retreating anymore.

If a glacier is in equilibrium, its terminus remains stable as ice loss from ablation equals ice gain from accumulation. The glacier's terminus does not advance or retreat under these conditions.

If a glacier is in equilibrium, it means that the ablation (loss of ice) is equal to the accumulation (gain of ice). The point where this balance is achieved is the equilibrium line. If the glacier is in equilibrium, the terminus or 'snout' of the glacier remains at a stable position. While the ice continues to flow downslope, the position of the terminus does not advance or retreat because the amount of ice being lost to ablation is equal to the amount being gained through accumulation.

A .5 kg toy train car moving forward at 3 m/s collides with and sticks to a .8 kg toy car that is traveling at 2 m/s what is the final velocity of the two cars round to the nearest 10th

Answers

Here we have perfectly inelastic collision. Perfectly inelastic collision is type of collision during which two objects collide, stay connected and momentum is conserved. Formula used for conservation of momentum is:
[tex] m_{1} * v_{1} + m_{2} * v_{2} = m_{1} * v'_{1}+ m_{2} * v'_{2}[/tex]

In case of perfectly inelastic collision v'1 and v'2 are same.

We are given information:
m₁=0.5kg
m₂=0.8kg
v₁=3m/s
v₂=2m/s
v'₁=v'₂=x

0.5*3 + 0.8*2 = 0.5*x + 0.8*x
1.5 + 1.6 = 1.3x
3.1 = 1.3x
x = 2.4 m/s

What tactics does a financial planner apply to deal with a difficult client

Answers

There are many different solutions to dealing with a difficult client. For example, you can release them which means you transfer them to another firm so you won't have to deal with them. If you want to keep the client, you can change the way in which you bill them. Another option is to be direct and polite at the same time. Lastly, use a team approach so other people in that firm get to work with that same client.

To determine a waves' frequency, you must know the

A. distance it travels.
B. number of oscillations in a given period of time.
C. distance between the crest and trough.
D.height of the wave.

Answers

B. number of oscillations in a given period of time.

Answer : Frequency equals number of oscillations in a given period of time.

Explanation :

The number of oscillations in a given period of time is known as the frequency of the wave. It is denoted by [tex]\nu[/tex]. Its SI unit is hertz (Hz).

It is also defined as the inverse of time period i.e.

[tex]\nu=\dfrac{1}{T}[/tex]

T is the time period.

Hence, the correct option is (B) " number of oscillations in a given period of time ".

why is it important foe scientists to know how many valence electrons a given element has

Answers

Because the number of valence electrons of an element determines the properties and in particular the reactivity of that element.

In fact, elements of the first group (i.e. only one valence electron) have high reactivity, because they can easily give away their valence electron to atoms of other elements forming bonds. On the contrary, elements of the 8th group (noble gases) have their outermost shell completely filled with electrons, so they do not have valence electrons, and they have little or no reactivity at all.

Suppose you increase your walking speed from 6 m/s to 14 m/s in a period of 1 s. What is your acceleration?

Answers

a = delta v over delta t delta v is calculated with final velocity less initial velocity so delta v is 14 - 6 that is 8m/s and delta t is calculated with final time less initial time as initial always is 0 then is 1 - 0 that is 1 then a = 8m/s over 1 that is 8 then the acceleration is 8m/s^2 (remember that is squared.)
Answer:
acceleration = 8 m/s²

Explanation:
Acceleration is defined as the rate of change of velocity.
This means that:
acceleration = [tex] \frac{v2 - v1}{t2 - t1} [/tex]
We are given that:
V2 = 14 m/sec
V1 = 6 m/sec
We are also given that the duration is 1 sec, this means that:
t2 = 1 sec
t1 = 0 sec

Substitute with the givens in the above equation to get the acceleration as follows:
acceleration = [tex] \frac{14-6}{1-0} [/tex] = [tex] \frac{8}{1} [/tex] = 8 m/s²

Hope this helps :)


What is an ion found in a glass of water

Answers

Answer:

[tex]H^{+}[/tex] ion and [tex]OH^{-}[/tex] ions.

Explanation:

As we notice the glass of water, in this observation we find that the glass also made up of sodium silicate which will give us oxygen ion.

And the water which is present in the glass will break into the hydroxyl ion and [tex]H^{+}[/tex] ion .

Therefore, glass of water contains [tex]H^{+}[/tex] ion and [tex]OH^{-}[/tex] ions.

An ion commonly found in a glass of water is the hydrogen ion (H+).

How does this happen?

When water molecules dissociate, a small fraction of them break apart into hydrogen ions (H+) and hydroxide ions (OH-). These ions are responsible for the water's ability to conduct electricity.

The presence of hydrogen ions in water makes it slightly acidic, with a pH below 7. However, the concentration of hydrogen ions in pure water is very low, making it close to neutral on the pH scale. The balance of these ions is essential for maintaining the pH and chemical properties of water.

Read more about hydrogen ions here:

https://brainly.com/question/29033205

#SPJ6


The horseshoe crab looks very similar to its fossil ancestor from the Jurassic era. Why has the horseshoe crab not evolved?

A. Its original form always remained well adapted to its environment.
B. The species was affected by natural selection.
C. The species did not pass on genetic information to its offspring.
D. The species underwent major mutations in a short period of time.

Answers

The answer is A. Natural selection always favors individuals in a population that are well adapted to their environment. These individuals are able to get to maturity and pass down their genes to subsequent generations. Any disadvantages mutations in the population are eliminated by natural selection.

Answer:

its a

A. Its original form always remained well adapted to its environment.

because it takes time to adapt to a new place

Which tubes will test positive for Benedict's test and which will test positive for Iodine test?

Answers

Disaccharides are positive in Benedicts test as it is a reducing sugar. Any animal product testing positive for starch on the lodine test may be contaminated or mixed with plant product. The positive control for the iodine test was the starch solution. 

If this helped, please give me brainliest :)
Final answer:

Benedict's test is used to identify reducing sugars and results in color changes from blue to green, yellow, or red. The Iodine test, on the other hand, identifies starch by changing from a brown iodine color to a blue-black color.

Explanation:

In conducting laboratory tests, two popular assays are the Benedict's test and the Iodine test. The Benedict's test is used to detect the presence of reducing sugars, like glucose, in a sample. If a tube turns from blue (the color of the original Benedict's solution) to green, yellow or red, it indicates a positive result - the various colors represent different levels of sugar concentration.

Conversely, the Iodine test is used to detect the presence of starch in a sample, such as in a potato or bread. In a positive Iodine test result, the originally brown iodine solution will change to a blue-black color upon interaction with starch.

Therefore, tubes containing reducing sugars (like glucose or lactose) will test positive in a Benedict's test, and tubes containing starch will test positive in an Iodine test.

Learn more about Benedict's and Iodine Tests here:

https://brainly.com/question/32559517

#SPJ6

What has occured when bubbles form in a liquid that is being heated

Answers

the waters evaporating.. theyre life air bubbles.. 

Bubbles form in a liquid being heated when it reaches its boiling point, due to the expansion of water vapor and air within them.

When bubbles form in a liquid that is being heated, such as water, this is an indication that the liquid is reaching its boiling point. Water and other liquids contain dissolved air and impurities, which become visible as small bubbles at lower temperatures. As the temperature of the liquid increases, the water vapor inside these bubbles expands. The boiling process starts when the vapor pressure inside the bubbles is equal to the atmospheric pressure. At this point, usually 100°C for water at sea level, bubbles grow rapidly in size increasing the buoyant force, causing them to rise to the surface and release their vapor in a process commonly referred to as boiling. To prevent bumping, a phenomenon where the liquid can boil violently, a boiling chip or a stirring rod can be used to provide nucleation sites for bubble formation.

Sometimes a liquid can become superheated, reaching a temperature at which it should be a gas without actually boiling. This condition is unstable and the liquid may boil suddenly, sometimes even explosively. Disturbance or introduction of nucleation sites can initiate boiling in superheated liquids.

How do i do this?



Draw a Punnett square in your assignment worksheet that shows the results of a cross between a homozygous red bull (RR) and a heterozygous red cow (Rr). Be certain to title your Punnett square and indicate each parent.

Answers

Ooh punnett squares
so
put one bull on the side and one on the top
aka
    |  R  |  r
R |RR  | Rr
R | RR | Rr

Answer:

  | R     | R

R | RR  | RR

r  | Rr   | Rr

Explanation:

The Punnett square is a square diagram that is used to predict the genotypes of a particular cross or breeding experiment.

At the top of the square you have to put the genetic contribution of one parent and at the leftmost column, the genetic contribution of other parent. And then make the combinations, as follows:

  | R     | R

R | RR  | RR

r  | Rr   | Rr

A television of mass 13 kg sits on a shelf. What is the normal force acting on the television?

A. 13.0 N
B. 127 N
C. 51.2 N
D. 99.4 N

Answers


[tex]13 \times 9.8 = 127.4[/tex]
B is the correct answer

Answer:

Normal force, F = 127 N

Explanation:

It is given that,

Mass of the television, m = 13 kg

It is sitting on the shelf. We have to find the normal force acting on it. The forces acting on it are normal force and its weight. So, the normal force is given by :

F = mg

g = acceleration due to gravity

[tex]N=13\ kg\times 9.8\ m/s^2[/tex]

F = 127.4 Newton

or

F = 127 N

Hence, the normal force acting on the television is 127 N

20 POINTS AND BRAINLIEST

describe the forces acting on the ball at the instant it is pushed. Do these forces continue to act on the ball as it rolls

Answers

Yes they keep acting until the ball is stopped. 
Ok, so the forces acting on the ball is Fraction, Potential Energy, and Kinetic Energy. So the ball goes down the ramp because of gravity, it moves because of Kinetic Energy and stops after some time because of Friction and Potential Energy. These forces do continue until the ball stops. Please give brainiest I helped!

In what way do acids affect your body?

Answers

It can affect your body's PH level. Eating foods that are alkaline tends to balance your system to the proper PH level.

what does it mean to say that momentum is conserved

Answers

It means that any system the total momentum before n event is always equal to the total momentum after the event. it usually applies to explosions or collisions.

What happens to a current when it comes in contact with a continent or landmass?

Answers

It changes direction.
 the pattern of witch direction so it changes 

Please need help still lost on this

Answers

A longitudinal wave is a wave that vibrates in the same direction as its direction of propagation. In a longitudinal wave, the direction of particle displacement is parallel to the direction of wave motion. The correct answer is "In a longitudinal wave, particle displacement is parallel to the direction of wave motion."

This means that as the wave moves forward, the particles of the medium through which the wave travels move back and forth along the same line as the wave's direction of propagation. This type of wave is often referred to as a compressional wave because it causes the particles of the medium to be compressed and then expanded as the wave passes through. An example of a longitudinal wave is sound waves. These waves move through the air by compressing and expanding the air particles along the same direction as the wave's motion, producing changes in air pressure that our ears detect as sound. Therefore, the correct answer is "In a longitudinal wave, particle displacement is parallel to the direction of wave motion."

For more questions on longitudinal wave

https://brainly.com/question/14364881

#SPJ8

If it takes 320 N of force to push a box up a ramp, yet it would take 1,600 N of force to lift the box straight up, what is the mechanical advantage of the ramp? O A. 0.2 O B. 4 O C. 5 O D. 40

Answers

MA = Fwithout help/Fwith machine
MA = 1600/320 = 5

An object's mass is a measure of how much matter makes it up. An object's weight is a measure of the gravitational force that acts on it. An object's mass is always _______ its weight.
A. proportional to
B. equal to
C. half of
D. double

Answers

Hi there!

An object's mass is always A. proportional to its weight. 

Since an object's weight is not always its mass, it depends on what forces act upon it. For example, a person standing the moon weighs less than if they were to stand on earth, but they always have the same mass. 

Hope this helps!

An object's mass is proportional to its weight. So the correct answer would be an option (A) proportional to.

What are fundamental forces?

At the considerable  fundamental level, all the forces in the existence (as currently understood) are emanated from only four forces:

The gravitational force

The electromagnetic force

The weak nuclear force

The strong nuclear force

An object's mass is proportional to its weight because weight is determined by the gravitational force acting on an object, which is directly proportional to the object's mass.

Specifically, an object's weight is equal to its mass multiplied by the acceleration due to gravity.

Therefore, if the mass of an object increases, its weight will increase proportionally, and if the mass decreases, the weight will decrease proportionally as well.

Therefore, the correct answer would be option (A) proportional to.

Learn more about the fundamental forces here:

https://brainly.com/question/14524583

#SPJ6

if a swimmer pushes off a pool wall with a force of 250n, what is her acceleration.

Answers


Her acceleration is

           (250) divided by (the swimmer's mass, in kilograms).

The unit is " meters per second² " .

Which of the following statements is true?

A.Animals add water vapor to the air through respiration.
B.Plants add water vapor to the air through photosynthesis.
C.Both plants and animals can make protein using nitrogen compounds.
D.Automobiles are the leading cause of acid rain.

Answers

I would say c. 

Forgive me if I am wrong! 
Other Questions
Elton mayo's famous experiment at the hawthorne plant concluded ________. robotics has been highly successful in work environments because workers find socialization at work to be highly toxic people who perceive that management permits them to contribute to work decisions might be more productive a physical environment with dark rooms can particularly decrease productivity because it puts workers to sleep there was a human side to the work environment that essentially gets in the way and most often jeopardizes productivity What theme other than class, marriage, pride, and prejudice did you notice in your reading of chapters 1-12 of Pride and Prejudice? How does this theme relate to the four themes already discussed in the lesson and listed above? Choose at least one other theme to analyze and relate it to a theme already discussed in the lesson. Compare the ways that Austen chooses to portray both themes. Which model of urbanization did Edward ullman develop All of the following are true of the Wade-Davis Bill EXCEPT: A.The bill was written by the moderate Republicans in Congress. B.The bill made it nearly impossible for the Southern states to rejoin the Union. C.The bill contained an iron-clad oath that required that one had never born arms against the United States nor supported the Confederacy. D.The bill was pocket-vetoed by President Abraham Lincoln. What is the current in a series circuit with a resistance of 30 ohms and a potential difference of 120 volts? Mrs. Bell has a rain gauge outside. On a very rainy day, the gauge measured 2.5 inches. The actual amount of rain that fell was 2.3 inches. To the nearest tenth, what is the percent error in Mrs. Bell's measurement? sin(76)cos(31)-cos(76)sin(31) John h. harland company is a large company with 5,200 employees and almost $800 million in annual sales. the company is best known for printing personal and business checks. harland analytical services is a technology company that produces software that enables banks to gauge the behavior of their customers by tracking their spending habits. in addition, harland owns scantron, a computerized testing and assessment company. the ________ for john h. harland company includes its check-printing business, its financial software business, and its testing and assessment business. a dos las termina la clase invert to question put the subject at the end When bill is alone with sally, he apologizes by saying, "i'm sorry about getting angry yesterday. i should have informed you sooner that i rescheduled my appointments." bill's apology could be even stronger if he had included? Why do you think Chopin does not elaborate more about Mrs.Mallard death? What is the solution set for 3x>6? What is one property of a wave that determines how much it will diffract when it encounters an obstacle?-speed-amplitude-polarization-wavelengthSuppose two waves collide, and the temporary combined wave that results is smaller than the original waves. What term best describes this interaction?-diffraction-destructive interfernce-standing wave formation-constructive interfernceThe formation of a standing wave requires-the traveling of a wave for a long distance-constructive interference between two waves of slightly different frequencies-that refraction and diffraction occur at the same time in a wave-interference between incoming and reflected waves In what way are Georgia's ports and Hartsfield-Jackson International Airport similar?Question 10 options:They both operate at a fiscal loss each year.They both are operated by the Federal government.They each receive imported goods and they both export goods.They each are located in the Coastal Plain Region of Georgia. While standing on a roof, you drop a hamner. The function y=16-64t^2 represents the height y (in feet) of the hammer t seconds after it is dropped. After how many seconds does the hammer land on the ground? Michael bought a $25.00 gift for a friend. After he bought the gift, Michael had $176.89. Write and solve an equation to calculate how much money Michael had before he bought the gift. Just want to know if this is right... A manufacturer uses a mold to make a part in the shape of a triangular prism. The dimensions of this part are shown below.Which estimate is closest to the volume in cubic millimeters of the part? (1 point) 306 768 1,008 2,016 Choose one tip for effective discipline. Explain why it is an effective method. Discipline tip and explanation: Sandra bought 120 square feet of carpet for a room in her new house. If the room is square, what is the length of each side of the room? Recall that the area of square is calculated by I square root 2, where I is the length of one side