a company buys a sweater for $14 and marks it up 90%. It later discounts the sweater 25%.

find the selling price of the sweater after the markup.

Answers

Answer 1

Answer:

$12.6 after marking it up by 90%

Step-by-step explanation:

Answer 2

Answer:

$12.6 after marking it up by 90%

Step-by-step explanation:

To calculate the markup amount, use the formula: markup = gross profit/wholesale cost. If you know the wholesale cost and the markup percentage, then calculating the gross profit just involves multiplying those two numbers. To get to the final retail sticker price, add the gross profit to the original, wholesale cost.Feb 21, 2017


Related Questions

What is sum 2/3 + 1/6?

Answers

Answer:

5/6

Step-by-step explanation:

convert 2/3 to 4/6 by multiplying by 2

4/6 + 1/6 = 5/6

Answer:

The answer is [tex]\frac{5}{6}[/tex]

Step-by-step explanation:

You need to find the GCF which is 6 so multiply the 2/3 to become 4/6 from then you can add the numerators.

Can someone do 11??? Please help I don’t want to fail my class

Answers

Answer: choice A) tan(Y) = 6/7 and tan(Z) = 7/6

Recall that the tangent of an angle is equal to the ratio of the opposite over adjacent sides

tan(angle) = opposite/adjacent

For reference angle Y, the opposite side is XZ = 6 and the adjacent side is XY = 7, so,

tan(Y) = XZ/XY = 6/7

For tan(Z), things will swap. The opposite side is now XY = 7 and the adjacent side is now XZ = 6

tan(Z) = XY/XZ = 7/6

We do not use the hypotenuse sqrt(85) at all in this problem because the tangent ratio does not involve the hypotenuse.

. The equation d + 6400 = 3/1.3 x 10". 42
relates the distance d in kilometers of a
certain GPS satellite above the surface of
the Earth to the number of hours t it takes
the satellite to complete one orbit. The
average distance of this satellite above the
surface of the Earth is 20, 100 kilometers.
To the nearest hour, how long does it
take the GPS satellite to complete one
orbit of the Earth?

Answers

The satellite's speed is approximately 45,216 kilometers per hour.

Calculating the Satellite's Speed

To find the satellite's speed in kilometers per hour, we can follow these steps:

1. Calculate the total distance traveled in one orbit:

The satellite's orbital distance is the circumference of its circular orbit around the Earth.

Circumference = 2 * π * radius

where:

π (pi) is a mathematical constant approximately equal to 3.14159

radius = distance from the satellite to the Earth's center = 6400 km + 2000 km = 8400 km

2. Calculate the orbital period in seconds:

We know the orbital period is 12 hours, but we need it in seconds for our calculations.

Convert hours to seconds: 12 hours * 60 minutes/hour * 60 seconds/minute = 43,200 seconds

3. Calculate the speed:

Speed = distance / time

Speed = total distance / orbital period

Speed = (2 * π * radius) / orbital period

Speed = (2 * 3.14159 * 8400 km) / 43,200 seconds

Speed ≈ 12.56 km/s

4. Convert speed to kilometers per hour:

Speed = 12.56 km/s * 3600 seconds/hour = 45,216 km/hr

Therefore, the satellite's speed is approximately 45,216 kilometers per hour.


The probable question can be: A satellite has recently been placed in a nearby circular orbit 2000 kilometers above the earth surface. Given that the radius of the earth is approximately 6400 kilometers and that the satellite completes its orbit in 12 hours, CALCULATE THE SPEED OF THE SATELLITE IN KILOMETERS PER HOUR.

Estimate a 15% tip on a dinner bill of 31.51 by first rounding the bill amount to the nearest ten dollars.

Answers

Answer: The estimated 15% tip would be $4.50.

Step-by-step explanation: Basically, first you will need to round the bill amount, $31.51 to the nearest ten dollars. 31.51 rounded to the nearest ten dollars is $30. Next, you will need to find the estimated tip amount. To do this multiply $30 by the tip 15%. Before you can find the tip amount, you will need to covert 15% to a decimal. To convert 15% to a decimal, divide 15 by 100 to get 0.15. Now, you can multiply 30 by 0.15 to get 4.50. So, $4.50 would be the tip if $31.51 was rounded to the nearest ten dollars.

at the flea market, erin buys a phone that is 22% off and gloves that are reduced to $19.97. erin spends a total of $48.52. let g represent the cost of the phone. write an equation that correctly represents the cost of erin's shopping trip.

Answers

Answer:

g is approximately $129.77

Step-by-step explanation:

.22g+19.97=48.52

.22g=28.55

28.55/.22=129.77

Answer:

The cost of the phone: $28.55

The total price of the phone: $129.77

48.52 - 19.97 = 28.55

The phone was marked off by 22% so you divide by 22% to get the total cost of the phone, just incase you needed that.

Hope this helps <3

Which table represents a linear function?? Help plis

Answers

Answer:

The answer is the bottom left hand corner.

Step-by-step explanation:

00:00
In 1 hour, 32 cars pass through a particular intersection. At the same rate how long would it take for 96 cars to pass through the intersection?
A 2 hours
B. 3 hours
C
8 hours
D. 16 hours

Answers

Answer:

b,3 hours

Step-by-step explanation:

because you have 32 times 2 is 64 in 2 hours so that is not is so the times 8 is 256 in 8 hours so that is not it then times 16 is 512 so 512 in 16 hours that's not it so then times 3 it is 96 cars in 3 hours

What is the mean of the following numbers?
5, 7, 2,9,5

Answers

Answer:5.6

Step-by-step explanation:

Answer:

5.6

Step-by-step explanation:

[tex] \frac{5 + 7 + 2 + 9 + 5}{5} = \frac{28}{5} = 5.6[/tex]

Coordinates of a Pre-image
The segments shown are dilations of each other about
the origin. Which statement could be true?
O
The coordinate (1, 0) is from a dilation using the
scale factor of
O
(1,0)
(5,0)
O
The coordinate (5,0) is from a dilation using the
scale factor of 4.
The coordinate (1, 0) is from a dilation using the
scale factor of 5.
The coordinate (5,0) is from a dilation using the
scale factor of
O​

Answers

Answer:

The coordinate (1, 0) is from a dilation using the scale factor of One-fifth.

Step-by-step explanation:

Answer:

this answer would be A. The coordinate (1, 0) is from a dilation using the scale factor of One-fifth.

hope this helps

Simplify.

1 – 2u + u + 4​

Answers

-1u + 5. The first thing to do is add like terms (-2u and u) (1 and 4). -2u + u is -1u or -u. 1 + 4 is 5. I hope this helps!!

Diego and Lin are drinking milkshakes. Lin starts with 12 ounces and drinks 1/4 an ounce per second. Diego starts with 20 ounces and drinks 2/3 an ounce per second. 1. How long will it take Lin and Diego to finish their milkshakes?

Answers

Answer:

Lin = 48 seconds  

Diego = 30 seconds  

Step-by-step explanation:

Hi, to answer this question we have to divide the total ounces of drink by the amount that each one drank per second, for each case.

Mathematically speaking:

Lin = 12 ounces / (1/4) ounces/second = 12/ (1/4) = 48 seconds  

Diego = 20 ounces / (2/3) ounces/second = 20/ (2/3) = 30 seconds  

Feel free to ask for more if needed or if you did not understand something.

Lin = 48 seconds  

Diego = 30 seconds  

The calculation is as follows:

Lin = 12 ounces ÷ (1/4) ounces/second = 12 ÷ (1/4) = 48 seconds  

Diego = 20 ounces ÷ (2/3) ounces/second = 20 ÷  (2/3) = 30 seconds  

Learn more: https://brainly.com/question/4804019?referrer=searchResults

a cylindrical tank has a diameter of 5 feet and the distance between the circular bases is 6 feet. find the lateral area of the tank.

Answers

Answer:

Lateral area = 94.2 ft²

Step-by-step explanation:

The formula for lateral area of cylinder is given as;

A_l = 2πrh

Where;

r is radius

h is height

Now, we are told that the distance between the 2 circular bases is 6ft. Thus, the height is 6ft.

Diameter is given as 5ft.

We know that radius = diameter/2

Thus;radius;r = 5/2 = 2.5 ft

So, lateral area = 2πrh = 2π x 2.5 x 6 = 94.2 ft²

Lateral area = 94.2 ft²

What is the radius of a base?
3 units
6 units
10 units
| 12 units

Answers

Answer:

Didn't give enough information..

Step-by-step explanation:

need to see the circle if need help ill give answer.

Translate this sentence into an algebraic inequality.x divided by the quantity y minus 9 is 18 or more.A.B.C.D.

Answers

Answer:

x/y-9 is grater than or equal to 18

Step-by-step explanation:

Answer:

B

Step-by-step explanation:

x

___     ≥        18

y-9

Tried my best to write it out like it would show it written out.

C) 0.2(x + 5) + 1 = 7​

Answers

Answer:

x = 25

Step-by-step explanation:

Given

0.2(x + 5) + 1 = 7 ( subtract 1 from both sides )

0.2(x + 5) = 6 ( divide both sides by 0.2 )

x + 5 = 30 ( subtract 5 from both sides )

x = 25

The answer X= 25 am sure

If a car has already traveled 10 miles and then continues for
another 6 hours at a steady rate of 30 miles per hour, how
many total miles will it have traveled?
miles

Answers

Answer:

190

Step-by-step explanation:

PLEASE MARK BRAINLY

190 30x6=180+10=190

Which expressions are equivalent to -6+4q+(-6q)?
Choose all answers that apply:


(Choice A)
A
-6(q+1)-4q

(Choice B)
B
2(q-3)

(Choice C)
C
None of the above
Brainiest for whoever answers first, if cannot do brainliest will 5 stars and heart

Answers

Answer:  

I believe non of the above.

Step-by-step explanation:

Answer: C- None of the above

Step-by-step explanation:

Total savings
Misumi started with $217 in her bank account. She deposits
$25.50 each week and never withdraws any money. What
expression can Misumi use to determine her account balance
after w weeks?

Answers

Answer:

y=$25.50w+$217

w=10 weeks

$25.5(10)+$217

$255+$217

$472=y

you never said how many weeks only w weeks

calculate the number in the middle of 11 and 24

Answers

Answer:

17.5

Step-by-step explanation:

11 +  24 = 35 /2

Answer:

17.5.

Step-by-step explanation:

The total number of integers from 11 to 24 =  13 + 1 = 14.

So the  2 middle numbers are 17 and 18.

Number in the middle = 17.5.

This is the median of the list of numbers.

A bag contains white marbles and blue marbles, 54 in total. The number of white marbles is 1 less than 4 times the number of blue marbles. How many white marbles are there?

Answers

Answer: There are 43 white marbles.

Step-by-step explanation:

t = total number of marbles = 54

w = white marbles = 4b - 1

b = blue marbles

54 = b + (4b - 1)

b + 4b = 5b

54 = 5b - 1

+1

55 = 5b

/5

11 = b

There are 11 blue marbles.

4(11) - 1

44 - 1 = 43

43 + 11 = 54, therefore our solutions are correct.

Answer:

43

Step-by-step explanation:

W = 4B - 1

W + B = 54

4B - 1 + B = 54

5B = 55

B = 11

W = 4(11) - 1

W = 43

Ryan would like to save 15% of his take-home pay towards retirement. How much should
he save each month if he makes $5,000 each month?
$750
$1125
$75
$75,000

Answers

15%=0,15

5000×0,15=750$

Answer: He should save $750

what's the least common denominator of 5/6 2/3 and 3/5?​

Answers

Answer:

30

Step-by-step explanation:

6*5= 30

3*10=30

5*6=30

Factor the following and remember to factor out any common factors first.

x^2+8x+15

Enter the factors separated by semicolons. ( ; )

Answers

Answer:

(x+5) (x+3)

Step-by-step explanation:

x^2+8x+15

What two numbers multiply to 15 and add to 8

5*3 = 15

5+3 = 8

(x+5) (x+3)

You are charged $16.7 in total for a meal. Assuming that the local
sales tax is 7.6%, what was the menu price of this item?
*How would I work this out I keep getting 15.43 but that’s not correct

Answers

the price before tax is $15.52

Final answer:

To find the menu price of an item after a total charge of $16.7 with a 7.6% local sales tax, calculate the total sales tax amount and then deduct it from the total cost to obtain the menu price of $15.43.

Explanation:

To find the menu price of the item after being charged $16.7 in total for a meal with a 7.6% local sales tax:

Calculate the sales tax amount: 7.6% of $16.7 = $1.27

Subtract the sales tax from the total cost: $16.7 - $1.27 = $15.43

Therefore, the menu price of the item was $15.43. Make sure to round off correctly based on the question requirements.

Which expression is equivalent to 1/3 + 3/4 + 2/3

Answers

Answer:

7/4 or 1.75 or 1  3/4

Step-by-step explanation:

What is the sum of the series? Write in expanded form making sure to show all steps used to find the sum.

Answers

Given:

[tex]\sum_{k=3}^{6}(-2 k+5)[/tex]

To find:

The sum of the series.

Solution:

[tex]$\sum_{k=3}^{6}-2 k+5[/tex]

Substitute k = 3, 4, 5 and 6.

               [tex]$=[-2 (3)+5] +[ -2 (4) +5]+[-2 (5)+5]+[-2 (6)+5][/tex]

               [tex]$=[-6+5] +[ -8 +5]+[-10+5]+[-12+5][/tex]

               [tex]$=[-1] +[ -3]+[-5]+[-7][/tex]

Apply minus plus rule: [tex]+(-a)=-a[/tex]

               [tex]$=-1 -3-5-7[/tex]

               [tex]$=-16[/tex]

[tex]$\sum_{k=3}^{6}-2 k+5=-16[/tex]

Therefore the sum of the series is -16.

If answered correctly will give brainiest plz helpppppp!!!!!!

Answers

Answer:

50.29

Step-by-step explanation:

(25 1/7)/(22/7) = diameter

8 = diameter -->

4 = radius

4^2 pi = area

16pi=area

16*22/7 = area

352/7 = area

50.29 is (approx.) area

five times as many girls as boys went to the dance. The total of 120 students went to the dance. How many boys and girls went to the dance?

Answers

Answer:

100 girls and 20 boys

Step-by-step explanation:

since its 5 times as many girls multiply 20 by 5 which is 100 and then boom 20 boys cause 100 divided by 5 is 20

Which pyramid has the greatest surface area?
Pyramid

Answers

Answer:

the greatest surface is A

Step-by-step explanation:

Answer:

answer is A have a great day

Step-by-step explanation:

Evaluate:
© 20
© 20.8
O 24
DONE

Answers

Answer:

24

Step-by-step explanation:

1. 24

2. 0

3. a [4.9] and [3.1]      and      c [-6] and [-6]

4. edge answer: The statement is not true for all real numbers. It is only true for decimal or fractional values of x . If x is an integer, then the ceiling function returns x when the input is x . But, the flooring function returns x + 1 when the input is x + 1. Since x does not equal x + 1 when x is an integer, the expressions are not equal when x is an integer.

5. edge answer: There are three steps. The steps are at 8 from 0 to 1, at 12 from 1 to 2, and at 16 from 2 to 3. Closed circles are on the left side of each step, and open circles are on the right.

6. all real numbers

7. all multiples of 4

8. multiples of 8 greater than 0

9. 3

10. real numbers ≥ 0

11. integers ≥ 0

12. f(x)=2.50[x-1]

here's your reminder to fix your posture (you know you're slouching, that'll hurt your back when you're old lol) and go get some water! hydration is best because your body uses it to regulate body temperature, keep joints lubricated, prevent infections, deliver nutrients to cells, and keep organs functioning properly. being well-hydrated also improves sleep quality, cognition, and mood! also, if you don't drink water for 3-21 days (depends on age and body and stuff) you'll die. so there's that too.

summary of that ^ fix your posture and drink some water <3

Other Questions
The pressure in an automobile tire filled with air is 245.0 kPa. If Po2 = 51.3 kPa, Pco2 = 0.10 kPa, and P-others = 2.3 kPa, what is Pn2? Suppose y varies inversely with x. Write an equation if y=40 when x=16 Which part of an atom is most directlly involved in chemical bonding? Which set of measurements forms a right triangle? Use the Pythagorean theorem: a2 + b2 = c2.A) 10, 12, 15B) 10, 13, 15C) 9, 12, 15D) 9, 11, 15 you have $15.a. How much money do you have left if you ride each ride once?You have $ left.b. Do you have enough money to ride each ride twice? Explain.It costs $ to ride each ride once, and you have $ left.Question 2response - correct Kelli Blakely is a portfolio manager for the Miranda Fund, a core large-cap equity fund. The market proxy and benchmark for performance measurement purposes is the S&P 500. Although the Miranda portfolio generally mirrors the asset class and sector weightings of the S&P, Blakely is allowed a significant amount of leeway in managing the fund. However, her portfolio holds only stocks found in the S&P 500 and cash. Miguel is a golfer, and he plays on the same course each week. The following table shows the probability distribution for his score on one particular hole, known as the Water Hole. Score34567 Probability0.150.400.250.150.05 Let the random variable X represent Miguels score on the Water Hole. In golf, lower scores are better. (a) Suppose one of Miguels scores from the Water Hole is selected at random. What is the probability that Miguels score on the Water Hole is at most 5 ? Show your work. A loop of wire lies flat on the horizontal surface in an area with uniform magnetic field directed vertically up. The loop of wire suddenly contracts to half of its initial diameter. As viewed from above induced electric current in the loop is: Consider a sampling distribution with p equals 0.15p=0.15 and samples of size n each. Using the appropriate formulas, find the mean and the standard deviation of the sampling distribution of the sample proportion. a. For a random sample of size n equals 5000n=5000. b. For a random sample of size n equals 1000n=1000. c. For a random sample of size n equals 500n=500. Which of the following terms could not be part of a polynomial expression?(1) 7x(3) -3r?(2) 8(4) 6/x^3 PLZ ANSWER BEING TIMED!!!!!!!!!! WILL MARK BRAINLIEST GIVE THANKS AND MARK 5 STARS!!!!!!! To practice Problem-Solving Strategy 15.1 Mechanical Waves. Waves on a string are described by the following general equation y(x,t)=Acos(kxt). A transverse wave on a string is traveling in the +x direction with a wave speed of 8.25 m/s , an amplitude of 5.50102 m , and a wavelength of 0.540 m . At time t=0, the x=0 end of the string has its maximum upward displacement. Find the transverse displacement y of a particle at x = 1.51 m and t = 0.150 s . ok, I need help with this one!!!!!!!!!!!!!!!!!!!! plz and thank youWhich statement is a correctly written thermochemical equation?2C8H18+25O216CO2+18H2O , H=5,471kJ/mol4Fe(s)+3O2(g)2Fe2O3(s) , H=3,926kJNH4Cl NH4+ + ClC3H8(g)+O2(g)CO2(g)+H2O(l), H=2,220kJ/mol Which value represents the interquartile range (IQR)?A)50B)110C)160D)560 Using words and information around the unknown word to figure out the meaning and pronunciation of the unknown word is called expression. Please select the best answer from the choices provided T F using trig to find a side. help please ! Why did the author include this description?A. to explain how a star produces lightB. to explain how light travelsC. to explain how cats see in the darkD. to explain how fog forms A foreign company (whose sales will not affect benjamin's market) offers to buy 4,100 units at $7.61 per unit. in addition to variable manufacturing costs, selling these units would increase fixed overhead by $610 and selling and administrative costs by $310. if benjamin accepts the offer, its profits will: Why is regular exercise important?It cancels the need to eat well.It improves energy and boosts mood.It ensures excellent academic performance.It prevents obstacles and challenges from occurring. Who do the congregation and the other ministers appoint to care for the ailing Dimmesdale?