A container was found in the home of the victim that contained 130 g of ethylene glycol in 380 g of liquid. What was the percentage of ethylene glycol?

Answers

Answer 1

Final answer:

The percentage of ethylene glycol in the solution is calculated to be 34.21% by mass, which is obtained by dividing the mass of ethylene glycol by the total mass of the solution and then multiplying by 100.

Explanation:

The percentage of ethylene glycol in the solution can be calculated using the mass percentage formula, which is the mass of ethylene glycol divided by the total mass of the solution, then multiplied by 100 to convert it into a percentage. In this case, we have 130 g of ethylene glycol and a total solution mass of 380 g. The calculation would be:

Percentage of ethylene glycol = (Ethylene glycol mass / Total solution mass) × 100

Percentage of ethylene glycol = (130 g / 380 g) × 100

Percentage of ethylene glycol = 0.3421 × 100

Percentage of ethylene glycol = 34.21%

Therefore, the solution contains 34.21% ethylene glycol by mass.


Related Questions

Boron - 10 emits alpha particles and cesium - 137 emits beta particles. Write balanced nuclear
reactions for each radioactive decay.

Answers

The balanced nuclear reaction is:10/5 B → 4/2 He + 6/3 Li.The balanced nuclear reaction is:137/55 Cs → 137/56 Ba + 0/-1 e Where Ba stands for Barium.

The balanced nuclear reaction for Boron-10 emits alpha particles and cesium-137 emits beta particles are as follows:Balanced nuclear reaction for Boron-10:Boron-10 emits an alpha particle, which consists of two protons and two neutrons, therefore the atomic mass of Boron-10 decreases by four, and the atomic number decreases by two, resulting in the formation of a new atom i.e. Helium-4.

Balanced nuclear reaction for Cesium-137:Cesium-137 emits a beta particle which is an electron, and when a beta particle is emitted, a neutron inside the atom changes into a proton, resulting in the formation of a new atom with the same mass number, but an atomic number that has increased by one.

Learn more about nuclear reactions,here:

https://brainly.com/question/13315150

#SPJ3

Final answer:

The radioactive decay of Boron-12 by beta particle emission can be represented by the nuclear equation ⁵B¹² → ⁵C¹² + ⁰e⁻ + γ, resulting in Carbon-12 and a gamma ray. For Cesium-137, the decay is represented by ⁵⁵Cs¹³⁷ → ⁵⁶Ba¹³⁷ + ⁰e⁻, producing Barium-137 and a beta particle.

Explanation:

The student's question requires writing balanced nuclear equations for the radioactive decay of Boron-10 and Cesium-137. However, the question has an error since Boron-10 does not usually emit alpha particles, so we will correct it to Boron-12, which undergoes beta decay:

Boron-12 emitting a beta particle and a gamma ray can be represented as:

⁵B¹² → ⁵C¹² + ⁰e⁻ + γ

In this equation, Boron-12 ( ⁵B¹² ) decays to Carbon-12 ( ⁵C¹² ) by emitting a beta particle (⁰e⁻) and a gamma ray (γ). The gamma ray represents the release of excess energy after the decay.

For Cesium-137 undergoing beta decay, the equation is as follows:

⁵⁵Cs¹³⁷ → ⁵⁶Ba¹³⁷ + ⁰e⁻

In this equation, Cesium-137 (⁵⁵Cs¹³⁷) decays to Barium-137 (⁵⁶Ba¹³⁷) by emitting a beta particle (⁰e⁻).

Can you determine which of two unknown elements has the larger radius if the only known information is that the atomic number of one of the elements is 20 greater than the other? Explain.

Answers

Yes you can
You can determine that the element with the atomic number that is 20 greater will be bigger because when an element is bigger, it will have more particles (electrons, protons, and neutrons) which means that the atom will get bigger which will cause it to have a bigger radius

Answer:

Yes, you can determine which one.

Explanation:

Hi, there are many factors that can be used to compare the atomic radius of to elements but the most important is the amount of electrons each atom has.

The atomic number represents the amount of protons and electrons (if the element isn't ionized) that the atom has.

The more electrons the atom has, the more energy levels it completes. And each of this levels has a longer radius than the one before it.

So, higher levels completed represent longer atomic radius.

In conclusion, a element with an atomic number 20 greater than the other has 20 more electrons, completed more energy levels and its radius will be longer

What is the de Broglie wavelength of an electron traveling at 1.62×105 m/s ?

Answers

Answer:

0.449  10^(-8)  meters

[tex]0.449 * 10^{-8}[/tex] meters

Explanation:

Use the deBroglie equation for the wavelength (lambda):

[tex]lambda = \frac{h}{m*v}[/tex]

where h stands for the Plank constant: [tex]6.6261 * 10^{-34} J[/tex]

m stands for the mass of the electron: [tex]9.109 * 10^{-31} kg[/tex]

and v is the given velocity: [tex]v = 1.62 *  10^5 \frac{m}{s}[/tex]

Evaluating lambda for these values:

[tex]lambda = \frac{h}{m*v}= \frac{6.6261 * 10^{-34} }{9.109 * 10^{-31} * 1.62 * 10^{5}} = 0.449* 10^{-8} m[/tex]

Answer : The wavelength of an electron is, [tex]4.39\times 10^{-9}m[/tex]

Explanation :

According to de-Broglie, the expression for wavelength is,

[tex]\lambda=\frac{h}{p}[/tex]

and,

[tex]p=mv[/tex]

where,  

p = momentum, m = mass, v = velocity

So, the formula will be:

[tex]\lambda=\frac{h}{mv}[/tex]

where,

h = Planck's constant = [tex]6.626\times 10^{-34}Js[/tex]

[tex]\lambda[/tex] = wavelength  = ?

m = mass  of electron = [tex]9.31\times 10^{-31}kg[/tex]

v = velocity = [tex]1.62\times 10^5m/s[/tex]

Now we have to calculate the wavelength.

Now put all the given values in the above formula, we get:

[tex]\lambda=\frac{h}{mv}[/tex]

[tex]\lambda=\frac{6.626\times 10^{-34}Js}{(9.31\times 10^{-31}kg)\times (1.62\times 10^5m/s)}[/tex]

[tex]\lambda=4.39\times 10^{-9}m[/tex]

Therefore, the wavelength of an electron is, [tex]4.39\times 10^{-9}m[/tex]

Select the correct answer.
An ion has a net charge of 3+. If this ion has 8 protons, how many electrons does it have?

Answers

Answer 12

Explanation:

Answer:

Ion formed from the atom contains 8 positive protons and 5 negative electrons

Explanation:

Atomic number = number of electrons = number of protons

So the atom contains 8 protons and 8 electrons

Protons are positively charged and electrons are negatively charged.

An ion with a positive charge (cation) is formed by the loss of negative electrons

An ion with a negative charge (anion) is formed by the gain of negative electrons.

The question says ion has a net charge of 3+ so it means the atom has lost 3 electrons from it.

So ion formed from the atom contains 8 positive protons and 5 negative electrons (Answer)

To find the number of neutrons we make use of the formula  

Please Note: Mass number - atomic number = number of neutrons

How many calories would be needed to heat 5.0 lbs of copper from 22 degrees C to 80.0 degrees C? C for copper = 0.092

Answers

Answer:

[tex]1.21\times 10^4[/tex] cal would be needed to heat 5.0 lbs of copper from 22 degrees C to 80.0 degrees C.

Explanation:

[tex]Q=m \times c \times \Delta T[/tex]

where

[tex]\Delta T[/tex] = Final T - Initial T

Q is the heat energy in calories

c is the specific heat capacity (for copper 0.092 cal/(g℃))  

m is the mass of water

plugging in the values

[tex]$Q=5.01 b s \times 0.092 \frac{c a l}{g^{\circ} \mathrm{c}} \times\left(80.0^{\circ} \mathrm{C}-22^{\circ} \mathrm{C}\right)$[/tex]

Please Note:

1 lb = 453.592grams  

So,  

5 lbs = 5 × 453.592g  = 2268 g

[tex]$\begin{aligned} Q &=2268 g \times 0.092 \frac{c a l}{g^{\circ} \mathrm{C}} \times 58^{\circ} \mathrm{C} \\\\ Q &=12102 \mathrm{cal} \end{aligned}$[/tex]

[tex]=1.21\times10^4[/tex] cal (Answer)

Consider a sample of calcium carbonate in the form of a cube measuring 2.805 in. on each edge.
If the sample has a density of 2.70 g/cm3 , how many oxygen atoms does it contain?

Answers

Final answer:

To find the number of oxygen atoms in a sample of calcium carbonate, calculate the number of moles of calcium carbonate and multiply by the number of oxygen atoms per molecule. The sample contains approximately 29.331 oxygen atoms.

Explanation:

To determine the number of oxygen atoms in a sample of calcium carbonate, we need to know the number of moles of calcium carbonate and the formula of calcium carbonate. The formula for calcium carbonate is CaCO3, which means there is one calcium atom (Ca), one carbon atom (C), and three oxygen atoms (O) in each molecule of calcium carbonate.



First, we need to find the volume of the cube. The volume of a cube is given by V = s3, where s is the length of the sides of the cube. In this case, the length of the sides of the cube is 2.805 in. Therefore, the volume is V = 2.8053 = 22.124 in3.



Next, we need to convert the volume from cubic inches to cubic centimeters, as the density is given in g/cm3. Since 1 in3 = 16.3871 cm3, the volume in cm3 is 22.124 in3 * 16.3871 cm3/in3 = 362.274 cm3.



Finally, we can calculate the mass of the sample of calcium carbonate using the density formula: density = mass/volume. Rearranging the formula, mass = density * volume. Plugging in the values, mass = 2.70 g/cm3 * 362.274 cm3 = 978.780 g.



Now, we know the mass of the sample, which is equal to the molar mass of calcium carbonate multiplied by the number of moles. The molar mass of calcium carbonate (CaCO3) is calculated by adding the atomic masses of calcium, carbon, and three oxygen atoms: 40.08 g/mol + 12.01 g/mol + (3 * 16.00 g/mol) = 100.09 g/mol.



Using the equation: mass = molar mass * moles, we can solve for the moles of calcium carbonate in the sample. Rearranging the equation, moles = mass / molar mass. Plugging in the values, moles = 978.780 g / 100.09 g/mol = 9.777 mol.



Since there are three oxygen atoms in each molecule of calcium carbonate, the total number of oxygen atoms in the sample is calculated by multiplying the number of moles of calcium carbonate by the number of oxygen atoms per molecule: 9.777 mol * 3 = 29.331 oxygen atoms.

Learn more about Calcium carbonate here:

https://brainly.com/question/32371197

#SPJ3

Tim puts his spare change in a jar each day when he comes home. When the jar is full he separates the coins and takes them to the bank. The coins would be classified as a _________.
A) compound
B) element
C) mixture
D) solution

Answers

I believe it’s A) compound not really sure though

Answer:

C) mixture

Explanation:

Mixture : It is defined as the substance that is made by the combination of two or more different components.

Hence, they can be separated. Answer - C

Pure substance : It is defined as a substance that is made by the combination of only one type of atom or only one type of molecule.

Compound : It is a pure substance which is made from atoms of different elements combined together in a fixed ratio by mass.

Element : It is a pure substance which is composed of atoms of similar elements.

Solution: It is the special type of the homogeneous mixture which is composed of more than one substances.

In pea plants, yellow seed color is completely dominant to green seed color.
A pure yellow-seeded plant is crossed with a pure green-seeded plant. What
alleles will be present in the body cells of the offspring?

Answers

Answer:

Assuming that the Alleles are uppercase Y for the dominant yellow and lowercase y for the recessive green, the alleles present in the hybrid plant will be Yy, and the color would be yellow as it is a dominant trait.

Answer:

We need to use a Punnett Square to figure this out.

Explanation:

Let's say that for the pea plants, Big Y represents the color yellow while Little y is the color green. If Big Y is dominant (which determines the plant's color) it means the plant is yellow. If Little y is dominant, the plant is green.

A phenotype (the genetic makeup of the offspring) would be green if it's genotype was Yy , or YY. It would be yellow if it was yy.

Both "parent" plant's genotype is "pure" which I'd presume means homozygous (two big letters). We need to use a mono-hybrid cross (4 squares, 1 trait) and cross the parents to see what we get.

MOM PEA PLANT - yy (green, homozygous recessive)

DAD PEA PLANT - YY (yellow, homozygous dominant)

OFFSPRING - 100% Yy (yellow, heterozygous)

There is no way that the parents could make a green plant with their genotypes. So the probability is that 100% of their offspring would be yellow, with the phenotype Yy.

4. Distinguish where kinetic energy and
potential energy are the greatest in the loop.

Answers

Answer:

We need a picture of the problem to solve!

Explanation:

Final answer:

Potential energy is greatest at the top of a loop (like a rollercoaster or pendulum), due to height and gravity. Kinetic energy, or the energy of motion, is greatest at the bottom of the loop, due to speed and the downward pull of gravity.

Explanation:

The distinction between where kinetic energy and potential energy are greatest in the loop of, say, a roller coaster or pendulum swing depends on gravity and motion.

At the top of the loop, the potential energy is at its greatest. This energy is stored due to the object's position relative to other objects, height, and gravity. Potential energy is highest when the rollercoaster is at its highest point because gravitational pull is maximized and movement is momentarily paused.

On the other hand, kinetic energy, which is energy in motion, is greatest at the bottom of the loop. This is because all the potential energy has been converted into kinetic energy as the rollercoaster or pendulum descends, speed increases, and pulls downwards by gravity.

Learn more about Energy here:

https://brainly.com/question/36891624

#SPJ2

What happens to the temperature of a substance while it is changing state? Explain.

Answers

Answer:

the temperature of a substance while changing often times while rise or fall depending on what is happening. Say you have an ice cube and you put it into a hot soup to cool the soup down the ice cube melts due to the surrounding temperature. In other cases if you want to cool something hot like say hot water you can 1:put it in a cool place such as a refrigerator or freezer or 2:you can leave it out to cool to room temperature.

If something I said didnt make sense plz dont get mad or anything I am only in jr.high in 8th grade and the school year is still fresh so I'm trying to catch up on somethings.

Answer:

When any substance changes its state, the temperature remains constant.

Explanation:

It happens so because the amount of heat supplied during the change of state of any substance is utilized to break the intermolecular forces of attraction or other kinds of forces.

how to convert moles to molecules

Answers

Explanation:

To convert from moles to molecules we simply multiply the number of moles by Avagadro's number, 6.02 × 10²³.

For example if we have 1 mol of a substance we have 6.02 × 10²³ molecules of that substance.

1 mol × 6.02 × 10²³ = 6.02 × 10²³ molecules.

To convert moles to molecules, multiply the number of moles by Avogadro's number, which is 6.022 x 10²³ molecules/mole.

To convert moles to molecules, you need to use Avogadro's number. Avogadro's number is 6.022 x 10²³, which is the number of molecules (or atoms, ions) in one mole of a substance.

Here are the steps for the conversion:

First, identify the number of moles you want to convert.

Next, multiply the number of moles by Avogadro's number (6.022 x 10²³ molecules/mole).

For example, if you have 2 moles of a substance, the number of molecules is calculated as follows:

Molecules = Moles x Avogadro's number

Molecules = 2 moles x 6.022 x 10²³ molecules/mole

Molecules = 1.2044 x 10²⁴ molecules

So, 2 moles of a substance contain 1.2044 x 10²⁴ molecules.

Which best describes ionization energy ?

Answers

Answer:

Ionization energy is the energy needed to remove an electron from an atom or ion in a gas phase.

HOPE THIS HELPED!!!!!!!!!!!!!! XDDDDDDD

Answer:

Are there multiple choices if they're is please show them for example

A.Apple

B.Banana

C.Carrot

D.Plums

calculate the concentration of OH- of a solution of hydrobromic acid (HBr) given that its pH is 1.7​

Answers

Answer:

Explanation: This is Quite matching Answer. The formula for pH is pH = -log[H+]. This means pH is the negative base 10 logarithm ("log" on a calculator) of the hydrogen ion concentration of a solution. To calculate it, take the log of the hydrogen ion concentration and reverse the sign to get the answer.

Subscribe to JELLO CRAFT

Consider the reaction of methane with ammonia and oxygen.
2CH4 (g) + 2NH3 (g) + 3O2 (g) 2HCN (g) + 6H2O (l)

Determine the limiting reactant in a mixture containing 123 g of CH4, 114 g of NH3, and 423 g of O2. Calculate the maximum mass (in grams) of hydrogen cyanide, HCN, that can be produced in the reaction.

The limiting reactant is:
NH3
CH4
O2

Amount of HCN formed =
g

Answers

Final answer:

The limiting reactant in the reaction is NH3. The maximum mass of HCN that can be produced is approximately 180.63 g.

Explanation:

To find the limiting reactant, you firstly convert the mass of each reactant to moles. For CH4, the molecular weight is approximately 16.04 g/mol, so 123 g CH4 is 123/16.04 = about 7.67 moles. For NH3, the molecular weight is approximately 17.03 g/mol, so 114 g NH3 is 114/17.03 = about 6.69 moles. For O2, the molecular weight is approximately 32 g/mol, so 423 g O2 is 423/32 = about 13.22 moles.

The balanced equation shows that the reaction consumes CH4, NH3 and O2 in a 2:2:3 ratio. So for the given amount of reactants, the number of mole ratios is 7.67/2 = 3.84 for CH4, 6.69/2 = 3.35 for NH3 and 13.22/3 = 4.41 for O2. The smallest value is NH3’s which is 3.35, so NH3 is the limiting reactant.

The balanced equation shows that 2 moles of NH3 will produce 2 moles of HCN. Therefore, 6.69 moles of NH3 will produce 6.69 moles of HCN. As the molar mass of HCN is 27 g/mol, the maximum mass is 6.69 moles * 27 g/mol = approximately 181.63 g of HCN.

Learn more about Limiting Reactant here:

https://brainly.com/question/33417913

#SPJ3

WHAT HAPPENS TO HOT AIR?

Answers

Answer:

Hot air rises

Explanation:

Hot air rises because when you heat air (or any other gas for that matter), it expands. When the air expands, it becomes less dense than the air around it. The less dense hot air then floats in the more dense cold air much like wood floats on water because wood is less dense than water.

Experiment #2
Question: Do different types of music affect how well a person can do his/her homework?
Hypothesis: Music that does not have a strong beat makes concentrating on a homework assignment easier.
Music with heavy beats makes concentration more difficult.
Experiment:
Sara Lilia pulled out four different CD's to find out which type helped her to finish her homework the
fastest. The first CD was rock, the second reggaeton, the third classical, and the fourth was cumbia. She chose a
math assignment that required concentration.
Sara Lilia used a stopwatch with an alarm to make sure that she only listened to each CD for 5 minutes.
Each time the alarm went off, Sara Lilia recorded how many problems she was able to finish.
At the end of the experiment, she found that she was able to concentrate the most with the classical
music, then the rock, and the cumbia. She noticed that she did not concentrate much at all with the reggaeton
and felt like dancing and singing along instead of working.
A. What was the independent variable?
B. What was the dependent variable?
C. What was the control?_
D. Was there a constant variable?

Answers

Answer:

Explanation:

An independent variable is a variable in which does not rely on how other variables. It is usually cause in an experiment. From Sara Lilia experiment, we can identify the different music genres as her independent variable.

The dependent variable here is her ability to concentrate in her study. Here, we should know that the dependent variable is often the result of the effects of the independent variable.

There is no control in the experiment. In the controlled set up, we would have put all other know factors that would make concentrations easier into consideration. It could be the environment, the arrangement of the room and a particular time of the day. None of such was stated in the experiment.

The constant variable is the variable that was held fixed throughout the experimental procedure. Here the time of study was fixed at 5minutes. What would happen to concentration if this time was shorter or much more?

Which undefined geometric term is described as a two-dimensional set of points that has no beginning or end?

Answers

Answer:

The two-dimensional set of points that has no beginning or end is described by the undefined geometric term plane.

Explanation:

There are three undefined terms in geometry:

point,line, andplane

They are referred as undefined terms because they are not defined in a formal way, i.e. using mathematically defined words. At the end these terms are abstractions (ideas).

The point has no dimensions, it can be represented by the tip of a sharp pencil.

The line is referred as an infinite set of joined points that extend indefinitely in one direction (from right to left, from north to south), so it has one dimension. The intersection of of two perpendicular walls is an example of what a line is.

Finally, the term to which the question is referred is the plane: an infinite set of joined points that extends in two dimensions. An example of plane is the surface of quite water. The plane does not have depth, only extension; that is why it has only two dimensions.

So, you should remember: points do not have dimensions, lines have one dimension, and planes have two dimensions.

The chemical formula of a compound does not indicate?

Answers

Answer: Option (c) is the correct answer.

Explanation:

A compound is defined as the substance in which different elements are chemically combined together in a fixed ratio by mass.

For example, [tex]MgSO_{4}[/tex] is a compound and elements are present in 1:4 ratio.

A compound can be divided into its constituent or simpler substances.

Hence, a chemical formula shows the elements involved in it along with their identity and relative proportion.

But a chemical formula does not tell how atoms are joined together as it can be done by structural formula and not by chemical formula.

Thus, we can conclude that the chemical formula of a compound does not indicate how elements are joined in the compound.

A sample of gas is enclosed in a container of fixed volume, Identify which of the following statements are
true. Check all that apply.
If the container is heated the gas particles will lose kinetic energy and temperature will increase.
If the container is cooled, the gas particles will lose kinetic energy and temperature will decrease.
If the gas particles move more quickly, they will collide more frequently with the walls of the container
and pressure will increase.
If the gas particles move more quickly, they will lose energy more rapidly and collide with the walls of
the container less often, and pressure will decrease.
If the gas particles move more quickly, they will collide with the walls of the container more often and
with more force, and pressure will increase.

Answers

Answer:

If the container is cooled, the gas particles will lose kinetic energy and temperature will decrease.

If the gas particles move more quickly, they will collide more frequently with the walls of the container  and pressure will increase.

If the gas particles move more quickly, they will collide with the walls of the container more often and  with more force, and pressure will increase.

Explanation:

The temperature of gases is a measure of the average kinetic energy of the molecules. With increasing temperature comes more kinetic energy for the gaseous particles. If temperature of the system is reduced, the particles will have less kinetic energy and would not be able to move. Temperature is directly proportional to average kinetic energy.

Pressure of gases increases when there is more frequent collision between their particles. The usual case is for gases to move more rapidly as a result of increase in kinetic energy of the system. The particles collides more frequently with one another and the walls of the container if the kinetic energy is raised.

Answer:

If the container is cooled, the gas particles will lose kinetic energy and temperature will decrease.

If the gas particles move more quickly, they will collide more frequently with the walls of the container and pressure will increase.

If the gas particles move more quickly, they will collide with the walls of the container more often and with more force, and pressure will increase.

Explanation:

On a caterpillar's map, all distances are marked in millimeters. The caterpillar's map shows that the distance between two milkweed plants is 4, 012milim . What is this distance in kilometers ?

Answers

Answer:

0.004012km

Explanation:

Problem:

Conversion of millimeters(mm) to Kilometers:

value given = 4012mm

Here, we are converting from a submultiple unit to a multiple unit.

Millimeter depicts 10⁻³m and kilometer stands for 10³m

Now, we must find how many exponents will take us from 10⁻³ to  10³

careful examination shows that if we multiply a power of 10⁶ to 10⁻³ it will give a 10³:

   i.e 10⁻³ x 10⁶ = 10⁻³⁺⁶ = 10³

Therefore,

       10⁶mm = 1km

      4,012mm = [tex]\frac{4012}{1000000}[/tex] = 0.004012km

Final answer:

To convert millimeters to kilometers, we have to remember that 1 kilometer equals 1000 meters and 1 meter equals 1000 millimeters, hence 1 kilometer equals 1,000,000 millimeters. So, 4012 millimeters is equal to approximately 0.004012 kilometers.

Explanation:

The subject of this question pertains to unit conversion within the metric system. Given a distance measured in millimeters (mm), we want to convert this to kilometers (km). To convert, we will utilize the fact that 1 kilometer equals 1000 meters and 1 meter equals 1000 millimeters. Therefore, 1 kilometer equals 1,000,000 millimeters.

To convert 4012 millimeters into kilometers, we divide 4012 by 1,000,000, which gives us approximately 0.004012 kilometers. So, the distance between the two milkweed plants on the caterpillar's map, when converted to kilometers, is 0.004012 kilometers.

Learn more about Unit Conversion here:

https://brainly.com/question/19420601

#SPJ3

If a light ray strikes a flat mirror at an angle of 27 degrees, what will the reflected ray be?

Answers

30 degrees from the mirror's surface

pretty sure It's correct and if it is then your welcome

The concept law of reflection is used here to find out the angle of reflected ray. The angle of reflected ray is also  27 degree. The light reflected from a mirror surface is an example of reflection of light.

What is Law of reflection?

The law of reflection states that the angle of reflection is always equal to the angle of incidence. Here the incident ray, reflected ray and the normal to the surface of the mirror is found to lie in the same plane.

A common reflected image is given by the the law of reflection where the distance between the object and the mirror is same as that of the distance between the image and the mirror.

The law of reflection can be shown here.

Thus the angle of reflected ray is 27 degree which is same as that of incident angle.

To know more about law of reflection, visit;

https://brainly.com/question/30191486

#SPJ6

 

plz help!!


A group of students performed an experiment to prove the law of conservation of energy. In the experiment, a flask containing water at room temperature was shaken vigorously for a few minutes. The table shows a partial record of the temperature of the water before and after shaking.

Experimental Record
Temperature
Before Shaking 21 °C
After Shaking Unknown


What best predicts the unknown temperature? (3 points)

Less than 21 °C because heat energy is formed from the energy used in shaking

Greater than 21 °C because heat energy is formed from the energy used in shaking

Less than 21 °C, because the total energy of the system after shaking is higher than before shaking

Greater than 21 °C, because the total energy of the system after shaking is higher than before shaking
9.
(01.04 HC)

The table shows the potential energy and kinetic energy of a skier at two different positions on a hill.

Position and Energy
Position (above ground) Kinetic Energy Potential Energy
100 meters 0 units 50,000 units
60 meters ? 30,000 units


What is the kinetic energy of the skier at a height of 60 meters above ground? (3 points)

20,000 units, because total energy remains unchanged

80,000 units, because total energy remains unchanged

20,000 units, because total energy of the skier decreases

80,000 units, because total energy of the skier decreases

Answers

Answer:    Greater than 21 °C because heat energy is formed from the energy used in shaking

Explanation:    I got this test and i got it right

Final answer:

The temperature of the water will be greater than 21 °C because the shaking converts the kinetic energy into thermal energy. The kinetic energy of the skier at a height of 60 meters is 20,000 units.

Explanation:

The law of conservation of energy states that energy cannot be created or destroyed, only transformed from one form to another. In the experiment described, the shaking of the flask converted the kinetic energy of the students' motions into thermal energy, thereby increasing the temperature of the water. Therefore, the temperature of the water after shaking will be greater than 21 °C because heat energy is formed from the energy used in shaking.

The kinetic energy of the skier can be calculated by subtracting the potential energy at the height of 60 meters from the potential energy at the height of 100 meters. Since the potential energy at the height of 100 meters is 50,000 units and the potential energy at the height of 60 meters is 30,000 units, the difference is 20,000 units. Therefore, the kinetic energy of the skier at a height of 60 meters is 20,000 units.

Learn more about Conservation of energy here:

https://brainly.com/question/35373077

#SPJ2

what are cathode rays made of

Answers

Answer:

electrons

Explanation:

they are composed of negatively charged particles also known as electrons

Final answer:

Cathode rays are made up of electrons, which are particles with a negative charge and mass. This was determined through historical experiments that demonstrated cathode rays' deflection by magnetic and electric fields and measured their charge-to-mass ratio.

Explanation:

Cathode rays are composed of particles known as electrons. Historical experiments conducted by scientists like J. J. Thomson and William Crookes revealed the nature of these rays. Using a cathode ray tube, Crookes observed that a paddle wheel placed between the electrodes moved from the cathode towards the anode upon the commencement of the tube, suggesting that the rays had mass. Similarly, Thomson's experiments, which involved deflecting the cathode ray with magnetic and electric fields, established that these rays are indeed made up of charged particles with a negative charge and have a specific mass-to-charge ratio.

The discovery that cathode rays are deflected away from a negatively charged electrical field and toward a positively charged field, along with their response to magnetic fields, was crucial in determining their particle nature. Thomson's calculation of the electron's charge-to-mass ratio further cemented the understanding of cathode rays, leading to the realization that electrons are fundamental components of all atoms, not just specific types of gases or metals used in the experiments.

what are metalloids​

Answers

A metalloid is an element that has properties that are intermediate between those of metals and nonmetals. Metalloids can also be called semimetals. On the periodic table, the elements colored yellow, which generally border the stair-step line, are considered to be metalloids.

Final answer:

Metalloids are elements with intermediate properties between metals and nonmetals, found along the staircase line of the periodic table and exclude aluminum and polonium. They are semiconductors with applications in electronics, as their conductivity increases with temperature. Silicon is a well-known metalloid, which is used for its semiconductor properties.

Explanation:

Metalloids are elements that exhibit properties intermediate between those of metals and nonmetals. These elements, sometimes referred to as semimetals, are located on the periodic table along a staircase line starting from element 5B (boron) and ending at 85At (astatine), excluding aluminum and polonium which are classified as metals. Metalloids such as boron, silicon, germanium, arsenic, antimony, and tellurium display a combination of metallic and nonmetallic characteristics, for instance, they tend to look metallic, but they do not conduct electricity as well as metals and thus are considered semiconductors.

These elements find numerous applications in the field of electronics due to their unique ability to control electrical conductivity. Their conductivity increases with temperature, a property that distinguishes them from metals and makes them valuable in electronic devices. The intermediate electronegativity and chemical behaviors are due to their electron structure, making them versatile in reactions; they form covalent crystals unlike metals but do not form monatomic anions like nonmetals. Silicon, a prominent metalloid, is particularly noted for its luster and brittleness.

Convert: 127 degrees Celsius = ______K -400 127 400 146 -146

Answers

Answer:

400.15 kelvin

Explanation:

Laws differ from theories because laws do not provide

A. a hypothesis
B. a description
C. an explanation
D. a statement​

Answers

Answer:

C. An explanation

Dimenstional analysis: How far can you travel in 7 hours of driving if your rate of speed is 55 miles per hour?​

Answers

Answer:

385 miles

Explanation:

To solve this question using dimensional analysis we first must seperate the speed into a fraction. Then we multiply this by the amount of hours, this will cancel out the hours giving us the speed.

[tex]\frac{55 mi}{1h}[/tex] × 7 h = 385 miles

Write a balanced chemical equation for the decomposition of RbNO3.

Help me please!!!​

Answers

Answer:

2RbNO³ --> 2Rb + N² + 30²

Hope this helps!

Final answer:

The decomposition of RbNO3 can result in different products depending on the reaction conditions, and alkali metal nitrates typically decompose into their metal oxides, nitrogen dioxide, and oxygen. For an accurate balanced equation, specific details regarding the decomposition conditions are necessary.

Explanation:

The decomposition of RbNO3 (rubidium nitrate) would lead to the formation of rubidium nitrite (RbNO2) and oxygen (O2). However, typical nitrates of alkali metals like rubidium do not decompose into nitrites and oxygen as do nitrates of heavier metals; instead, they usually decompose into the nitrate's corresponding metal oxide, nitrogen dioxide, and oxygen. Therefore, since this behavior can be complex and context-dependent, I would need more specific information about the conditions of the decomposition to provide a precise equation.

Let's take a more generic example for illustrative purposes:

Decomposition of potassium chlorate: 2 KClO3 → 3 O2 + 2 KCl.

In case of RbNO3, if we were to speculate a similar simple decomposition, a balanced chemical equation might be:

2 RbNO3 → 2 RbNO2 + O2.

However, this is just a hypothetical example and should not be taken as the actual decomposition of rubidium nitrate. Understanding the decomposition of such compounds requires knowledge of the specific conditions under which the reaction occurs.

Which equation represents the combined gas law?
o Pq Va = P2 V2
| VI VÀ
O TT
Pq Vq Tq = P₂ V 2T 2

Answers

Answer:

The answer to your question is below:

Explanation :

The combined gas law as it name says it combines three gas laws: Boyle's law, Charles' law and  Gay Lussac Law. It states that at initial conditions of pressure, volume and temperature, it there is a change in one of this variables

the equilibrium will be equivalent to a second equilibria of pressure, volume and temperature.

                        [tex]\frac{P1V1}{T1}  =  \frac{P2V2}{T2} \\[/tex]

"1" indicates initial conditions

"2" indicates final conditions

The combined gas law is represented by the equation P1V1/T1 = P2V2/T2 and is used to model the behavior of gases when the number of moles and the ideal gas constant are constant.

The equation that represents the combined gas law is:

P1V1/T1 = P2V2/T2

This law combines Boyle's law, Charles's law, and Gay-Lussac's law, and it is used when the number of moles (n) of a gas and the ideal gas constant (R) are held constant. The combined gas law allows us to predict how a gas will behave under different sets of conditions in terms of pressure (P), volume (V), and temperature (T), assuming the amount of gas in moles does not change.

Examples of Gas Laws:

Boyle's Law: P1V1 = P2V2 (at constant n and T)

Charles's Law: V1/T1 = V2/T2 (at constant n and P)

Gay-Lussac's Law: P1/T1 = P2/T2 (at constant n and V)

Each can be derived from the combined gas law depending on which variables are held constant.

which of the following is an example of inference? Explain WHY.

A. The girl is wearing red shoes
B. My science binder has 45 pages in it.
C. Ms. Sparks must be a great reader she is always carrying around books.
D. There is a cat sitting by the window.

Answers

Answer:

C

Explanation:

This is because you are guessing that since Mrs. Sparks always carries around books, she must be a great reader. All the other answers are just facts that you see. For c, you are guessing this.

Answer:

C

Explanation:

Must is the key word. An inference is a guess, you guess Ms. Sparks must be a great reader because she is always carrying around books. You don't know for sure she is a great reader which makes it an inference. Hope this helps!

Other Questions
What's the different between an outside salesforce and an inside salesforce? How is the principle of superposition used to determine the stress state for a combined loading? Let a = 0.9876 and b = 0.9887 with N = 2, calculate the midpoint. What was one result of the Emancipation Proclamation? Imagine that you caught a female albino mouse in your kitchen and decided to keep it for a pet. A few months later, while vacationing in Guam, you caught a male albino mouse and decided to take it home for some interesting genetic experiments. You wonder whether the two mice are both albino due to mutations in the same gene. What could you do to find out the answer to this question? Assume that both mutations are recessive. I need to know the answers of 10, 12, and 14 Carrying the genetic code and determining an organism's structure and function are the functions ofDNAORNA The nurse is caring for a client after insertion of an implanted insulin pump. Which statement by the client indicates a need for further instruction?a. " I should expect to gain less weight with this pump."b. " I need to make sure I still give my insulin before I eat".c. "This will help me to have better control of my blood sugar ".d. "This pump delivers a continuous infusion of insulin throughout the day ". Spermatogenesis takes place within the ________________ Wilson has already prepared 2 kilograms of dough and will continue preparing 1 kilogram ofdough every hour. How much dough did Wilson prepare if he worked for 4 hours? Emily purchased a building to store inventory for her business. The purchase price was $760,000. Emily also paid legal fees of $300 to acquire the building. In March, Emily incurred $2,000 to repair minor leaks in the roof (from storm damage earlier in the month) and $5,000 to make the interior suitable for her finished goods and $300 for legal fees. What is Emily's cost basis in the new building? The black mamba is one of the worlds most poisonous snakes, and with a maximum speed of 18.0 km/h, it is also the fastest. Suppose a mamba waiting in a hide-out sees prey and begins slithering toward it with a velocity of +18.0 km/h. After 2.50 s, the mamba realizes that its prey can move faster than it can. The snake then turns around and slowly returns to its hide-out in 12.0 s. Calculate the mamba's average velocity for the complete trip. Five-year-old Jonah likes to play a scrabble-like game on the family computer. He plays against other family members, and usually does pretty well. When he gets a list of letter tiles that are too difficult for him to use, he asks his mother and father for help. The difference between letter tiles that Jonah can use and letter tiles with which he needs help typifies what Vygotsky called the zone of ____ development. The antibiotic rifampin inhibits the bacterial RNA polymerase, preventing it from binding to the promoter region. This inhibits ___________a. translationb. transcriptionc. transpositiond. transductione. transformation 6h-3=7h-13step by step pleasee We sometimes "signal" interest in someone without the use of words, which is part of how we establish a relationship with another person, possibly a lasting one. How would an anthropologist describe our behavior? The probability that a lab specimen contains high levels of contamination is 0.15. A group of 3 independent samples are checked. Round your answers to four decimal places (e.g. 98.7654). (a) What is the probability that none contain high levels of contamination? (b) What is the probability that exactly one contains high levels of contamination? (c) What is the probability that at least one contains high levels of contamination? Can i please have help i will rate 5 and thank. Song Title:Year Song Was Released:1.How many different instruments do you hear in this band or group? Identify and name the instruments you hearAnswer: 2.Is one instrument featured more prominently than the others? What is it about the sound of that instrument that makes a distinct impression on the listener? What is unique about this instrument? Answer:3.Choose an instrument that you normally dont pay much attention to (maybe the bass or the keyboard, for instance). Listen carefully to how it sounds in this song. Describe three interesting features that characterize this instrument and its sound. Why is this instrument crucial to the overall sound of this band? Explain your reasoning.Answer:4.Think about the singer and the instruments in the band. Are the instruments and the singer of equal importance? In your opinion, which is more important and why do you think so?Answer: which of the following is indicated by the arrow in the image Convert the condensed structures to line angle formulas: 1. CH3CH2CH(CH3)CH2CH3 8. CH:COCH 9. CH3CH2OCH3 2. CH3CH2CH(CH2CH3)CH(CH3)CH2CHO CH)CH:CH-CH: 10. CH CH2CH=C(CH:CH)(C(CH))CH 3. CH3CH2CH(CH3)CH(CH3)CH2CH3 11. CH:CH-CH(CH2CH)CH OH 4. CH3C(CH3)2CH2CH2CH(CH3)CH2CH3 12. CHCHOCH2CHO 5. CH(CH3)2CH(CI)CH2CH3 13. HOOCCH2NHCH(CH3)COCH; 6. CH3CH2CHOCH(CH2CH3)CH2CH3 14. HOOCCH OCH COOH 7. HOCH:C(CH3)2CONH2