Find the mid points of a and b where a has coordinates (8,2) and b has coordinates (3.8)

Find The Mid Points Of A And B Where A Has Coordinates (8,2) And B Has Coordinates (3.8)

Answers

Answer 1

Answer:

(5.5,5)

Step-by-step explanation:

Answer 2

Answer:

The coordinate of the midpoint is (5.5,5)

Step-by-step explanation:

To find the midpoint between two points, find the average of the x coordinates and the midpoint of the y coordinates.

x=(8+3)/2

x=11/2

x=5.5

y=(2+8)/2

y=10/2

y=5

The coordinate of the midpoint is (5.5,5)


Related Questions

Which equation represents a line that passes through (-9, -3) and has a slope of -6?
y-9=-5(x – 3)
y+9= -6(x + 3)
y-3--5(x – 9)
y+3=-6[X + 9)

Answers

Answer:

  y +3 = -6(x +9)

Step-by-step explanation:

The point-slope form of the equation of a line is ...

  y -k = m(x -h)

for a line with slope m through point (h, k).

You want the line with slope -6 through point (-9, -3), so its equation is ...

  y -(-3) = -6(x -(-9))

  y +3 = -6(x +9) . . . . . matches the last choice

What is the volume of the sphere? (Use 3.14 for π.) 28.26 in.3 113.04 in.3 339.12 in.3 452.16 in.3


Answers

Answer:

1.3 x 3.14 x 3 x 3 x 3 = 27 x 1.3 x 3.14 = 113.04

formula is 4/3 x pi x radius to the power of three

Step-by-step explanation:

I may have used google...

Answer:

It's 113.04 in. 3

Step-by-step explanation:

I used the formula from the person on top, credits to them ^^

I am a three digit number. I am number between 350 and 400. All my digits are different and they are all odd. The sum of my last two digits is 16. What number am I

Answers

Answer:

397

Explanation: 9+7 =16 and 3 is odd

Answer:

397

Step-by-step explanation:

379 or 397 with fit the criteria

What is the solution to the system of equations below? Negative 4 x + 6 y = negative 18 and y = negative 2 x + 21

Answers

If I had to guess that it mean -4x + 6y = -18 and y = -2x+21:

Since we have a y =, we can plug that in.

-4x + 6(-2x + 21) = -18

-4x  -12x + 126 = -18

-16x = -18 -126

-16x = -144

-16x/-16 = -144/-16

x = 9

The value of x is equal to 9 and the value of y is equal to 3

Data given;

-4x + 6y = -18y = -2x + 21

System of Equations

To solve the linear equations above, we have to use substitution method.

from equation 1

[tex]-4x + 6y = -18[/tex]

Make x the subject of formula

[tex]-4x + 6y = -18\\x = \frac{9 + 3y}{2}[/tex][tex]-4x + 6y = -18\\-4x = -18 - 6y \\\frac{-4x}{-4} = \frac{-18-6y}{-4}\\ x = \frac{9 + 3y}{2}[/tex]

substitute the value of x into equation 2

[tex]y = -2x + 21\\y = -2(\frac{9+3y}{2})+ 21\\ y = {-9-3y} + 21\\y = -3y + 12\\4y = 12\\4y/4 = 12/4\\y = 3[/tex]

substitute the value of y into either equation 1 or 2

[tex]y = -2x + 21\\3 = -2x + 21\\2x = 21 - 3\\2x = 18\\2x/2 = 18/2\\x = 9[/tex]

From the calculations above, the value of x is 9 and y is 3

Learn more on system of equations here;

https://brainly.com/question/13729904

the difference between circumference and area.

Answers

Answer:

The circumference of a circle is the length of its side, the area is the amount of space within it.

Step-by-step explanation:

Answer:

The circumference of a circle is the length of its side, the area is the amount of space within it.

Have a good day! (:

A square sheet of paper measures 25 centimeters on each side. What is the length of the diagonal of this paper?

Answers

Answer:

35.36 cm

Step-by-step explanation:

The diagonal of a square will be given by

[tex]D=\sqrt {a^{2}+b^{2}}[/tex]

Where a is the length of one side and b is the length of another side. For a square, botj sides are equal hence the diagonal calculations will be as follows

Given that a is 25 then

[tex]D=\sqrt {25^{2}+25^{2}}[/tex]

D=35.3553390593274

Rounding off the nearest two decimal place

D=35.36 cm

Final answer:

The length of the diagonal (c) of the square paper that measures 25 cm on a side can be found using the Pythagorean Theorem (a² + b² = c²). In this case, a = 25cm, b = 25cm, and by solving for c we get c = √(25² + 25²) ≈ 35.36 cm.

Explanation:

In order to answer your question about the length of the diagonal of a square, you would need to use the Pythagorean Theorem. The Pythagorean Theorem is a mathematical principle which states that in a right-angled triangle, the square of the length of the hypotenuse (the side opposite the right angle) is equal to the sum of the squares of the lengths of the other two sides. This can be expressed as: a² + b² = c².

In a square, all sides are equal, so we can consider the given measurement of 25 cm for both 'a' and 'b'. Hence, a = 25cm and b = 25cm. That would make our equation: 25² + 25² = c². When you calculate it, we get 625 + 625 = c², summing them up you get 1250 = c². To find 'c', you will take the square root of 1250 which equals approximately 35.36 cm. So, the length of the diagonal of the square paper is around 35.36 cm.

Learn more about Pythagorean Theorem here:

https://brainly.com/question/19649203

#SPJ3

Lyle went fishing for 1 hour and 30 minutes until he ran out of bait at 6:40 p.m. At what time did Lyle start fishing? *

Answers

Answer:

he started fishing by 5:10pm

Step-by-step explanation:

just subtract 1:30 from 6:40

Hillel is juggling flaming torches to raise money for charity. His initial appearance raises \$500$500dollar sign, 500, and he raises \$15$15dollar sign, 15 for each minute of juggling performance. The amount RRR of money Hillel raises is a function of t, the length of his performance in minutes. Write the function's formula.

Answers

Answer:

$R = $500 + $15(t)

Step-by-step explanation:

in this question, we are told to give a mathematical expression that would model the amount of money that is made by Hillel.

from the question, we were made to understand that the amount of money he makes is a front of his time t. that is noted.

and also, he has a base cost of $500.

now, let’s write an equation;

R = $500 + 15(t)

where t represents the length of the performance as suggested by women

Bob and John are 450 feet apart when they start running towards each other. Bob runs at a speed of 11 feet per second, and John runs at a speed of 14 feet per second. How soon will they meet?

Answers

Answer:

18 s

Step-by-step explanation:

We are given that

Distance between Bob and John=450 feet

Speed of Bob=11ft/s

Speed of John=14 ft/s

We have to find the time after they will meet when they are travel towards to each other.

Total distance traveled by Bob and John in 1 s=11+14=25 ft

25ft covered by Bob and John in 1 s

1 ft covered by Bob and John in [tex]\frac{1}{25}s[/tex]

450 ft covered by Bob and John  in [tex]\frac{1}{25}\times 450=18 s[/tex]

Hence, they will meet after 18 s.

Answer:

18 seconds

Step-by-step explanation:

450 divided by 11+14=18

Bonita has $2.95 in dimes and quarters in her pocket. If she has five more dimes than quarters, how many of each coin does she have?

Answers

Bonita have 12 dimes and 7 quarters in her pocket.

What is linear expression?

A linear expression is an algebraic statement where each term is either a constant or a variable raised to the first power.

Given that;

Bonita have with dimes and quarters in pocket = $2.95

Bonita have 5 more dimes than quarters.

Now,

Let number of dimes = x

Let number of quarters = y

Since, Bonita have 5 more dimes than quarters.

x = y + 5

Here,

Bonita have with dimes and quarters in pocket = $2.95

So, we can formulate;

0.1x + 0.25y = =$2.95

Substitute the value of x in above equation, we get;

0.1 (y + 5) + 0.25y = $2.95

0.1y + 0.5 + 0.25y = $2.95

0.35y + 0.5 = $2.95

Subtract 0.5 we get;

0.35y + 0.5 - 0.5 = $2.95 - 0.5

0.35y = 2.45

Divide by 0.35 we get;

y = 7

And, x = y + 5 = 7 + 5 = 12

Thus, Bonita have 12 dimes and 7 quarters in her pocket.

Learn more about the linear expression visit:

https://brainly.com/question/28061742

#SPJ2

Write each equation in logarithmic form.


5^3 = 125

Answers

Answer:

log5(125)=3 The 5 should be smaller and a little lower.

Step-by-step explanation:

Hannah's school hosted a book donation. There are 150150150 students at her school, and they donated a total of bbb books! Hannah donated 333 times as many as the average number of books each student donated. How many books did Hannah donate

Answers

Answer:

Hanna donated b/50 books

Step-by-step explanation:

In this problem, we have:

n = 150 number of students at Hanna's school

b = ? number of total books donated by the students

Also, Hannah has donated 3 times as many as the average number of books each student donated.

The average number of books each student donated can be written as:

[tex]\frac{b}{150}[/tex]

And calling

h = number of books donated by Hannah

This means that

[tex]h=3(\frac{b}{150})[/tex]

Simplifying, this can be rewritten as

[tex]h=\frac{b}{50}[/tex]

Answer:

b/50

Step-by-step explanation:

An object is launched from a platform.
Its height (in meters), xxx seconds after the launch, is modeled by:
h(x)=-5(x-4)^2+180h(x)=−5(x−4)
2
+180h, left parenthesis, x, right parenthesis, equals, minus, 5, left parenthesis, x, minus, 4, right parenthesis, squared, plus, 180
How many seconds after being launched will the object hit the ground?

Answers

Answer:

  10

Step-by-step explanation:

Ground level is where h = 0, so solve the equation ...

  h(x) = 0

  -5(x -4)^2 +180 = 0 . . . . substitute for h(x)

  (x -4)^2 = 36 . . . . . . . . . . divide by -5, add 36

  x -4 = 6 . . . . . . . . . . . . . . positive square root*

  x = 10 . . . . . . add 4

The object will hit the ground 10 seconds after launch.

_____

* The negative square root also gives an answer that satisfies the equation, but is not in the practical domain. That answer would be x = -2. The equation is only useful for time at and after the launch time: x ≥ 0.

The object modeled by the quadratic equation h(x)=-5(x-4)²+180 will hit the ground 10 seconds after being launched.

The equation given is a quadratic equation which models the height of an object after being launched from a platform. To find out when the object will hit the ground, we need to determine when the height h(x) is equal to zero. The equation can be written as h(x) = -5(x - 4)² + 180.

To find the time when the object hits the ground, we set the height equal to zero and solve for x:
0 = -5(x - 4)² + 180
Solving the quadratic equation, we divide both sides by -5:
(x - 4)² = 36
Taking the square root of both sides gives two solutions: x - 4 = [tex]\pm6[/tex]. The positive root gives us the time after launch when the object hits the ground:
x - 4 = 6
x = 10

Therefore, the object will hit the ground 10 seconds after being launched.

A shop sells packs of black pens, packs of red pens and packs of green pens.

There are:


3 pens in each pack of black pens

5 pens in each pack of red pens

6 pens in each pack of green pens


On Monday

number of packs sold of black, red and green pens = 7 : 2 : 4

A total of 220 were sold.


Work out the number of green pen sold. Show your working out.

Answers

Answer: There are 96 green pens sold.

Step-by-step explanation:

Since we have given that

Number of pens in each pack of black pens = 3

Number of pens in each pack of red pens = 5

Number of pens in each pack of green pens = 6

Ratio of number of packs sold of black, red and green pens = 7: 2: 4

Number of total pens sold = 220

So, ratio of pens in number of packs would be

[tex]7\times 3:2\times 5:4\times 6\\\\=21:10:24[/tex]

So, Number of green pens sold would be

[tex]\dfrac{24}{55}\times 220\\\\=24\times 4\\\\=96\ pens[/tex]

Hence, there are 96 green pens sold.

96 green pens were sold.

Since the number of packs sold of black, red and green pens are in the ratio  7 : 2 : 4

Also, a total 220 pens were sold. Let x represent the total number of packs, hence:

Number of black pens = 7x/13 * 3 = 21x/13

Number of red pens = 2x/13 * 5 = 10x/13

Number of green pens = 4x/13 * 6 = 24x/13

Hence:

21x/13 + 10x/13 + 24x/13 = 220

21x + 10x + 24x = 2860

55x = 2860

x = 52

Number of green pens = 24x/13 = 24(52)/13 = 96

Hence  96 green pens were sold.

Find out more at: https://brainly.com/question/25343092

Tayiln buys 5 ounces of tea leaves for $2.35. At this rate how much money does she need to buy 12 ounces of tea leaves?

Answers

Answer:

5.64

Step-by-step explanation:

set up a ratio problem

5 ounces/2.35 = 12 ounces/x

5x = 28.2

x = 5.64

Answer:

5.64

Step-by-step explanation:

5x2.4=12

SO,

2.35x2.4=5.64

A circle has a radius of 2 units. Find the radian measure of a central angle that intercepts an arc length of 5.8 units. Round the radians measure to the nearest tenth.

Answers

Answer:

2.9 radians.

Step-by-step explanation:

Please kindly check the attached file for explanation.

The radian measure of a central angle intercepting an arc length of 5.8 units in a circle with a radius of 2 units is 2.9 radians when rounded to the nearest tenth.

The question deals with finding the radian measure of a central angle in a circle with a given radius and arc length. The formula for this calculation is theta = arc length / radius. Given that the circle's radius (r) is 2 units and the arc length (l) is 5.8 units, we substitute these values into the formula to find the radian measure of the central angle.

theta = l / r = 5.8 units / 2 units

This gives us theta = 2.9 radians. However, we need to round this to the nearest tenth, resulting in theta = 2.9 radians as the final answer.

Factor the quadratic expression completely.
-8x^2 -15x + 2 =​

Answers

Answer:

Step 1: −8x2−15x+2

Step 2: (−8x+1)(x+2)

Step 3: Say thank you

The factors of quadratic equation are : (8x -1) and (x + 2)

Given ,

-8x² -15x + 2 =​ 0

Now,

Firstly multiply the equation with -1 to make the coefficient of x² positive .

8x² + 15x -2 = 0

Now taking the factors,

8x² + 16x - 1x -2 = 0

8x(x + 2) -1 (x + 2) = 0

(8x -1) (x + 2) = 0

Thus,

The factors are (8x -1) and (x + 2).

The values of x are 1/8 and -2 .

Know more about quadratic equation,

https://brainly.com/question/30098550

#SPJ2

There were 32 volunteers to donate blood. Unfortunately, n of the volunteers did not meet the health requirements, so they couldn't donate. The rest of the volunteers donated 470 milliliters each.
How many milliliters of blood did the volunteers donate?

Answers

Answer:

470(32 - n)

Step-by-step explanation:

Here are the given:

> 32 volunteers

> n volunteers who didn't donate

> 470 mL each

So your expression is: 470(32 - n).

Why?

Subtract the 32 volunteers who want to donate blood from the volunteers who were not able to donate then multiply it by 470.

Hope this helps!

Suppose you are a designer making the traffic sign above. What is the sum of the interior angles of the equilateral triangle? What is the measure of ∠N? What is the measure of ∠M? Explain your reasoning. (2 points)


Answers

Answer:

Measure of <N = 60°

(angles in an equilateral triangle are all equall 60°)

the measure of ∠M= 60°

(angles in an equilateral triangle are all equall 60°)

Step-by-step explanation:

Sum of angles in a triangle is equall to 180....

And in equilateral triangle of all sides equall...all angles are equal to 60° because all sides are equal.

So <m= <n=<o=60°

jsjsjjs jsjsjjs Help

Answers

Answer:

84,500

Step-by-step explanation:

8.45*10^4

8.45 * (10*10*10*10)

8.45 * 10000

84500

the decimal place moves to the right for however many zeros you have :)

i hope this helps :)

Please help me out please 10 point

Answers

Answer:

Its A.

Step-by-step explanation:

answer:
the answer is A

The product of a number and five more than twice a number is 75. Find the number numbers

Answers

Assume number =x,

x(2x+5) = 75

=> 2x^2 + 5x -75 = 0

=> 2x^2+ 15x -10x -75 =0

 

=> x(2x+15)-5(2x+15)=0

=>(x-5)(2x+15)=0

x = 5, or x = -15/2

Starting at the age of 40, an average man loses 5%of his hair every year. At what age should an average man expect to have half his hair left?

Answers

At the age of 53.5136 years, an average man expects to have half his hair left.

Given information:

Starting at the age of 40, an average man loses 5% of his hair every year.

So, at the age of 40 years, an average man will have 95% of total hairs left.

Let t be the number of years after the age of 40 years.

So, the value of t so that the man will have 50% of hairs left can be calculated as,

[tex]50\%=(1-5\%)^t\\0.5=(1-0.05)^t\\0.5=0.95^t\\log0.5=t\rm \;log0.95\\\it t=\rm 13.5136[/tex]

So, the age of the man with 50% hairs left will be 40+13.5136=53.5136 years.

Therefore, at the age of 53.5136 years, an average man expects to have half his hair left.

For more details, refer to the link:

https://brainly.com/question/14294555

Find the trapezoid.The trapoized has an area of

Answers

Answer: what trapezoid?

HELP PLZ THIS IS DUE TODAY

Answers

Answer:

1300π

Step-by-step explanation:

The volume of a cylinder is

V = Area of base * height

The base is a circle, so its area is

A = πr^2

The radius is half the diameter: 20/2 = 10 ft.

A = π10^2 = 100π

Plug this back into the volume formula:

V = 100π * height

   = 100π * 13

   = 1300π ft

Maria drives at a rate of 60 miles per hour. It takes her 3 hours to get to her aunt's house. How long will it take if she drives at a rate of 50 miles per hour?

Answers

Answer:

3.4 miles

Step-by-step explanation:

60 × 3 = 180

she has to drive 180 miles

180 ÷ 50 = 3.4

3.4 miles

Final answer:

In this problem, we need to understand the relationship between rate, time and distance. Here, we establish that Maria's aunt's house is 180 miles away. When Maria drives at a rate of 50 miles per hour, it takes her 3.6 hours to reach her aunt's house.

Explanation:

This is a problem of rate, time, and distance, specifically about understanding how changes in rate (or speed) affect time. Here, Maria drives to her aunt's house at a rate of 60 miles per hour, which takes 3 hours. The distance to her aunt's house, then, is 60 miles/hour times 3 hours, or 180 miles. We know that distance = rate times time (D = rt).

Now, when Maria drives at a rate of 50 miles per hour, the time will change. To find the new time, we rearrange the formula to t = D/r. Plugging the values in, t = 180 miles / 50 miles/hour, we get 3.6 hours. So, it would take Maria 3.6 hours to reach her aunt's house if she drives at a rate of 50 miles per hour.

Learn more about Rate, Time, and Distance here:

https://brainly.com/question/35683374

#SPJ2

What are two ways to name the marked angle? *

Answers

Angles are named in two ways. You can name a specific angle by using the vertex point, and a point on each of the angle's rays. The name of the angle is simply the three letters representing those points, with the vertex point listed in the middle. You can also name angles by looking at their size.

Find the probability that a randomly selected student drives to school.

Answers

Final Answer:

The probability that a randomly selected student drives to school is [tex]\( \frac{2}{45} \)[/tex].

Explanation:

The probability of an event is calculated by dividing the number of favorable outcomes by the total number of possible outcomes. In this case, the number of sophomores who drive to school is 2, and the total number of sophomores is the sum of those who drive, take the bus, and walk: 2 + 25 + 3 = 30. Therefore, the probability for sophomores is [tex]\( \frac{2}{30} \)[/tex]. Similarly, for juniors, it is [tex]\( \frac{13}{35} \)[/tex], and for seniors, it is [tex]\( \frac{25}{35} \)[/tex]. To find the overall probability, we take the weighted average:

P(driver to school) = [tex]\frac{\text{(Number of sophomores)} \times P(\text{sophomores}) + \text{(Number of juniors)} \times P(\text{juniors}) + \text{(Number of seniors)} \times P(\text{seniors})}{\text{Total number of students}}[/tex]

[tex]\[ P(\text{driver to school}) = \frac{2 \times \frac{2}{30} + 13 \times \frac{13}{35} + 25 \times \frac{25}{35}}{30 + 35 + 35} \][/tex]

After calculating, the final answer is [tex]\( \frac{2}{45} \)[/tex], representing the probability that a randomly selected student drives to school. This approach considers the distribution of students across different grades, giving a more accurate representation of the overall likelihood.

Juan and Lizzy are in the final week of their training for a marathon. Juan's goal is to run one mile on the first day of the week and double the amount he runs each day for the next six days. Lizzy's goal is to run 10 miles on the first day of the week and increase the amount she runs by 3 miles each day for the next six days. 1: Juan's marathon training schedule is an example of a(n) : arithmetic or geometric 2: Lizzy's marathon training schedule is an example of a(n) : arithmetic or geometric 3: Who will be better prepared for the marathon: Juan or Lizzy

Answers

Answer:

1. Juan's marathon training schedule is an example of a geometric sequence

2. Lizzy's marathon training schedule is an example of an arithmetic sequence

3. Lizzy will be better prepared for the marathon

Step-by-step explanation:

In the arithmetic sequence there is a common difference between each two consecutive terms

In the geometric sequence there is a common ratio between each two consecutive terms

Juan's Schedule

∵ Juan's will run one mile on the first day of the week

∴ [tex]a_{1}[/tex] = 1

∵ He will double the amount he runs each day for the next

   6 days

- That means he multiplies each day by 2 to find how many miles

   he will run next day

∴  [tex]a_{2}[/tex] = 1 × 2 = 2 miles

∴  [tex]a_{3}[/tex] = 2 × 2 = 4 miles

∴  [tex]a_{4}[/tex] = 4 × 2 = 8 miles

∴  [tex]a_{5}[/tex] = 8 × 2 = 16 miles

∴  [tex]a_{6}[/tex] = 16 × 2 = 32 miles

∴  [tex]a_{7}[/tex] = 32 × 2 = 64 miles

That means there is a common ratio 2 between each two consecutive days

1. Juan's marathon training schedule is an example of a geometric sequence

Lizzy's Schedule

∵ Lizzy's will run 10 miles on the first day of the week

∴ [tex]a_{1}[/tex] = 10

∵ She will increase the amount she runs by 3 miles each day for

   the next six days

- That means she adds each day by 3 to find how many miles

    she will run next day

∴  [tex]a_{2}[/tex] = 10 + 3 = 13 miles

∴  [tex]a_{3}[/tex] = 13 + 3 = 16 miles

∴  [tex]a_{4}[/tex] = 16 + 3 = 19 miles

∴  [tex]a_{5}[/tex] = 19 + 3 = 22 miles

∴  [tex]a_{6}[/tex] = 22 + 3 = 25 miles

∴  [tex]a_{7}[/tex] = 25 × 3 = 28 miles

That means there is a common difference 3 between each two consecutive days

2. Lizzy's marathon training schedule is an example of an arithmetic sequence

The rule of the sum of nth term in the geometric sequence is [tex]S_{n}=\frac{a_{1}(1-r^{n})}{1-r}[/tex]

∵ [tex]a_{1}[/tex] = 1 , r = 2 and n = 7

∴  [tex]S_{7}=\frac{1(1-2^{7})}{1-2}[/tex]

∴  [tex]S_{7}[/tex] = 127

Juan will run 127 miles in the final week

The rule of the sum of nth term in the arithmetic sequence is [tex]S_{n}=\frac{n}{2}[a_{1}+a_{n}][/tex]

∵ n = 7,  [tex]a_{1}[/tex] = 10  and  [tex]a_{7}[/tex] = 28

∴ [tex]S_{7}=\frac{7}{2}(10+28)[/tex]

∴ [tex]S_{7}[/tex] = 133

Lizzy will run 133 miles in the final week

∵ 133 miles > 127 miles

∴ Lizzy will run more miles than Juan

3. Lizzy will be better prepared for the marathon

Sadie decorated her horse with ribbons for the Memorial Day Parade. In the mane, she used 6 feet of ribbon. She used an additional 11 inches of ribbon around her front right leg. How many inches of ribbon did she use altogether for the horse?

Answers

Answer: 83 inches

Step-by-step explanation:

1 foot = 12 inches

In the mane, she used 6 feet of ribbon. 6×12 = 72 inches

 She used an additional 11 inches of ribbon around her front right leg

Altogether she use 72 + 11 = 83 inches

Other Questions
1.) l ___ bastante serio pero hoy ___ muy gracioso.a. es,esb. es, estac. esta, estad. soy, esta2.) Los padres de Angel ___ de Cuba.a. estnb. esc. estsd. son3.) Luis y yo ___ de estados unidos. Ahora ___ en Espaa.a. son, estnb. somos, estnc. son, estd. somos, estamos 4.) Hoy ella ___ muy obstinada y agresiva tambien. a. estsb. estnc. estd. es5.) l ___ muy nervioso porque turns dolor de cabeza.a. estb. estsc. estnd. estoy 6.) Ellos ___ de mal humor.a. estb. sonc. estnd. ests7.) La casa de ngel ___ en la Calle 60.a. estb. estnc. estsd. estoy8.) Ella ___ ambicioso.a. estb. esc. soyd. son*will give brainliest!!!* John bought 3 cds and 2 dvds. Each cd cost $9.95, and each dvd cost $14.98. Write an equation representing the total cost c. do you think classification of economic activities into primary secondary an tertiary is usefull? explain how A painter uses the expression 35h + 30c to determine how much he charges a customer for a job that takes h hours and c cans of paint. His last job required 3 cans of paint and took 15 hours to complete. How much did the painter charge? a) $540 b) $555 c) $615 d) $638 The pressure in an automobile tire filled with air is 245.0 kPa. If Po2 = 51.3 kPa, Pco2 = 0.10 kPa, and P-others = 2.3 kPa, what is Pn2? Suppose y varies inversely with x. Write an equation if y=40 when x=16 Which part of an atom is most directlly involved in chemical bonding? Which set of measurements forms a right triangle? Use the Pythagorean theorem: a2 + b2 = c2.A) 10, 12, 15B) 10, 13, 15C) 9, 12, 15D) 9, 11, 15 you have $15.a. How much money do you have left if you ride each ride once?You have $ left.b. Do you have enough money to ride each ride twice? Explain.It costs $ to ride each ride once, and you have $ left.Question 2response - correct Kelli Blakely is a portfolio manager for the Miranda Fund, a core large-cap equity fund. The market proxy and benchmark for performance measurement purposes is the S&P 500. Although the Miranda portfolio generally mirrors the asset class and sector weightings of the S&P, Blakely is allowed a significant amount of leeway in managing the fund. However, her portfolio holds only stocks found in the S&P 500 and cash. Miguel is a golfer, and he plays on the same course each week. The following table shows the probability distribution for his score on one particular hole, known as the Water Hole. Score34567 Probability0.150.400.250.150.05 Let the random variable X represent Miguels score on the Water Hole. In golf, lower scores are better. (a) Suppose one of Miguels scores from the Water Hole is selected at random. What is the probability that Miguels score on the Water Hole is at most 5 ? Show your work. A loop of wire lies flat on the horizontal surface in an area with uniform magnetic field directed vertically up. The loop of wire suddenly contracts to half of its initial diameter. As viewed from above induced electric current in the loop is: Consider a sampling distribution with p equals 0.15p=0.15 and samples of size n each. Using the appropriate formulas, find the mean and the standard deviation of the sampling distribution of the sample proportion. a. For a random sample of size n equals 5000n=5000. b. For a random sample of size n equals 1000n=1000. c. For a random sample of size n equals 500n=500. Which of the following terms could not be part of a polynomial expression?(1) 7x(3) -3r?(2) 8(4) 6/x^3 PLZ ANSWER BEING TIMED!!!!!!!!!! WILL MARK BRAINLIEST GIVE THANKS AND MARK 5 STARS!!!!!!! To practice Problem-Solving Strategy 15.1 Mechanical Waves. Waves on a string are described by the following general equation y(x,t)=Acos(kxt). A transverse wave on a string is traveling in the +x direction with a wave speed of 8.25 m/s , an amplitude of 5.50102 m , and a wavelength of 0.540 m . At time t=0, the x=0 end of the string has its maximum upward displacement. Find the transverse displacement y of a particle at x = 1.51 m and t = 0.150 s . ok, I need help with this one!!!!!!!!!!!!!!!!!!!! plz and thank youWhich statement is a correctly written thermochemical equation?2C8H18+25O216CO2+18H2O , H=5,471kJ/mol4Fe(s)+3O2(g)2Fe2O3(s) , H=3,926kJNH4Cl NH4+ + ClC3H8(g)+O2(g)CO2(g)+H2O(l), H=2,220kJ/mol Which value represents the interquartile range (IQR)?A)50B)110C)160D)560 Using words and information around the unknown word to figure out the meaning and pronunciation of the unknown word is called expression. Please select the best answer from the choices provided T F using trig to find a side. help please !