please help me

500+150+20+6=​

Answers

Answer 1
676 is the answer to 500+150+20+6
Answer 2
The answer is six hundred seventy six. 676

Related Questions

What is a multi step problem?

Answers

Answer:

In multi-step problems, one or more problems have to be solved in order to get the information needed to solve the question being asked.

A problem with multiple steps

10x−8/3−4x=6x

whats the value of x?

(20 points!!!)

Answers

There is no solution of expression.

We have to given that,

An expression to solve,

⇒ 10x - 8/3 - 4x = 6x

Now, We can simplify as,

⇒ 10x - 8/3 - 4x = 6x

Combine like terms,

⇒ 6x - 8/3 = 6x

⇒ 6x - 6x = 8/3

⇒ 0 ≠ 8/3

Which is not possible.

Thus, There is no solution of expression.

Learn more about the mathematical expression visit:

brainly.com/question/1859113

#SPJ6

What is the area of the trapezoid?
13 m
16 m
19 m
232 m2
256 m2
328 m2
352 m2

Answers

Answer:

256m2.

Step-by-step explanation:

Answer:

256m^2

Step-by-step explanation:

Write an equation for the description.
Ten times the sum of half a number x and 5 is 8.

Answers

10(1/2X + 5) = 8

Happy to help! Please mark me as the brainliest!

Final answer:

The statement 'Ten times the sum of half a number x and 5 is 8' can be translated into a mathematical equation as: 10 * (0.5x+5) = 8.

Explanation:

To write the equation for the given description, we first need to translate the statement into mathematical terms.

The description is 'Ten times the sum of half a number x and 5 is 8'. In mathematics:

'The sum of' is represented by a plus '

So, translating the statement into an equation we get:

10 * (0.5x+5) = 8

Learn more about Mathematical Translation

https://brainly.com/question/1046778

#SPJ2


What is the solution to the following equation?

|3x - 6| = 10

Answers

Answer:

B

Step-by-step explanation:

1) Set up the following two equations, because of the absolute value:

3x-6=10

3x-6=-10

2) Solve both equations:

3x=16

3x=-4

3) Divide both sides by 3:

x=16/3

x=-4/3

4) Make fractions proper:

x=5 1/3

x=-1 1/3

I need help!!! Please help me

Answers

Answer:

5 ≥ 0

Step-by-step explanation:

9w - 4w +6 ≥ 1 + 5w.

Subtract 9w - 4w = 5w.

5w + 6 ≥ 1 + 5w.

Subtract 1 from each side.

5w + 6 - 1 ≥  1 - 1 + 5w

5w + 5 ≥ 5w

Subtract 5w from each side

5w - 5w + 5 ≥ 5w -5w

5 ≥ 0

Rate as brainliest plz

Sketch and prove the following for the two congruent triangles ∆ABC and ∆DEF.

The medians drawn from vertex A and D are congruent.

Label medians MA and ND ; then △ABM≅△

by reason

Answers

Answer:

See explanation

Step-by-step explanation:

Given: ΔABC ≅ ΔDEF

AM, DN - medians

Prove: AM ≅ DN

Proof:

1. Congruent triangles ABC and DEF have congruent corresponding parts:

AB ≅ DE;BC ≅ EF;∠ABC ≅ ∠DEF.

2. BM ≅ MC - definition of the median AM;

3. EN ≅ NF - definition of the median DN;

4. AB ≅ 2BM, EF ≅ 2EN

BM ≅ 1/2 AB,

EN ≅ 1/2 EF,

thus, BM ≅ EN

5. Consider two triangles ABM and DEN. In these triangles \:

AB ≅ DE (see 1));BM ≅ EN (see 4));∠ABM ≅ ∠DEN (see 1).

So, ΔABM ≅ ΔDEN by SAS postulate.

6. Congruent triangles ABM and DEN have congruent corresponding sides BM and DN.


Miguel says that to create rectangle F' he reflected rectangle F across the y-axis, dilated the reflection by a scale factor of 3, and translated the dilated figure to the right 2 units.

What mistake did Miguel make in describing the steps of his transformation?
A. He gave the incorrect scale factor.
B. He named the incorrect axis of reflection.
C. He gave the incorrect direction of translation.
D. He gave the incorrect number of units of translation.

Answers

Answer:

A. He gave the incorrect scale factor.

Step-by-step explanation:

The scale factor is the Multiplicative Inverse of 3, which is ⅓:

F → 12 × 6

F' 4 × 2

This is a genuine statement because according to the graph, each block is worth 2, and ⅓ of 6 is 2, and ⅓ of 12 is 4.

I am delighted to assist you anytime my friend.

Answer:

the answer is A

Step-by-step explanation:

Miguel gave an incorrect scale factor.  The shape decreased in size meaning it would have a scale factor under 1 but he put 3 meaning the shape got larger when really it shrunk.  This means A is the correct answer

Which of the following is a rational equation?

A. 4-2(x-1)=x+3

B. 1/2x-1/3=4-x

C. 0.7x-3=0.09(x-5)

D. 6/x - 1 = 4/(x-2)

Answers

Answer:

B and D

Step-by-step explanation:

Since they're the fractions

Option B and Option D represent rational equation.

A rational equation is defined as any equation that can write in p/q form where q not equal  to zero.

From given option it is observed that,

Option B,   [tex]\frac{1}{2}x-\frac{1}{3} =4-x [/tex]

option D,  [tex]\frac{6}{x}-1=\frac{4}{x-2} [/tex]

Both option have fraction term.

Hence, Option B and Represent rational equation.

Learn more:

https://brainly.com/question/12223525

-15= z/-2 answer please?​

Answers

Answer:

30

Step-by-step explanation:

[tex]-15=\frac{z}{-2}\\\\(-15)(-2)=z\\\\30=z[/tex]

-1/4 in decimal form

Answers

Answer:

-0.25

Step-by-step explanation:

During the first year it is in business, another candy company sells
100 times as many boxes as the Cricket Candy Company. How
many boxes are sold by both companies during that first year?

Answers

Can you please give me more information

if y varies direrectly as x and inversely as the square of z. y=52 when x=16 and z=2. find y when x=18 and z=3.

Answers

Answer:

y = 26

Step-by-step explanation:

Given y varies directly as x and inversely as the square of z then the equation relating them is

y = [tex]\frac{kx}{z^2}[/tex] ← k is the constant of variation

To find k use the condition y = 52, x = 16, z = 2

k = [tex]\frac{yz^2}{x}[/tex] = [tex]\frac{52(4)}{16}[/tex] = 13

y = [tex]\frac{13x}{z^2}[/tex] ← equation of variation

When x = 18 and z = 3, then

y = [tex]\frac{13(18)}{9}[/tex] = 26

How do you round 949999 to the nearest ten thousand

Answers

Answer:

950000

Step-by-step explanation:

the rule with rounding is if the number to the direct left is under 5, it stays the same but if it is 5 or above, you round up and everything behind becomes zeroes.

write down the coordinates of the point 5 units to the left of the y axis and 3 units above the x axis

Answers

5 units to the left would mean positive 5 and up 3 units is also positive so the coordinates would be (5,3)

The coordinates of the point is (-5,3)

How to determine the coordinates?

Let the initial coordinate be:

Initial = (0,0)

5 units to the left of the x-axis represents a horizontal translation left by 5 units.

So, we have:

New = (0 - 5,0)

3 units above the y-axis represents a vertical translation up by 3 units.

So, we have:

New = (0 - 5, 0 + 3)

Evaluate

New = (-5, 3)

Hence, the coordinates is (-5,3)

Read more about coordinates at:

https://brainly.com/question/17206319

#SPJ9

Kaleb had 136 songs on his mp3 player. if he deleted 56 songs, what is the ratio of songs he kept to songs he deleted

Answers

Kalevala now has 80 songs left. 136-56=80
So the ratio is 80:56
Or 80 to 56

Answer:

80/56 = 1.42

Step-by-step explanation:

Total songs = 136

Number deleted = 56

Number kept = 136-56 = 80

The ratio of songs kept to songs deleted = 80/56 = 1.42

The proportions or ratio are used to compare quantities with each other, and are usually written with a colon (:) intermediate.

the 9s in 9,905,482

Answers

Answer:

the 9s are in the millions and hundred thousands

Step-by-step explanation:

Round the following numbers to the nearest 10. 13-21-29

Answers

Answer:

13 --> 10

21 --> 20

29 --> 30

Answer:

The correct answer is: 10-20-30

Step-by-step explanation:

13 is between 10 and 20. The closest 10 for 13 is 10, because it's only 3 away (13  the other option would be 20 but it's 7 away, so way more.)

21 is between 20 and 30. The closest 10 for 21 is 20 ( it's only 1 away from 20, the other option would be 30 but it's 9 away, so way more.)

29 is between 20 and 30. The closest 10 for 29 is 30 (it's only 1 away from 30, the other option would be 20 but it's 9 away, so way more.)

Is the number 4.333..... rational or irrational?

Answers

Answer:

Irrational number

Final answer:

The number 4.333.... is a rational number because it can be expressed as the fraction 13/3. An irrational number, like Pi, cannot be expressed as a fraction of two integers.

Explanation:

The number 4.333..... is an example of a rational number. Rational numbers can be expressed as a fraction of two integers, and in this case, 4.333.... can be expressed as 13/3. In contrast, an irrational number cannot be expressed as a fraction of two integers. For example, the number Pi is an irrational number because it can not be accurately expressed as a fraction.

Learn more about Rational and Irrational Numbers here:

https://brainly.com/question/33462926

#SPJ2

The school is taking students on a field trip. Each bus holds 32 students. If 140 students have RSVP'd, what is the fewest number of buses that can be used?
a) 5
b) 6
c) 7

Answers

Answer:

5

Step-by-step explanation:

because in 5 buses there could fit 160 students which is more than have rsvpd

Answer:

(a)

Step-by-step explanation:

Basically we're trying to figure out how many groups of 32 students are needed to have more than 140.

To do this, we take 140/32 (*BIG NOTE!! No matter what our answer is, we round up. If we rounded down, we'd be leaving some students behind, and we don't want that.)

140/32 = 4.375 (but remember, we round up no matter what)

so the answer is 5, which is A.

Sophie and $18 for working 2 1/4 hours how much did she earn per hour

Answers

Answer:

8 dollars per hour

Step-by-step explanation:

2 1/4=2.25

18/2.25=8

(Sorry I read the question wrong at first above answer should be able to help you. I apologize)

Answer:

A car used 1/64 of a gallon of gas to drive 1/4 of a mile. at this rate, how many miles can the car travel using 1 gallon of gas?


HELP ! SHOW WORK AND I WILL MAKE YOU THE BRAINIEST ANSWER .

Answers

Answer: 4/64

Step-by-step explanation:

Since 1/4 * 4 = 1

We just have to multiply 1/64 times 4 to get the answer

1/64 * 4 = 4/64

Answer:

Car will cover 16 miles in 1 gallon of the gas.

Step-by-step explanation:

We can solve this question by unitary method.

∵ A car used [tex]\frac{1}{64}[/tex] gallons of gas to drive the distance = [tex]\frac{1}{4}[/tex] miles

∴ Car used 1 gallons to drive the distance = [tex]\frac{\frac{1}{4} }{\frac{1}{64} }[/tex]

= [tex]\frac{64}{1}\times \frac{1}{4}[/tex]

= [tex]\frac{64}{4}[/tex]

= 16 miles

Therefore, car will cover 16 miles in 1 gallon of the gas.

The equation y-5=6(x+1) is written in point-slope form. What is the equation written in slope-intercept form?
A)y = 6x + 11
B)y = 6x – 1
C)y = 6x – 4
D)y = 6x + 6

Answers

Answer:

a. y = 6x + 11

Step-by-step explanation:

distribute and rearrange into slope-intercept form.

y - 5 = 6x + 6

add 5 to both sides

y = 6x + 6 + 5 ⇒ y = 6x + 11

Answer: Hello mate!

our equation is y - 5 = 6(x + 1), and we want to rewrite it in the slope-intercept form.

First lets distribute the parenthesis.

y - 5 = 6(x+1) = 6x + 6

now let's add 5 in both sides.

y-5 + 5 = 6x + 6 + 5

y = 6x + 11

Then the correct answer is the option A.

Find X and Y for both.

Answers

Answer:

Second picture: y=4 and x=7

First picture: x=70 degrees y=20 degrees

Step-by-step explanation:

Second picture:

One of the given triangles is an equilateral and the other is an isosceles.

Equilateral triangle has all congruent sides and it's angles are all congruent.

Isosceles triangle has two congruent angles and the opposite sides of those congruent angles are also congruent.

This implies all the side algebraic expression-measurements given are all equal.

5y-4=y+12

Add 4 on both sides:

5y=y+16

Subtract y on both sides:

4y=16

Divide both sides by 4:

y=4

So what is the side measurement for each of the sides given in terms of algebraic expressions?

y+12

4+12

16

Each side given in terms of an algebraic explanation is 16 units.

So we have also the following equation to solve:

3x-5=16

Add 5 on both sides:

3x=21

Divide both sides by 3:

x=7

So x=7 and y=4.

There is only one side in the picture that is possibly not 16. It is the one of the sides in the isosceles, not opposite the base angles.

------------------------------------------

First picture:

We are given x+y=90.

Since that one triangle is an isosceles we know that x+x+(180-40)=180

So let's solve the second equation for x then go back and solve for y in the first equation.

2x+140=180

Subtract 140 on both sides:

2x=40

Divide both sides by 2:

x=20

First equation:

x+y=90

So y=90-x=90-20=70.

Need points sorry mate

the product of a number and 3 is 6 more than the number which equation models this sentence

Answers

Answer:

3x = 6 + x

Step-by-step explanation:

We can express the product of a number and 3 as:

3x

Where x is the number that we don't know.

Now it says that that product is 6 more than the number (x) so we can write it down:

3x (The product of a number and 3) = (is) 6 + x (6 more than the number)

3x = 6 + x

Final answer:

The sentence 'the product of a number and 3 is 6 more than the number' can be translated into the algebraic equation 3x = x + 6.

Explanation:

The given statement can be translated into a mathematical equation in the following way: If we let x be the number in question, the first part of the sentence tells us that the product of the number and 3 can be modeled as 3x. The second part of the sentence tells us that this is 6 more than the number itself. This can be translated into the equation as x + 6. Thus, putting the two parts together, we get the algebraic equation 3x = x + 6.

Learn more about Algebraic Equation here:

https://brainly.com/question/953809

#SPJ3

For 32 hours of work, you are paid $244.80. How much would you receive for 37 hours?
You would receive $
. (Round to the nearest cent as needed.)​

Answers

Answer:

$283.05

Step-by-step explanation:

first divide $244.80 by 32, to find out how much you are making hourly. in this case you are making $7.65 an hour

next, multiply $7.65 by 5, to add the 5 hours, in this case you get $38.25.

next, add $38.25 to $244.80 and you get your answer!

Final answer:

To find out how much you would receive for 37 hours of work, set up a proportion using the given information and solve for x. The result is approximately $283.98.

Explanation:

To find out how much you would receive for 37 hours of work, we can set up a proportion using the information given. Since 32 hours of work pays $244.80, we can set up the proportion: 32/244.80 = 37/x. Cross-multiplying, we get: 32x = 244.80 * 37. Simplifying, we find that x = (244.80 * 37) / 32. Calculating the result, we find that you would receive approximately $283.98 for 37 hours of work.

last week at the business where you work,you sold 120 items.the business paid $1 per item and sold them for $3 each.what profit did the business make from selling the 120 items?​

Answers

Answer:

The business would get 240$

Step-by-step explanation:

120$ is the amount you would of made for the the 120 items. The business gets 3$ per item. 120 x 3 would be 360, subtracted by 120 which is what they give you. The business would end up with 240$, or 2/3rds of the money.

Answer:

240

Step-by-step explanation:

since you get the items for 1 dollar and sell them for 2 you need to subtract   3-1 to get your profit which is 2. since you sold 120 items, multiply 120x2 to get your profit of 240.

Please need help urgent

Answers

Answers with explanations:

Problem 2-
First we have to insert our numbers into the equation. So we would have
l2l-l-7l
The ll bars mean to find the absolute value. Absolute value is how many spaces it is between that number and zero. So we can simply this to
2-7=-5

Problem 3-
First, we have to insert our numbers into the problem.
2(-2)^3(3)
Using PEMDAS or order of operations, we solve the exponent first and simplify from there
2(-8)(3)
(-16)(3)
(-48)
The answer is -48

Problem 4-
Again, we have to input the numbers into the equation.
(4^2-4(-3))/2
(16-4(-3))/2
(16+12)/2
(28)/2
14
The answer is 14

Problem 5-
(3)(-1)-(-1^2)
(3)(-1)-(1)
-3-1
-4
The answer is -4

Problem 7-
l-3-4l- -3^2
l-3-4l- +9
l-7| - +9
7-+9
-2
The answer is -2

Problem 8-
3(-3)^2-4|-3|+6
3(9)-4|-3|+6
27-4|-3|+6
27-12+6
21

8 5/8 + 8 7/8 ????????

Answers

Answer:

17 1/2

Step-by-step explanation:

8 5/8 + 8 7/8

=17 1/2

Answer:

17 1/2

Step-by-step explanation:

8 5/8+8 7/8=...

So, let's take away the fractions for now.

What's 8+8?

Well, 8+8=16.

Now, let's take a look at the fractions.

5/8+7/8=...

Well, when we are adding fractions, the denominator will stay the same. So let's pretend that we are adding 5+7.

5+7= 12. So our answer is 16 12/8 Right?

wrong.

you will simplify the 12/8. Since the numerator is more than eight, we will subtract 8 from 12.

12-8=4

we will make the 8/8 a 1 and add it to the 16 to make it 17 4/8. We can still simplify this. The 4/8 becomes 1/2 making the answer: 17 1/2

Hope this helps!!!

@ 4x +(2x - 1) = x +5+x-6​

Answers

Answer:

I believe the answer is 4 but im not sure because I skipped the @ but I didnt know what it meant

Step-by-step explanation:

4x +(2x - 1) = x +5+x-6

pretend that there is a 1 in front of the bracket

4x+1(2x-1)= x+5+x-6

Mutiply the bracket by 1

(1)(2x)= 2x

(1)(-1)= -1

4x+2x-1=x+x+5-6( combine like terms)

6x-1= 2x-1

move 2x to the other side

sign changes from +2x to -2x

6x-2x-1= 2x-2x-1

4x-1=-1

move -1 to the other side

4x-1+1= -1+1

4x= 0

divide by 4 for both sides to get x by itself

4x/4= 0/4

Cross out 4 and 4, divide by 4 and then becomes 1*1*x= x

x= 0/4

Answer: x= 0

Other Questions
The probability that a lab specimen contains high levels of contamination is 0.15. A group of 3 independent samples are checked. Round your answers to four decimal places (e.g. 98.7654). (a) What is the probability that none contain high levels of contamination? (b) What is the probability that exactly one contains high levels of contamination? (c) What is the probability that at least one contains high levels of contamination? Can i please have help i will rate 5 and thank. Song Title:Year Song Was Released:1.How many different instruments do you hear in this band or group? Identify and name the instruments you hearAnswer: 2.Is one instrument featured more prominently than the others? What is it about the sound of that instrument that makes a distinct impression on the listener? What is unique about this instrument? Answer:3.Choose an instrument that you normally dont pay much attention to (maybe the bass or the keyboard, for instance). Listen carefully to how it sounds in this song. Describe three interesting features that characterize this instrument and its sound. Why is this instrument crucial to the overall sound of this band? Explain your reasoning.Answer:4.Think about the singer and the instruments in the band. Are the instruments and the singer of equal importance? In your opinion, which is more important and why do you think so?Answer: which of the following is indicated by the arrow in the image Convert the condensed structures to line angle formulas: 1. CH3CH2CH(CH3)CH2CH3 8. CH:COCH 9. CH3CH2OCH3 2. CH3CH2CH(CH2CH3)CH(CH3)CH2CHO CH)CH:CH-CH: 10. CH CH2CH=C(CH:CH)(C(CH))CH 3. CH3CH2CH(CH3)CH(CH3)CH2CH3 11. CH:CH-CH(CH2CH)CH OH 4. CH3C(CH3)2CH2CH2CH(CH3)CH2CH3 12. CHCHOCH2CHO 5. CH(CH3)2CH(CI)CH2CH3 13. HOOCCH2NHCH(CH3)COCH; 6. CH3CH2CHOCH(CH2CH3)CH2CH3 14. HOOCCH OCH COOH 7. HOCH:C(CH3)2CONH2 name the property that is shown by the following expression (9x3)x4=9x(3x4) PLEASE HELPWhich of the following is TRUE about gothic master builders?A. They designed the structure of the church without supervising its constructionB. Their primary role was to construct the church the abbot designed.C. They worked closely with the abbot to design and build a church.D. They supervised construction without working with their own hands. Exotics Faucets and Sinks LTD., guarantees that its new infrared sensor faucet will save any household that has 2 or more children at least $30 per month in water costs beginning 1 month after the faucet is installed. If the faucet is under full warranty for 5 years, the minimum amount a family of four could afford to spend now on such a faucet at an interest rate of 1/2% per year, compounded monthly, is closest to(a) $149c) $1787(b) $1552d) $1890 Which terms are rational in the expansion of (\sqrt{3} + \frac{1}{\sqrt[4]{6}})^{15} . List the rational terms and justify why the others are not rational. Please help me answer these: (8.18*10^-6)(1.15*10^-5)and1.15*10^-7_______2.5*10^-3 It's scientific notation and please explain your answer What volume of phenytoin suspension 30 mg/5 mL is required to be added to a suitable diluent to obtain 150 mL phenytoin suspension 20 mg/5 mL? 100 Use Gaussian elimination on the augmented matrix, then use back substitution to find the solution of the system of linear equations.-2x + 3y - 4z = 75x - y + 2z = 133x + 2y - z = 17 Males of different species of the fruit fly Drosophila that live in the same parts of the Hawaiian Islands have different elaborate courtship rituals. These rituals involve fighting other males and making stylized movements that attract females. What type of reproductive isolation does this represent?a. habitat isolationb. temporal isolationc. behavioral isolationd. gametic isolation 53.010,000 in scientific nottation Even though the nation faces political instability, the island of Frollik with its wide, expansive beaches is a destination hub for cruise lines. Recently, a large theme park company showed strong interest in buying land in Frollik with the intent of building a park targeted toward families. The company wants to make a commitment to Frollik, including the hiring of several hundred local employees. Theyre using a global marketing strategy called ____________. According to Archimedes' principle, the mass of a floating object equals the mass of the fluid displaced by the object. A 150-lbm swimmer is floating in nearby pool; 95% of her body's volume is in the water while 5% of her body's volume is above water. Determine the density of the swimmer's body The density of water is 0.036 lbm/in5. Does your answer make sense?? Why why not? Discuss the meaning and significance of the fact that thegenetic code is degenerate. Which set of diagrams shows a balanced chemical equation?A : Diagram AB : Diagram BC : Diagram CD : Diagram D What did John withrop do in the Americas missing length??3 cm8 cmi need big help The chief explained what the situation was.Is this a simple or complex sentence ?