Plz help. A tram moved upward 3 meters per second for 24 seconds. What was the total change in the tram's elevation?

Answers

Answer 1

Answer:

Step-by-step explanation:

[tex]\frac{3 meters}{1 second} * 24 seconds[/tex]

[tex]72 meters[/tex]

Answer 2
Final answer:

The total change in the tram's elevation is found by multiplying the speed (3 meters per second) by the time (24 seconds) which gives us a result of 72 meters.

Explanation:

The total change in the tram's elevation can be found using the formula for distance travelled which is speed times time. We know that the speed of the tram is 3 meters per second, and it moved for 24 seconds. To find the total distance travelled or the total change in elevation, we simply multiply the speed by the time.

So, 3 meters per second multiplied by 24 seconds equals 72 meters. Therefore, the total change in the tram's elevation was 72 meters.

Learn more about Distance Calculation here:

https://brainly.com/question/34212393

#SPJ2


Related Questions

Please I really need help with this one

Answers

Answer:

C

Step-by-step explanation:

Given the complex number a ± bi, then the complex conjugate is

a ∓ bi

Note the real part remains unchanged while the sign of the imaginary part is reversed, thus

The conjugate of 7 - i  is 7 + i → C

Answer:

○ C 7 + i ohms

Step-by-step explanation:

Conjugates are expressions with OPPOSITE operation symbols, so the conjugate of 7 - i is 7 + i.

I am joyous to assist you anytime.

What is credit score meaning

Answers

Answer:

A credit score is a numerical expression based on a level analysis of a person's credit files, to represent the creditworthiness of an individual. A credit score is primarily based on a credit report, information typically sourced from credit bureaus.

Answer:

a number assigned to a person that indicates to lenders their capacity to repay a loan.

Step-by-step explanation:

What is the value of (x) = -3.25x + 22.41 at x = -4.2?

Answers

Don’t mind this comment just need points but good luck

Solve the equation for x in terms of c.

Answers

Answer:

x, 2/3(cx+1/2)- 1/4= 5/2 : x= 29/8c; c \neq 0

Step-by-step explanation:

D. The value of x in terms of c is  [tex]x=\frac{29}{8c}[/tex]

What is the value of x ?

The given equation is [tex]\frac{2}{3}(cx+ \frac{1}{2})-\frac{1}{4}=\frac{5}{2}[/tex]

Solving we get,

First we have to add 1/4 in both sides,

[tex]\frac{2}{3}(cx+ \frac{1}{2})-\frac{1}{4}+\frac{1}{4}=\frac{5}{2}+\frac{1}{4}[/tex]

⇒  [tex]\frac{2}{3}(cx+ \frac{1}{2})=\frac{5}{2}+\frac{1}{4}[/tex]

⇒ [tex]\frac{2}{3}(cx+ \frac{1}{2})=\frac{10+1}{4}[/tex]

⇒  [tex]\frac{2}{3}(cx+ \frac{1}{2})=\frac{11}{4}[/tex]

⇒  [tex](cx+ \frac{1}{2})=\frac{11}{4}*\frac{3}{2}[/tex]

⇒ [tex](cx+\frac{1}{2} )=\frac{33}{8}[/tex]

⇒ [tex]cx = \frac{33}{8} -\frac{1}{2}[/tex]

⇒ [tex]cx = \frac{33-4}{8}[/tex]

⇒ [tex]cx=\frac{29}{8}[/tex]

⇒ [tex]x=\frac{29}{8c}[/tex]

Learn more about equation here :

https://brainly.com/question/27893282

#SPJ2

What is the rate of change for the interval between A and B?

Answers

The slope of this graph is rise over run which means how much your distance x has between the 2 points and how much y increased between those 2 points. So it starts at (1,-2) and ends at (2,1). So x had a run of 1 and y had a rise of 3 we have 3/1 which is equivalent to 3, so the answer would be B.

Can you make a triangle with the following side lengths: 1 in, 2 in, 5 in ?

Answers

Answer:

No, because the two shorter sides added must be longer than the longest side.

Also 1 squared plus 2 squared is not equal to 5 squared.


6. A
5. Gabby measures out 55 pounds of
almonds at the grocery store bulk section. At
checkout the total cost is $20.90. What is the
price per pound?
fast

Answers

It would be $0.38. You would divide $20.90 by 55 to receive this answer.

Answer:

The price of the almonds is $0.38 per pound.

Step-by-step explanation:

Gabby measures out 55 pounds of almonds at the grocery store bulk section.

At checkout the total cost is $20.90.

So, the price per pound will be = [tex]\frac{20.90}{55}[/tex]

= $0.38 per pound.

Therefore, the price of the almonds is $0.38 per pound.

Sara bought 4 pounds
of coffee beans for
$3,20 per pound.
What was the total
cost, before tax?

Answers

Answer:

$12.80

Step-by-step explanation:

Sara bought 4 pounds of coffee.

Each pound (lb) costs $3.20

To find the total cost, multiply the cost per pound ($3.20) with the amount of pounds Sara is going to buy (4):

4 x 3.20 = $12.80

$12.80 would be the total cost before tax.

~

Answer:

12.8

Step-by-step explanation:

Its proportions: 1 pound equals 3.20, 4 poundes equals x.

3.20 (cost per pound) x 4 (how many pounds) = 12.8 (answer)

There are 7 red, 8 green, and 6 blue marbles
in bag. Kate is going to select one marble at
random. What is the probability that she will
select a green or blue marble?

Answers

(8+6)/(7+8+6)
=14/21
=0.67
=67%

Answer:

14/21

Step-by-step explanation:

Total marbles = 7+8+6 = 21

7 Red

8 Green

6 Blue

Probability of choosing Red = 7/21

Probability of choosing Green = 8/21

Probability of choosing Blue = 6/21

Probability of choosing Green or Blue = 8/21 + 6/21 = 14/21

Mark packed 1 inch cubes into a box with a volume of 120 cubic inches how many layers of 1 inch cubes did mark pack

Answers

Answer:

The number of layers of 1-inch cubes that Mark packed is determined by assuming that the larger box is also a cube. 

                        120 = e³

The value of e from the equation is approximately 5. Thus, there are approximately 5 layers of 1-inch cubes. 

Read more on Brainly.com - https://brainly.com/question/3427563#readmoreStep-by-step explanation:

How does the value of the digit 2 in the number 32,000 compare with the value of the digit 2 in the number 26,000?
*Explain ur answer*

Answers

Answer:

the second value is ten times higher then the refference one

The value of the digit 2 in the number 32,000 is greater than the value of the digit 2 in the number 26,000 by a factor of 10.

What is an expression?

An expression contains one or more terms with addition, subtraction, multiplication, and division.

We always combine the like terms in an expression when we simplify.

We also keep all the like terms on one side of the expression if we are dealing with two sides of an expression.

Example:

1 + 3x + 4y = 7 is an expression.

3 + 4 is an expression.

2 x 4 + 6 x 7 – 9 is an expression.

33 + 77 – 88 is an expression.

We have,

The value of a digit in a number depends on its place value.

In the number 32,000, the digit 2 is in the ten thousands place, which has a value of 20,000.

In the number 26,000, the digit 2 is in the thousands place, which has a value of 2,000.

Therefore,

The value of the digit 2 in the number 32,000 is 10 times greater than the value of the digit 2 in the number 26,000.

This is because the ten thousands place is 10 times greater than the thousands place.

In other words,

The digit 2 in the number 32,000 represents 20,000 while the digit 2 in the number 26,000 represents only 2,000.

Thus,

The value of the digit 2 in the number 32,000 is greater than the value of the digit 2 in the number 26,000 by a factor of 10.

Learn more about expressions here:

https://brainly.com/question/3118662

#SPJ3

5. If v=u+at, find:
a) u when a=2,t=3 and v= 10

b) t when a=4, u=5 and v=29

Answers

Answer:

Step-by-step explanation:

(a) Answer below

[tex]v = u + at[/tex]

[tex](10) = u + (2)(3)[/tex]

[tex]10 = u + 6[/tex]

[tex]u = 4[/tex]

(b) Answer below

[tex]v = u + at[/tex]

[tex](29) = (5) + (4)t[/tex]

[tex]29 = 5 + 4t[/tex]

[tex]24 = 4t[/tex]

[tex]t = 6[/tex]

[tex]\text{Hello there!}\\\\\text{Plug in and solve:}\\\\1. \\\\10=u+2(3)\\\\10=u+6\\\\\boxed{4=u}\\\\2.\\\\29=5+4(t)\\\\24=4(t)\\\\\text{Divide by 4}\\\\\boxed{6=t}[/tex]

Find a solution to the linear equation y=−4x+36 by filling in the boxes with a valid value of x and y.

Answers

Answer:

A solution would be:

[tex](1,32)[/tex]

Step-by-step explanation:

This is a linear equation written in Slope-Intercept form. Recall that this form, in general, is written as follows:

[tex]y=mx+b \\ \\ \\ Where: \\ \\ m:slope \\ \\ b:y-intercept[/tex]

In this case, we have the following equation:

[tex]y=-4x+36 \\ \\ \\ Where: \\ \\ m=-4 \\ \\ b=36[/tex]

In order to find a solution, let's set [tex]x=1[/tex], so the y-value will be:

[tex]y=-4(1)+36 \\ \\ y=-4+36 \\ \\ y=32[/tex]

So, a  solution to the linear equation is the point [tex](1,32)[/tex]

Final answer:

The solutions to y = -4x + 36 are x = 3 resulting in y = 24, and x = -7 resulting in y = 64, both of which have been verified to be correct by substitution back into the original equation.

Explanation:

To find a solution to the linear equation y = -4x + 36, we can substitute any value for x and solve for y, or vice versa. Let's use the given solutions x = 3 and x = -7 to find the corresponding values for y.

Substitute x = 3 into the equation: y = -4(3) + 36, which simplifies to y = -12 + 36, resulting in y = 24.

Substitute x = -7 into the equation: y = -4(-7) + 36, which simplifies to y = 28 + 36, resulting in y = 64.

To check the validity of these solutions, we back-substitute them into the original equation. For x = 3, the equation becomes 24 = -4(3) + 36, which simplifies to 24 = 24, confirming the first solution. Similarly, for x = -7, the equation becomes 64 = -4(-7) + 36, simplifying to 64 = 64, confirming the second solution. Both substitutions lead to an identity, verifying the correctness of the solutions.

emily and how are selling wrapping paper for a school fundraiser. customers can buy rolls of plain wrapping paper and rolls of holiday wrapping paper. emily sold 14 rolls of plain wrapping paper and 6 rolls of holiday wrapping paper for a total of $248. joe sold 10 rolls of plain wrapping paper and 12 rolls of holiday wrapping paper for a total of $316. find the cost each of one roll of plain wrapping paper and one roll of holiday wrapping paper.

Answers

1 plain=$10
1 holiday=$18

i just played around w my numbers until i found it, but you should probably do (14•10)+(18•6)=140+108=248
and
(10•10)+(18•12)=100+216=316

The cost of one roll of plain wrapping paper is found to be $10, and one roll of holiday wrapping paper is $18.

We have two equations based on the given information:

Emily's sales: 14 rolls of plain wrapping paper + 6 rolls of holiday wrapping paper = $248

Joe's sales: 10 rolls of plain wrapping paper + 12 rolls of holiday wrapping paper = $316

Using algebra to solve the system, we represent the cost of one roll of plain wrapping paper as p, and the cost of one roll of holiday wrapping paper as h. Thus, the equations become:

14p + 6h = 248

10p + 12h = 316

We use the method of substitution or elimination to find the value of p and h. For instance, using elimination, we can multiply the first equation by 2 to make the coefficients of h the same:

(14p + 6h) * 2 = 248 * 2

28p + 12h = 496

Then we subtract the second equation from this new equation:

(28p + 12h) - (10p + 12h) = 496 - 316

18p = 180

p = $10

With the cost of plain wrapping paper found, substitute p = $10 into one of the original equations to find h:

10 * 10 + 12h = 316

12h = 216

h = $18

The cost of one roll of plain wrapping paper is $10, and the cost of one roll of holiday wrapping paper is $18.

1.) Lawrence spent $1.89
on a bottle of paint and
Assessment
$0.45'on a brush.
Practice
A. What was the total amount he spent?

Answers

Answer:

the total amount spent was$2.34 cents

Answer:

He spent $ 2.34 in all.

Step-by-step explanation:

Given,

The amount spent on the bottle of paint = $ 1.89,

While, the amount spent on the brush = $ 0.45,

Hence, the total amount spent = amount spent on paint + amount spent on brush

[tex]= 1.89 + 0.45[/tex]

[tex]= \$ 2.34[/tex]

i.e. Lawrence spent total $ 2.34 in both.

There are exclusions that make the expression
x^3 - 1 / x^3 + x^2 + x undefined.
True
False

Answers

Truer hi s hm Ken mallow’s

Answer:

True.

Step-by-step explanation:

The given expression is

[tex]\frac{x^{3}-1}{x^{3}+x^{2}+x}[/tex]

This expression is rational, which means the denominator must be different to zero, otherwise, the function will be undefined. So, let's find if there are values that make the denominator zero.

[tex]\frac{x^{3}-1}{x^{3}+x^{2}+x}=\frac{x^{3}-1}{x(x^{2}+x+1)}[/tex]

So, if we evaluate the expression with [tex]x=0[/tex], we would have

[tex]\frac{x^{3}-1}{x(x^{2}+x+1)}=\frac{0^{3}-1}{0(0^{2}+0+1)}=\frac{-1}{0}[/tex]

As you can observe, there must be one exclusion, because it makes the expression undefined.

Therefore, the answer is true.

You and your family are planning the vacation of a lifetime around the world that would cost 25,000.You borrowed this amount from your bank with an annal interest rate of 10.5%.You decide to pay it back in 5 years.What is the interest that will accrue on this loan

Answers

Answer:

238.095238 is correct

Answer:$13,125

Step-by-step explanation:

-2x + 5 = -12x -15 solve and check

Answers

Answer:

10/7

Step-by-step explanation:

Step 1: Subtract 12x from both sides.

−2x+5−12x=12x−15−12x

−14x+5=−15

Step 2: Subtract 5 from both sides.

−14x+5−5=−15−5

−14x=−20

Step 3: Divide both sides by -14.

−14x/14=−20/14

x=10/7

You get 10 over 7 because you simplify 20 over 14 by dividing them by 2 which would give you 10/7.

Two similar triangles are shown.
AMNO was dilated, then
to create AYHO.
rotated
reflected
translated
dilated​

Answers

Triangle MNO was dilated (increased) and then rotated to create triangle YHO.

Transformation

Transformation is the movement of a point from its initial location to a new location. Types of transformation are rotation, translation, reflection and dilation.

Dilation is the increase or decrease in the size of a figure to create an image.

Triangle MNO was dilated (increased) and then rotated to create triangle YHO.

Find out more on transformation at: https://brainly.com/question/1548871

What is the cofunction of cos 2pi/ 9

Answers

The cofunction of cos is sin(90-x)

90 degrees is equal to PI/2

The cofunction becomes sin(PI/2 - 2PI/9)

Rewrite both fractions to have a common denominator:

PI/2 = 9PI/18

2PI/9 = 4PI/18

Now you have sin(9PI/18 - 4PI/18)

Simplify:

Sin(5PI/18)

Final answer:

The cofunction of cos 2pi/9 is sin(pi/2 - 2pi/9), which is a basic concept in trigonometry.

Explanation:

The student is asking about the cofunction of

cos 2pi/9

. In trigonometry, the cofunction of a function is basically the complementary function of 90 degrees minus the original function. In this case, the cofunction of cos is sin, so to find the cofunction of cos 2pi/9, you need to find sin(90 - 2pi/9). However, since we are dealing with radians here, rather than degrees, we will be using pi/2 instead of 90 degrees. Therefore, the cofunction of cos 2pi/9 is

sin(pi/2 - 2pi/9)

.

Learn more about Co-function here:

https://brainly.com/question/35503118

#SPJ3

Can someone tell me how to do number 15 please!!!

Answers

Answer:

x = 90

c = 11

d = 11

Step-by-step explanation:

For this, we just need to use algebra to solve for x.

(x / 3) - 4 = 26 | First we add 4 to both sides

x / 3 = 30 | Then we multiply both sides by 3

x = 90.

For the others, it's the same.

-8 + 10c = 102 | Subtract -8 from both sides, or add 8

10c = 110 | Divide both sides by 10

c = 11

2.5d + 7.5 = 20 | Subtract 7.5 from both sides

2.5d = 27.5 | Divide both sides by 2.5

d = 11

A rectangle has a length of 30 cm and
height of 53 mm. What is the perimeter
of this rectangle in centimeters?​

Answers

Final answer:

The perimeter of the rectangle is calculated using the formula P = 2l + 2w, converting the height from millimeters to centimeters and then applying the values to get a perimeter of 70.6 cm.

Explanation:

To calculate the perimeter of a rectangle, we use the formula P = 2l + 2w, where l is the length and w is the width of the rectangle. In this case, the rectangle's length is given as 30 cm, but the height (which can be considered as the width in the context of the perimeter) is given in millimeters. First, we need to convert the height to centimeters by dividing the number of millimeters by 10, because there are 10 millimeters in a centimeter. So, 53 mm is equivalent to 5.3 cm. Now, we apply the formula to find the perimeter:

P = 2 × 30 cm + 2 × 5.3 cm = 60 cm + 10.6 cm = 70.6 cm.

Therefore, the perimeter of the rectangle is 70.6 cm.

Hattie had $3,000 to invest and wants to earn 10.6% interest per year. She will put some of the money into an account that earns 12% per year and the rest into an account that earns 10% per year. How much money should she put into each account?

Answers

Final answer:

To achieve an overall interest of 10.6% on her $3,000 investment, Hattie should put $900 into an account with a 12% interest rate and $2,100 into an account with a 10% interest rate.

Explanation:

Let's denote the amount of money Hattie puts in the 12% interest account as x, and the amount she puts in the 10% interest account as 3000 - x. Her aim is that the total interest she earns from both accounts is 10.6% of her total investment ($3,000).

So, 0.12x (interest from the first account) + 0.10(3000-x) (interest from the second account) should equal 0.106*3000 (her total desired income).

By solving this equation we can determine the amount of money Hattie should place in each account:

0.12x + 0.10*3000 - 0.10x = 3180.02x = 318 - 3000.02x = 18x = 900

So, Hattie should put $900 in the 12% account and the rest, which is $2,100, in the 10% account to get her goal of 10.6% total interest.

Learn more about Interest Calculation here:

https://brainly.com/question/29011216

#SPJ2

Final answer:

To solve this problem, set up a system of equations using the amount of money Hattie puts into each account and the total interest earned. Solve the system to find the values of x and y.

Explanation:

To solve this problem, we can set up a system of equations. Let's call the amount of money Hattie puts into the account that earns 12% per year x, and the amount of money she puts into the account that earns 10% per year y. We know that x + y = $3,000 (since she has $3,000 to invest). We also know that the total interest earned is equal to 10.6% of $3,000, which is 0.106 * $3,000 = $318.

The interest earned from the account that earns 12% per year is 0.12x, and the interest earned from the account that earns 10% per year is 0.1y. We can set up another equation based on this: 0.12x + 0.1y = $318.

Now we have a system of equations: x + y = $3,000 and 0.12x + 0.1y = $318. We can solve this system using substitution or elimination to find the values of x and y.

Learn more about Solving systems of equations here:

https://brainly.com/question/29050831

#SPJ12

the mass of a textbook is approximately 0.00165 metric ton . how is this number written in scientific notation

Answers

Answer:

1.65 X 10^-3 (i don't know if your teacher wants you to also add the unit at the end, but if your teacher does, then just add metric ton at the end. :-) )

Step-by-step explanation:

We want to bring the decimal point to the right of the first number, so you move the decimal point 3 times to the right, which would give you 1.65 metric ton.

So you should know that moving a decimal point to the right would make the power negative, and moving the decimal point to the left would make the power positive.

In this situation, the power would be negative, and a negative three, because you moved the decimal point 3 times to the right.

Hope this helped :-) <3

Use the number line to determine the absolute value. Enter the value, as a mixed number in simplest form, in the box. ∣∣−223∣∣ =

Answers

Answer:

[tex]2\frac{2}{3}[/tex]

Step-by-step explanation:

we know that

Absolute value is a term which is used to indicate the distance of a point or number from the origin of a number line or coordinate system.

In this problem

we have to find the absolute value of the given number

[tex]\left \| -2\frac{2}{3} \right \|[/tex]

that means we have to find the distance of [tex]\left \| -2\frac{2}{3} \right \|[/tex]  from the origin of a number line.

Distance of [tex]-2\frac{2}{3}[/tex] from the origin is [tex]2\frac{2}{3}[/tex] .

Remember that the distance cannot be a negative number.

Therefore, the absolute value of [tex]\left \| -2\frac{2}{3} \right \|[/tex] is [tex]2\frac{2}{3}[/tex]

see the attached figure to better understand the problem

Answer:

2_2/3  

Step-by-step explanation:

Change the fraction to a decimal with division 1/10

Answers

Answer: 0.1

Step-by-step explanation: you only need to add zero to the first value,

for example if you have 1/10, you add zero, getting the next equation

10/10 if you add a zero to value you can add a zero to the result getting the following result

10/10=0. in this point both values are divisible

and 10 between 10 is equal to 1

as you finish add zeros you can add a point and after the 1 getting this result

1/10 = 0.1

 

0.1 will be the answer to your question

|x−5|=2x |x−5|=2x .

Answers

Answer:

x=-5,x=5/3 Brainliest please? Thank you! <3

Step-by-step explanation:

x-5=2x ~ x-5=-2x

-5=x ~ x=5/3

Possible answer 1: x - 5 =2x

Subtract 2x from both sides
x−5 -2x =2x−2x
-x -5= 0
Add 5 to both sides.
-x -5 +5 = 0 +5
-x= 5
Divide both sides by -1.
-x/-1= 5/-1
X= -5
Possible answer 2: x -5 = -2x
Add 2x to both sides.
X -5 +2x = -2x +2x
3x -5 = 0
Add 5 to both sides.
3x -5 +5= 0+5
3x= 5
Divide both sides by 3.
3x/3= 5/3
X=5/3

These two are the possible answers but check if they work: x= -5, x= 5/3.
Plug them in the equation.
|x-5| =2x
Possible Answer 1: |-5-5| =2x
|-10|=2x
10=2x
Divide both sides by 2.
10/2=2x/2
5=x
This means the answer x=-5 doesn’t work since the result ended up being a positive 5. Thus, this is not a solution.

Possible answer 2: |5/3-5| =2x
5/3 subtracted by 5 is -10/3.
|-10/3| = 2x
10/3 =2x
Divide both sides by 2.
(10/3)/2= 2x/2
5/3 = x
This means the solution x=5/3 works. Thus, a solution.

The first one doesn’t work but the second one does. So that means possible answer 2 is the answer.

Answer: x= 5/3
I hope this is helpful.

-1/7(14+28p)-13=4(1/2p-3)-6p

Answers

Answer:

No Solution

Step-by-step explanation:

-1/7(14+28p)-13=4(1/2p-3)-6p

-2-4p-13=2p-12-6p

rearrange the question so like terms are next to each other

-2-13-4p=2p-6p-12

-15-4p=-4p-12

add 12 to both sides

-3-4p=-4p

add 4p to both sides

-3=0

No solution

Answer:

something is wrong in the equation

Step-by-step explanation:

45 less than twice the number of n

Answers

Answer:

45 less than twice a number is 5 times that number

Step-by-step explanation:

n = 15

What are arithmetic operations?

Use one of the four fundamental arithmetic operations to add, subtract, multiply, or divide two or more integers. For challenging computations, we use the PEMDAS approach.

Given five times n is equals to 45 less than twice the number of n.

hence,

5 * n = 2* n + 45

3* n = 45

n = 15

Therefore the value of the n in the given problem is 15.

Learn more about Arithmetic operations here:

brainly.com/question/12278115

#SPJ2

-3^2 - 1^2 -(-2)^3+(-1)^2-(-1-5)^3

Answers

Answer: 215

Step-by-step explanation:

Other Questions
The probability that a lab specimen contains high levels of contamination is 0.15. A group of 3 independent samples are checked. Round your answers to four decimal places (e.g. 98.7654). (a) What is the probability that none contain high levels of contamination? (b) What is the probability that exactly one contains high levels of contamination? (c) What is the probability that at least one contains high levels of contamination? Can i please have help i will rate 5 and thank. Song Title:Year Song Was Released:1.How many different instruments do you hear in this band or group? Identify and name the instruments you hearAnswer: 2.Is one instrument featured more prominently than the others? What is it about the sound of that instrument that makes a distinct impression on the listener? What is unique about this instrument? Answer:3.Choose an instrument that you normally dont pay much attention to (maybe the bass or the keyboard, for instance). Listen carefully to how it sounds in this song. Describe three interesting features that characterize this instrument and its sound. Why is this instrument crucial to the overall sound of this band? Explain your reasoning.Answer:4.Think about the singer and the instruments in the band. Are the instruments and the singer of equal importance? In your opinion, which is more important and why do you think so?Answer: which of the following is indicated by the arrow in the image Convert the condensed structures to line angle formulas: 1. CH3CH2CH(CH3)CH2CH3 8. CH:COCH 9. CH3CH2OCH3 2. CH3CH2CH(CH2CH3)CH(CH3)CH2CHO CH)CH:CH-CH: 10. CH CH2CH=C(CH:CH)(C(CH))CH 3. CH3CH2CH(CH3)CH(CH3)CH2CH3 11. CH:CH-CH(CH2CH)CH OH 4. CH3C(CH3)2CH2CH2CH(CH3)CH2CH3 12. CHCHOCH2CHO 5. CH(CH3)2CH(CI)CH2CH3 13. HOOCCH2NHCH(CH3)COCH; 6. CH3CH2CHOCH(CH2CH3)CH2CH3 14. HOOCCH OCH COOH 7. HOCH:C(CH3)2CONH2 name the property that is shown by the following expression (9x3)x4=9x(3x4) PLEASE HELPWhich of the following is TRUE about gothic master builders?A. They designed the structure of the church without supervising its constructionB. Their primary role was to construct the church the abbot designed.C. They worked closely with the abbot to design and build a church.D. They supervised construction without working with their own hands. Exotics Faucets and Sinks LTD., guarantees that its new infrared sensor faucet will save any household that has 2 or more children at least $30 per month in water costs beginning 1 month after the faucet is installed. If the faucet is under full warranty for 5 years, the minimum amount a family of four could afford to spend now on such a faucet at an interest rate of 1/2% per year, compounded monthly, is closest to(a) $149c) $1787(b) $1552d) $1890 Which terms are rational in the expansion of (\sqrt{3} + \frac{1}{\sqrt[4]{6}})^{15} . List the rational terms and justify why the others are not rational. Please help me answer these: (8.18*10^-6)(1.15*10^-5)and1.15*10^-7_______2.5*10^-3 It's scientific notation and please explain your answer What volume of phenytoin suspension 30 mg/5 mL is required to be added to a suitable diluent to obtain 150 mL phenytoin suspension 20 mg/5 mL? 100 Use Gaussian elimination on the augmented matrix, then use back substitution to find the solution of the system of linear equations.-2x + 3y - 4z = 75x - y + 2z = 133x + 2y - z = 17 Males of different species of the fruit fly Drosophila that live in the same parts of the Hawaiian Islands have different elaborate courtship rituals. These rituals involve fighting other males and making stylized movements that attract females. What type of reproductive isolation does this represent?a. habitat isolationb. temporal isolationc. behavioral isolationd. gametic isolation 53.010,000 in scientific nottation Even though the nation faces political instability, the island of Frollik with its wide, expansive beaches is a destination hub for cruise lines. Recently, a large theme park company showed strong interest in buying land in Frollik with the intent of building a park targeted toward families. The company wants to make a commitment to Frollik, including the hiring of several hundred local employees. Theyre using a global marketing strategy called ____________. According to Archimedes' principle, the mass of a floating object equals the mass of the fluid displaced by the object. A 150-lbm swimmer is floating in nearby pool; 95% of her body's volume is in the water while 5% of her body's volume is above water. Determine the density of the swimmer's body The density of water is 0.036 lbm/in5. Does your answer make sense?? Why why not? Discuss the meaning and significance of the fact that thegenetic code is degenerate. Which set of diagrams shows a balanced chemical equation?A : Diagram AB : Diagram BC : Diagram CD : Diagram D What did John withrop do in the Americas missing length??3 cm8 cmi need big help The chief explained what the situation was.Is this a simple or complex sentence ?