Sketch a rectangle and label its dimensions that meets the following conditions perimeter 18 area 20

Answers

Answer 1

Answer:

4 units by 5 units

Step-by-step explanation:

To solve this problem, then we must develop two equations; one for the perimeter and another for the area of the rectangle.

The perimeter of a rectangle = 2(L +B)

The area of a rectangle = L x B

Let the length be represented by L while the breadth is denoted by B. Then, our equations are

         2L + 2B =18  ---  eq 1

and  

          LB = 20  ----- eq 2

From eq 2, then  L = 20/B

We shall substitute this in equation 1 such that

2(20/B) + 2B =18

= 40/B + 2B = 18

= 40/B + 2B/1 = (40 + 2B^2) /B =18

We do cross multiplication by multiplying both sides of the equation by B.

We get

 40 + 2B^2 = 18B

We then rearrange the equation as   2B^2- 18B + 40 = 0

Dividing both sides by 2, we get B^2- 9B =20 =0

We shall get the roots of the equation to be -4 and -5. Why?  

-4B-5B =-9  and -4x-5 =20

Thus, B^2- 9B =20 =0 can be reworked as  

(B-4) (B-5)= 0   From B-4=0, B= 4

                   From LB =20, If B =4, then L =20/4 = 5

                           From B-5=0; B=5

                  From LB =20, If B=5, L = 20/5 = 4

Thus, the dimensions of the rectangle are 5 units and 4 units.


Related Questions

Divide. Do not round your answer.
52.72 - 8

Answers

Answer:

6.59

Step-by-step explanation:

52.72 ÷ 8 = 6.59

So the answer is 6.59

The answer would be 6.59 without rounding your answer

Find the distance between P(2, 8) and Q(5, 3).

Answers

Answer:

The distance (d) between two points (x1,y1) and (x2,y2) is given by the formula

d = √  ((X2-X1)2+(Y2-Y1)2)

d = √ (5-2)2+(3-8)2

d = √ ((3)2+(-5)2)

d = √ (9+25)

d = √ 34

The distance between the points is 5.8309518948453

The midpoint of two points is given by the formula

Midpoint= ((X1+X2)/2,(Y1+Y2)/2)

Find the x value of the midpoint

Xm=(X1+X2)/2

Xm=(2+5)/2=3.5

Find the Y value of the midpoint

Ym=(Y1+Y2)/2

Ym=(8+3)/2=5.5

The midpoint is: (3.5,5.5)

Graphing the two points, midpoint and distance

P1 (2,8)

P2 (5,3)

Midpoint (3.5,5.5)

The length of the black line is the distance between the points (5.8309518948453)

Find the slope of the line connecting the two points

Slope =  (Y2-Y1)  =  (3-8)  =  (-5)  = -1.66666666666667

(X2-X1) (5-2) (3)

Find the equation of the line passing through the two points

The general equation for a straight line is

y = mx + b

Where m represents the slope of the line which we found in the previous step to be -1.66666666666667

y = -1.67x + b

We substitute x and y for the values from one of our points (2,8)

8 = -1.67×2 + b

8 = -3.33 + b

8--3.33 = b

11.33 = b

Knowing both b and m, we can contruct the equation of the line

y= -1.67x+ 11.33

X and Y intercepts

The x-intercept is a point on the graph where y is zero

Using the equation we found in the previous step and substituting zero for y

y= -1.67x+ 11.33

0= -1.67x+ 11.33

1.67x= 11.33

x= 11.33/1.67 = 6.80

The x intercept for this straight line is 6.80

The y-intercept is a point on the graph where x is zero

Using the equation we found in the previous step and substituting zero for x

y= -1.67×0+ 11.33

y= 11.33

The y intercept for this straight line is 6.80

References

refernce image showing the distance between two points on the xy plane

Step-by-step explanation:

The distance between the two points will be √34. The correct option is c

What is coordinate geometry?

A coordinate plane is a 2D plane that is formed by the intersection of two perpendicular lines known as the x-axis and y-axis. A coordinate system in geometry is a method for determining the positions of the points by using one or more numbers or coordinates.

The distance (d) between two points (x₁,y₁) and (x₂,y₂) is given by the formula:-

d = √  ((X₂-X₁)²+(Y₂-Y₁)²)

d = √ (5-2)²+(3-8)²

d = √ ((3)²+(-5)²)

d = √ (9+25)

d = √ 34

Therefore, the distance between the two points will be √34. The correct option is c

To know more about Coordinate geometry follow

brainly.com/question/18269861

#SPJ6

51pts! which expression represents a difference of squares?
A. 81-49y^2
B. 25k-64
C. t^2+100
D. 4x^2-16x

Answers

Answer:

A.

Step-by-step explanation:

81 - 49y^2 = (9 - 7y)(9 + 7y)

FOIL the equation.

(9 - 7y)(9 + 7y)

81 + 63y - 63y - 49y^2

81 - 49y^2

The correct answer is option A. 81 - 49y².

What are different squares?

It exists easily identified by looking at the numbers, the number shows a perfect square, and the variable y exists also squared

That is 9² = 81 and 7² = 49

Also, the sign in-between them must be a negative sign, when the expression consists of the above, then it provides a different square.

81 - 49y²

9² - 7²y²

(9 - 7y)(9 +7y)

Opening back the parenthesis to verify our answer

(9 - 7y)(9 +7y)

9(9+7y) -7y(9+7y)

81 +63y -63y -49y²

81 - 49y²

Therefore, the correct answer is option A. 81 - 49y².

To learn more about the different squares

https://brainly.com/question/15975147

#SPJ2

Given that P = (5, 8) and Q = (6, 9), find the component form and magnitude of vector PQ.

<-1, -1>, square root of two
<1, 1>, square root of two
<1, 1>, 2
<-1, -1>, 2

Answers

Answer:

<1 ,1>..., square root of two

Step-by-step explanation:

Component of vector PQ...,

; Q - P...where you subtract the x coordinate of Q by the x coordinate of P and the same for the y coordinate

; <(6-5),(9-8)>

; < 1,1 >

And the magnitude of PQ...,

;square root of( 1^2 + 1^2 )

;square root of 2

Final answer:

The component form of vector PQ is <1, 1>, and the magnitude is the square root of 2, thus the correct answer is <1, 1>, square root of 2.

Explanation:

To find the component form and magnitude of vector PQ, we calculate the difference in the x-coordinates and the y-coordinates of points P and Q. The component form of a vector is obtained by subtracting the coordinates of the initial point from the coordinates of the terminal point. In this case, the initial point is P(5, 8) and the terminal point is Q(6, 9).

The component form of vector PQ is therefore:

Vector PQ = (Qx - Px, Qy - Py)

Vector PQ = (6 - 5, 9 - 8)

Vector PQ = <1, 1>

Next, to find the magnitude of vector PQ, we use the Pythagorean theorem, which is the square root of the sum of the squares of the components:

Magnitude of PQ = √(1^2 + 1^2)

Magnitude of PQ = √(2)

Magnitude of PQ = √2

Therefore, the correct answer is <1, 1>, √2.


[tex] \sqrt[3]{216} [/tex]

Answers

reduce the index of the radical and exponent with 3, rhen you get your answer, 6

Seth went to sticker station.he bought 1 sheet of 100 ,4 strips of 10 , and 6 single soccer stickers, and he bought 8 strips of 10 and 3 single animal stickers. How many stickers did Seth buy?

Answers

Answer:

229

Step-by-step explanation:

100+40+6+80+3

ok why is your math so easy

The height of a cone is twice the radius of its base. What expression represents the volume of the cone, in cubic units?

A)2/3πx^3
B) 4/3πx^2
C) 2πx^3
D) 4πx^3

Answers

Answer:

A

Step-by-step explanation:

The general formula for the volume of a right cone is as follows (also see attached):

V = (1/3) π r² h; where r = radius of base and h = height

In this case, it is given that r = x

also given :

height = 2 (base radius)

or

h = 2x.

Hence the formula becomes:

V = (1/3) π r² h

V = (1/3) π x² (2x)

V = (2/3) π x³  (answer A)

Yep I agree I think the answer is A

Patty needs a total of $80 to buy a bicycle. She has already saved $35. If she saves $10 a week from her earnings, what is the least number of weeks she must work to have enough money to buy the bicycle?
F.3
G.4
H.5
J.8

Answers

Answer:

h

Step-by-step explanation:

80-35=45

4days x10=40

leaving 5 dollars left so u need another week to save 5 dollars more

in total of 5 weeks

The answer is She has to work at least for 4.5 to be able to buy the bicycle i.e x≥4.5

What is the unitary method?

The unitary method is a method in which you find the value of a unit and then the value of a required number of units.

Given here: price of the bicycle is $80 and she has $35 in hand

If she earns $10 in a week then let x weeks be the minimum number of weeks she has to work then we have

x= 45/10

  =4.5 weeks

Hence, She has to work at least for 4.5 to be able to buy the bicycle

Learn more about the unitary method here:

https://brainly.com/question/22056199

#SPJ5

257
What names apply to this number

Answers

Answer:

Step-by-step explanation:

Whole, integer, rational, real

Suppose karl uses 5 cups of tomatoes how many salqds can he make? Write a division equation and multiplication equation

Answers

Final answer:

Assuming one salad requires 1 cup of tomatoes, Karl can make 5 salads as shown by the division equation 5 cups / 1 salad = 5 salads. The multiplication equation 5 salads x 1 cup = 5 cups demonstrates the amount of tomatoes needed for 5 salads.

Explanation:

To properly answer this question, we first need to know the number of cups of tomatoes required to make one salad. However, if we suppose that one salad requires 1 cup of tomatoes, then the division equation is 5 cups / 1 salad = 5 salads. This equation illustrates that Karl can make 5 salads with the amount of tomatoes he has.

On the other hand, the multiplication equation would be 5 salads x 1 cup = 5 cups. This equation pertains to how many cups of tomatoes are needed to make 5 salads. Please note that these equations assume that 1 cup of tomatoes is needed for a single salad, but the proportions may vary depending on the actual recipe.

Learn more about Division and Multiplication Equations here:

https://brainly.com/question/32871453

#SPJ12

Karl can make 5 salads using 5 cups of tomatoes.

Assuming Karl makes salads that require 1 cup of tomatoes each, we can determine the number of salads he can make using division:

Number of salads = Total tomatoes (cups) / Tomatoes per salad (cups)

Number of salads = 5 cups / 1 cup/salad

Therefore, Karl can make 5 salads using 5 cups of tomatoes.

A multiplication equation can be used to express the relationship between the number of salads, the number of tomatoes per salad, and the total number of tomatoes:

Total tomatoes (cups) = Number of salads × Tomatoes per salad (cups)

5 cups = 5 salads × 1 cup/salad

Both equations demonstrate the same relationship between the number of salads, the number of tomatoes per salad, and the total number of tomatoes.

look at the attached file.

please show your work on how you got the answer

Answers

Answer:

D

Step-by-step explanation:

[tex]\frac{f(x)}{g(x)}[/tex]

= [tex]\frac{2x+4}{2x^2+4x}[/tex]

Factor out 2 on the numerator and 2x on the denominator.

= [tex]\frac{2(x+2)}{2x(x+2)}[/tex]

Cancel the factor (x + 2) on the numerator/ denominator

= [tex]\frac{2}{2x}[/tex] ← cancel the 2 on numerator/ denominator

= [tex]\frac{1}{x}[/tex] : x ≠ 0

31. The bus fare in a city is $1.25. People who use the bus
have the option of purchasing a monthly discount pass for
$15.00. With the discount pass, the fare is reduced to $0.75.
Determine the number of times in a month the bus must
be used so that the total monthly cost without the discount
pass is the same as the total monthly cost with the discount pass.

Answers

Final answer:

The bus must be used 30 times in a month for the total monthly cost without the discount pass to be the same as the total monthly cost with the discount pass.

Explanation:

The mathematical problem deals with determining the number of times one must take a bus ride for a monthly discount pass to be as cost-effective as individual fare payments. To solve it, we must set up an equation based on the cost of bus rides. Let's denote the number of bus rides as 'n'.

Without the pass, each ride is $1.25, so n rides would cost 1.25n dollars.

With the pass, each ride is $0.75 and you also need to pay $15 for the monthly pass, so n rides would cost 0.75n + 15 dollars.

To find out the break-even point, we set these two expressions for the total cost equal to each other:

1.25n = 0.75n + 15

Solving this equation gives us:

0.5n = 15, n = 15/0.5 = 30.

Therefore, the bus must be used 30 times in a month for the total monthly cost without the discount pass to be the same as the total monthly cost with the discount pass.

Learn more about Bus Fare Calculation here:

https://brainly.com/question/13224694

#SPJ2

S = 2lw + 2wh + 2lh; solve for l

Answers

Answer:

l = (S - 2wh)/(2w + 2h)

Step-by-step explanation:

S = 2lw + 2wh + 2hl

S - 2wh = 2lw + 2hl

S - 2wh = l (2w + 2h)

(S - 2wh)/(2w + 2h) = l

The equation S = 2lw + 2wh + 2lh the value of l is given by l = S / (2w + 2h + 2wh)

To solve for l in the equation S = 2lw + 2wh + 2lh, we'll isolate l on one side of the equation. Here are the steps to do that:

Step 1: Start with the given equation:

S = 2lw + 2wh + 2lh

Step 2: Factor out l from the terms that contain it:

S = l( 2w + 2h + 2wh )

Step 3: Divide both sides of the equation by (2w + 2h + 2wh) to solve for l:

S / ( 2w + 2h + 2wh ) = l

So, the value of l is given by:

l = S / ( 2w + 2h + 2wh )

To know more about equation click here :

https://brainly.com/question/29050831

#SPJ2

Evaluate expression using the value given for the variable
7b - 2a, when a = -3 and b = 4

Answers

it would equal 34. all you would do it substitute 4 for b and that’ll be 7(4)-2a and then substitute 4 for a and that would make the entire expression 7(4)-2(-3)

Answer:

34

Step-by-step explanation:

Substitute the given values for a and b into the expression

7(4) - 2(- 3) = 28 - (- 6) = 28 + 6 = 34

What is the GCF of 36, 48, and 60?

Answers

Answer:

12

Step-by-step explanation:

ANSWER PLS ITS URGENT NEED DONE IN ONE MIN BUS IS COMING!!!! pls dont let me fail!!!!! (will mark as brainliest)
(answer the circled ones) its quadratic equation factoring

Answers

Answer:

8.) x = 5, x=-12

9.)x = 5, x = -8

10.)x = -1/5, x = -2

Hope I helped :)

Answer:

10. -2, -⅕ = x

9. -8, 5 = x

8. -12, 5 = x

7. -5, 6 = x

Step-by-step explanation:

10. [tex]5{x}^{2} + 11x + 2 = 0 \\ \\ (5{x}^{2} + x) + (10x + 2) = 0 \\ x(5x + 1) + 2(5x + 1) \\ \\ (x + 2)(5x + 1) = 0 \\ \\ -2, \: - \frac{1}{5} = x[/tex]

9.

[tex]2{x}^{2} + 6x - 80 = 0 \\ \\ (2{x}^{2} + 16x) - (10x - 80) = 0 \\ 2x(x + 8) -10(x + 8) = 0 \\ \\ (x + 8)(2x - 10) = 0 \\ \\ -8, \: 5 = x[/tex]

8.

[tex] {x}^{2} + 8x - 65 = x - 5 \:→ {x}^{2} + 7x - 60 \\ \\ ({x}^{2} - 5x) + (12x - 60) \\ x(x - 5) + 12(x - 5) \\ \\ (x + 12)(x - 5) = 0 \\ \\ 5, \: -12 = x[/tex]

7.

[tex] {x}^{2} = x + 30 → - {x}^{2} + x + 30 \\ \\ (-{x}^{2} - 5x) + (6x + 30) \\ -x(x + 5) + 6(x + 5) \\ \\ -(x - 6)(x + 5) = 0 \\ \\ -5, \: 6 = x[/tex]

I am joyous to assist you anytime.

explain how reading the digits ro the right of the decimal point and knowing the name of the least place value help yoi read a decimal number.use examples .604 and 1.604 in your explanation

Answers

Final answer:

Reading decimal numbers requires understanding the places to the right of the decimal point: tenths, hundredths, thousandths, etc. The least significant place value—which in 0.604 is the thousandth place—helps in reading, rounding, and performing operations like moving the decimal point or using scientific notation.

Explanation:

Understanding how to read decimal numbers is important in mathematics. When reading the digits to the right of the decimal point, the name of each place value position helps you determine the value of the digit. For example, in the number 0.604, the digit '6' is in the tenth place, which means it represents six tenths, the digit '0' is in the hundredth place, acting as a placeholder, and the '4' is in the thousandth place, representing four thousandths. Similarly, in 1.604, the '1' is in the ones place, the '6' is in the tenth place, the '0' is a placeholder in the hundredth place, and the '4' is in the thousandth place.

Knowing the least place value is also important when rounding or when dealing with operations that affect the decimal point. For instance, if we need to move the decimal point or deal with scientific notation, recognizing the least significant digit's place value informs us how to maintain numerical accuracy. If you understand that the least significant digit in 1.604 is the '4' in the thousandth place, you would keep the decimal up to three places if you were to round or shift the decimal in calculations.

If g(x) = x2 + 3, find g(4).
011
19
16
08

Answers

Answer:

11

Step-by-step explanation:

Write an equation of the line that passes through (−3,7) and is perpendicular to the line y=−2x−5.

Answers

Answer:

Step-by-step explanation:

an equation is : Use the point-slope formula.

y - y_1 = m(x - x_1)    ;  m : the slope   when : x_1 = -3   and  y_1  = 7

- 2 ×m = - 1  because this line is perpendicular to the line y= -2x-5 when the slope is  -2

so : m= 1/2

an equation is : y - 7 =(1/2)(x+3)  

Answer:

The desired equation is

y = (1/2)x + 17/2

Step-by-step explanation:

The slope of the perpendicular line is the negative reciprocal of -2:  m = 1/2.

Start with y = mx + b.

Substituting 7 for y, 1/2 for m and -3 for x, we get:

                7 = (1/2)(-3) + b.  Then 7 = -3/2 + b, so that b = 17/2.

The desired equation is

y = (1/2)x + 17/2

Which graph of ordered pairs shows a proportional relationship?

Answers

Answer:

c

Step-by-step explanation:

Graph C of ordered pairs shows a proportional relationship.

What is a proportional relationship?

Proportional relationships are relationships between two variables where their ratios are equivalent. Another way to think about them is that, in a proportional relationship, one variable is always a constant value time the other.

What is a proportional relationship on a graph?

A proportional relationship is one where there is multiplying or dividing between the two numbers. A linear relationship can be a proportional one (for example y=3x is proportional), but usually, a linear equation has a proportional component plus some constant number (for example y=3x +4).

Learn more about the proportional relationship here https://brainly.com/question/12242745

#SPJ2

evaluate the problem below -4 1/6 + 5 2/3​

Answers

Answer:

3/2 (or 1 1/2)

Step-by-step explanation:

-4 1/6 + 5 2/3​   (express as improper fractions)

= -25/6 + 17/3  (convert fractions common denominator i.e 6)

= -25/6 + (17/3)(2/2)

= -25/6 + (17 x 2)/6

= -25/6 + 34/6

= 9/6

= 3/2

=1 1/2

Marco has a piece of wood that measures 9 x 1/10 + 6 x 1/100 + 4 x 1/1000 how can this measurement be written as a decimal? you miss ONE DAY OF SCHOOL

Answers

Answer:

The decimal number is 0.964

Step-by-step explanation:

we have

[tex]9(\frac{1}{10})+ 6(\frac{1}{100})+4(\frac{1}{1,000})[/tex]

step 1

Multiply each fraction by the whole number

[tex](\frac{9}{10})+ (\frac{6}{100})+(\frac{4}{1,000})[/tex]

step 2

Convert each fraction in a decimal number

Remember

Move the decimal point to the left as many places as there are zeros in the factor.

Move the decimal point one step to the left (10 has one zero).

Move the decimal point two steps to the left (100 has two zeros)

Move the decimal point three steps to the left (1000 has three zeros)

[tex]0.9+0.06+0.004[/tex]

step 3

Adds the number

[tex]0.964[/tex]

A bus has 40 seats . There are as many adults as children riding the bus so there are

Answers

Answer:

20 children and 20 adults

Step-by-step explanation:

20 + 20 = 40

Answer:

20 adults 20 children

Step-by-step explanation:

if theres the same amount of children and adults just do 40/2

Chandresh has several fishing rods that she would like to pack in boxes. One box is shown below.



Which fishing rod will fit in the box shown?
A. 17-inch fishing rod
B. 24-inch fishing rod
C. 27-inch fishing rod
D. 32-inch fishing rod

Answers

Answer: A, 17 inch

The box is 21 inches long, anything longer and it won't fit. 17 inch is the only thing shorter than 21.

Answer:

the green means its right at the top

Step-by-step explanation:

Which lines are parallel? Check all that apply.
89.5°
91.51
88.5°
89.5°
90.5°

Answers

The lines that are parallel to each other are as follows;

b║fc║e

How to know lines that are parallel from the angles?

When parallel lines are cut by a transversal, angles relationship are formed.

This angle relationship includes corresponding angles, alternate angles, vertical angles and many more.

Therefore, the lines that are parallel are as follows;

b║f : If you use alternate angle theorem you will notices line b and f are parallelc║e: using alternate and corresponding angle theorem you will notice both line c and e are parallel.

learn more on parallel lines here: https://brainly.com/question/10652739

#SPJ1

simplify 20+3xy-3+4y^2+10-2y^2​

Answers

Here is your answer the A/= it means the answer is okay.

Julia recorded the number of trips each of his classmates made to fast food restaurants last week in the dit plot below which of the following would be the best measure of center

Answers

Mean absolute deviation of the following would be the best measure of center. Option A is correct.

What is a boxplot?

A boxplot is a visual representation of a data set's dispersion and centers.

The interquartile range and the mean of the data set are two examples of spread measures. The mean, average, and median are examples of center measures.

A box plot is a graph that allows us to readily compare the median number of teeth in mammals and reptiles.

The scatter plot below shows how many visits to fast food establishments each of his classmates made throughout the previous week.

The best indicator of the center would be the mean absolute deviation of the following.

Hence option A is correct.

To learn more about the box plot, refer to https://brainly.com/question/1523909

#SPJ2

As lucia fills her fish tank, she notices that it fills 8 cubic centimeters of water in 4 minutes. How many cubic centimeters of water does it fill in 1 minute?

Answers

Answer:

2 cubic centimeters per minute

Step-by-step explanation:

8 cubic centimeters filled per 4 minutes

divide 8 by 4 = 2

2 cubic centimeters per minute

Answer: 2 cubic centimeters

Step-by-step explanation:

Given : As lucia fills her fish tank, she notices that it fills 8 cubic centimeters of water in 4 minutes.

i.e. Time taken to fills 8 cubic centimeters of water = 4 minutes

By UNITARY METHOD, we have

Amount of water it fills in 1 minute (i.e. Unit rate) = [tex]\dfrac{\text{8 cubic centimeters }}{\text{4 minutes}}[/tex]

= [tex]\dfrac{8}{4}=2[/tex] cubic centimeters

Therefore, it fills 2 cubic centimeters in 1 minute.

Hence, the correct answer is 2 cubic centimeters.

If h(x) = 6 - X, what is the value of (10)

Answers

Answer:

-4 = h(x)

Step-by-step explanation:

[tex]6 - 10 = -4[/tex]

I am joyous to assist you anytime.

what is equivalent to the square root of -98

Answers

Answer:

7√2 i

Step-by-step explanation:

√(-98)

=√{(-1) .98}

=√(-1 . 2 . 7²)

=√-1 .√2 . √7²

= i . √2 . 7         [∵√-1 = i ]

=7√2 i

Answer:

[tex]\large\boxed{\sqrt{-98}=7\sqrt2\ i}[/tex]

Step-by-step explanation:

[tex]\sqrt{-98}=\sqrt{(-1)(49)(2)}\qquad\text{use}\ \sqrt{ab}=\sqrt{a}\cdot\sqrt{b}\\\\=\sqrt{-1}\cdot\sqrt{49}\cdot\sqrt2\qquad\text{use}\ \sqrt{-1}=i\ -\text{an imaginary unit}\\\\=i\cdot7\cdot\sqrt2\qquad\sqrt{49}=7\ \text{because}\ 7^2=49\\\\=7\sqrt2\ i[/tex]

Other Questions
The probability that a lab specimen contains high levels of contamination is 0.15. A group of 3 independent samples are checked. Round your answers to four decimal places (e.g. 98.7654). (a) What is the probability that none contain high levels of contamination? (b) What is the probability that exactly one contains high levels of contamination? (c) What is the probability that at least one contains high levels of contamination? Can i please have help i will rate 5 and thank. Song Title:Year Song Was Released:1.How many different instruments do you hear in this band or group? Identify and name the instruments you hearAnswer: 2.Is one instrument featured more prominently than the others? What is it about the sound of that instrument that makes a distinct impression on the listener? What is unique about this instrument? Answer:3.Choose an instrument that you normally dont pay much attention to (maybe the bass or the keyboard, for instance). Listen carefully to how it sounds in this song. Describe three interesting features that characterize this instrument and its sound. Why is this instrument crucial to the overall sound of this band? Explain your reasoning.Answer:4.Think about the singer and the instruments in the band. Are the instruments and the singer of equal importance? In your opinion, which is more important and why do you think so?Answer: which of the following is indicated by the arrow in the image Convert the condensed structures to line angle formulas: 1. CH3CH2CH(CH3)CH2CH3 8. CH:COCH 9. CH3CH2OCH3 2. CH3CH2CH(CH2CH3)CH(CH3)CH2CHO CH)CH:CH-CH: 10. CH CH2CH=C(CH:CH)(C(CH))CH 3. CH3CH2CH(CH3)CH(CH3)CH2CH3 11. CH:CH-CH(CH2CH)CH OH 4. CH3C(CH3)2CH2CH2CH(CH3)CH2CH3 12. CHCHOCH2CHO 5. CH(CH3)2CH(CI)CH2CH3 13. HOOCCH2NHCH(CH3)COCH; 6. CH3CH2CHOCH(CH2CH3)CH2CH3 14. HOOCCH OCH COOH 7. HOCH:C(CH3)2CONH2 name the property that is shown by the following expression (9x3)x4=9x(3x4) PLEASE HELPWhich of the following is TRUE about gothic master builders?A. They designed the structure of the church without supervising its constructionB. Their primary role was to construct the church the abbot designed.C. They worked closely with the abbot to design and build a church.D. They supervised construction without working with their own hands. Exotics Faucets and Sinks LTD., guarantees that its new infrared sensor faucet will save any household that has 2 or more children at least $30 per month in water costs beginning 1 month after the faucet is installed. If the faucet is under full warranty for 5 years, the minimum amount a family of four could afford to spend now on such a faucet at an interest rate of 1/2% per year, compounded monthly, is closest to(a) $149c) $1787(b) $1552d) $1890 Which terms are rational in the expansion of (\sqrt{3} + \frac{1}{\sqrt[4]{6}})^{15} . List the rational terms and justify why the others are not rational. Please help me answer these: (8.18*10^-6)(1.15*10^-5)and1.15*10^-7_______2.5*10^-3 It's scientific notation and please explain your answer What volume of phenytoin suspension 30 mg/5 mL is required to be added to a suitable diluent to obtain 150 mL phenytoin suspension 20 mg/5 mL? 100 Use Gaussian elimination on the augmented matrix, then use back substitution to find the solution of the system of linear equations.-2x + 3y - 4z = 75x - y + 2z = 133x + 2y - z = 17 Males of different species of the fruit fly Drosophila that live in the same parts of the Hawaiian Islands have different elaborate courtship rituals. These rituals involve fighting other males and making stylized movements that attract females. What type of reproductive isolation does this represent?a. habitat isolationb. temporal isolationc. behavioral isolationd. gametic isolation 53.010,000 in scientific nottation Even though the nation faces political instability, the island of Frollik with its wide, expansive beaches is a destination hub for cruise lines. Recently, a large theme park company showed strong interest in buying land in Frollik with the intent of building a park targeted toward families. The company wants to make a commitment to Frollik, including the hiring of several hundred local employees. Theyre using a global marketing strategy called ____________. According to Archimedes' principle, the mass of a floating object equals the mass of the fluid displaced by the object. A 150-lbm swimmer is floating in nearby pool; 95% of her body's volume is in the water while 5% of her body's volume is above water. Determine the density of the swimmer's body The density of water is 0.036 lbm/in5. Does your answer make sense?? Why why not? Discuss the meaning and significance of the fact that thegenetic code is degenerate. Which set of diagrams shows a balanced chemical equation?A : Diagram AB : Diagram BC : Diagram CD : Diagram D What did John withrop do in the Americas missing length??3 cm8 cmi need big help The chief explained what the situation was.Is this a simple or complex sentence ?