Write each of the following expressions as a powers of 2: (4·25)÷(23· 1/16 )

Answers

Answer 1
(4 · 2^5) ÷ (2^3 · 1/16 )

= (2^2 · 2^5) ÷ (2^3 · 2^-4 )

= (2^7) ÷ (2^-1)

= 2^8
Answer 2

The value obtained as the power of 2 after solving the expression, (4×2⁵) ÷ (2³ × 1/16 ) will be 2⁸.

What is an integer exponent?

In mathematics, integer exponents are exponents that should be integers. It may be a positive or negative number. In this situation, the positive integer exponents determine the number of times the base number should be multiplied by itself.

The given expression is,

(4×2⁵) ÷ (2³ × 1/16 )

Keep the base constant and add the exponents when multiplying similar bases. Maintaining the same base while multiplying the exponents will raise a base with power to another power. When dividing two bases with similar exponents, keep the exponents of the numerator and denominator constant.

= (2² × 2⁵) ÷ (2³ × 2⁻⁴ )

= (2⁷) ÷ (2⁻¹)

= 2⁸

Thus, the values obtained as the power of 2 after solving the expression, (4×2⁵) ÷ (2³ × 1/16 ) will be 2⁸.

Learn more about the integer exponent here:

brainly.com/question/4533599

#SPJ2


Related Questions

Make a line graph of the data in the table and conjecture on the minimum degree of a polynomial model...

Answers

When you plot the given points, you obtain the graph attached. As you can see, the function has two turning points, so:

 Minimum degree=(2 turning points)+1=3

 Therefore, the minimum degree of a polynominal model is 3, and it can be expressed as below:

 f(x)=ax³+bx+cx+d

 The answer is:3
 

Lorne subtracted 6x3 – 2x + 3 from –3x3 + 5x2 + 4x – 7. Use the drop-down menus to identify the steps Lorne used to find the difference. 1. (–3x3 + 5x2 + 4x – 7) + (–6x3 + 2x – 3) 2. (–3x3) + 5x2 + 4x + (–7) + (–6x3) + 2x + (–3) 3. [(–3x3) + (–6x3)] + [4x + 2x] + [(–7) + (–3)] + [5x2] 4. –9x3 + 6x + (–10) + 5x2 5. –9x3 + 5x2 + 6x – 10

Answers

To find the polynomial difference, Lorne transformed the subtraction into addition of the opposite, combined like terms, and simplified the expression to get the result of -9x³ + 5x² + 6x - 10.

To find the difference between the two polynomials, Lorne correctly followed the steps of subtraction by changing the subtraction to the addition of the opposite. The process is outlined below:

Add the opposite of the second polynomial to the first polynomial by changing the sign of each term in the second polynomial.

Combine like terms by adding the coefficients of terms with the same degree of x.

Rearrange the terms in descending order of their degrees.

Write down the final simplified form of the polynomial.

By following these steps, the result would be:

Step 1:

(-3x³ + 5x² + 4x - 7) + (-6x³ + 2x - 3)

Step 2:

(-3x³ + 5x² + 4x - 7) + (-6x³) + 2x + (-3)

Step 3:

[(-3x³) + (-6x³)] + [4x + 2x] + [(-7) + (-3)] + [5x²]

Step 4:

-9x³ + 6x + (-10) + 5x2

Step 5:

-9x³ + 5x² + 6x - 10

Lorne subtracted [tex]6x^{3} - 2x + 3[/tex] from [tex]-3x^{3} + 5x^{2} + 4x - 7[/tex]. So, the main answer is 5. [tex]-9x^{3} +5x^{2} +6x-10.[/tex]

The steps Lorne used to find the difference between [tex]-3x^{3} +5x^{2} +4x-7[/tex] and [tex]6x^{3} -2x+3[/tex] are:

[tex]1. (-3x^{3} +5x^{2} +4x-7)+(-6x^{3} +2x-3)\\2. (-3x^{3} )+5x^{2} +4x+(-7)+(-6x^{3} )+2x+(-3)\\3. [(-3x^{3} )+(-6x^{3} )]+[4x+2x]+[(-7)+(-3)]+[5x^{2} ]\\4. -9x^{3} +6x+(-10)+5x^{2} \\5. -9x^{3} +5x^{2} +6x-10[/tex]

So, the main answer is 5. [tex]-9x^{3} +5x^{2} +6x-10.[/tex]

Lorne first added the two polynomials by combining like terms, then simplified the result by collecting like terms. The final expression represents the difference between the two polynomials after combining and simplifying.

COMPLETE QUESTION:

Lorne subtracted [tex]6x^{3} - 2x + 3[/tex] from [tex]-3x^{3} + 5x^{2} + 4x - 7[/tex]. Use the drop-down menus to identify the steps Lorne used to find the difference.

[tex]1. (-3x^{3} +5x^{2} +4x-7)+(-6x^{3} +2x-3)\\2. (-3x^{3} )+5x^{2} +4x+(-7)+(-6x^{3} )+2x+(-3)\\3. [(-3x^{3} )+(-6x^{3} )]+[4x+2x]+[(-7)+(-3)]+[5x^{2} ]\\4. -9x^{3} +6x+(-10)+5x^{2} \\5. -9x^{3} +5x^{2} +6x-10[/tex]

Miguel’s teacher asks him to color for 4/8 of his grid. He must use three colors: red blue and green. There must be more green sections then red sections. How can Miguel color the section service grid to follow all the rules?

Answers

2/8 can be green, 1/8 can be red, and 1/8 can be blue. The amount of green is greater then the red section and it all adds up to 4/8 or 1/2.

Help with this question

Answers

Since there is one real root and one complex root, there must be one additional real root and another complex root that is the conjugate of the one given.

The conjugate complex roots give rise to the factor
.. (x -2 -5i)*(x -2 +5i)
.. = (x -2)^2 +25
.. = (x^2 -4x +29)

The given real root gives rise to the factor 
.. (x +2)

The remaining factor can be written as
.. (ax -3)
since we know the product of the constant terms in these factors must be -174.

The product of these factors is
.. (x +2)(x^2 -4x +29)(ax -3)
.. = ax^4 -(2a +3)x^3 +(21a +6)x^2 +(58a -63)x -174

Matching x-coefficients, we have
.. 53 = 58a -63
.. 116 = 58a
.. 2 = a


(a) The factored function is
.. f(x) = (x +2)(x^2 -4x +29)(2x -3)


(b) The values of a, b, c are ...
.. a = 2
.. b = -(2a +3) = -7
.. c = 21a +6 = 48

(a, b, c) = (2, -7, 48)

Use Cavalieri’s Principle to calculate the exact volume of an oblique cylinder with a height of 10 meters and a circular base with a radius of 8 meters

Answers

I think it is 640 pi

Answer: Volume of an oblique cylinder is 2011.43 sq.m.

Step-by-step explanation:

Since we have given that

Radius of a cylinder = 8 meters

Height of a cylinder = 10 meters

Cavelieri's Principle states that volume of an oblique cylinder is same as the volume of right circular cylinder with equal radius and height.

As we know the formula for "Volume of cylinder":

[tex]Volume=\pi r^2h\\\\V=\frac{22}{7}\times 8\times 8\times10\\\\V=\frac{14080}{7}\\\\V=2011.43[/tex]

Hence, Volume of an oblique cylinder is 2011.43 sq.m.


The Philips family had 3 cats. They needed to split 20 ounces of cat food among the three cats. How much cat food would each cat get? between what two whole numbers does your answer lie?

Answers

Final answer:

Each cat would get approximately 6.67 ounces of cat food, which falls between 6 and 7 ounces. The calculation is done by dividing the total amount of food (20 ounces) by the number of cats (3).

Explanation:

The Philips family had to split 20 ounces of cat food among their 3 cats. To find out how much food each cat gets, we need to divide the total amount of food by the number of cats. Calculating this, 20 ounces ÷ 3 cats equals approximately 6.67 ounces per cat. Even though this is a decimal, if we consider whole numbers, the amount each cat gets falls between 6 and 7 ounces, since 6.67 is more than 6 and less than 7.

When dealing with fractions and division, it's essential to understand the concept of division and be able to find averages. The task at hand may often find itself related to dividing a quantity evenly among a number of recipients, much like in scenarios where we have to split a pie or determine individual portions.

Final answer:

To divide 20 ounces of cat food equally among three cats, each cat gets approximately 6.67 ounces. The amount of food per cat lies between the whole numbers 6 and 7.

Explanation:

The question is asking how to divide 20 ounces of cat food equally among three cats. To find out how much each cat would get, you divide the total amount of cat food by the number of cats:

Determine the total amount of food: 20 ounces.Count the number of cats: 3 cats.Divide the total amount of food by the number of cats: 20 ounces ÷ 3 cats = approximately 6.67 ounces per cat.

This calculation shows that each cat would get approximately 6.67 ounces of food. This value lies between the whole numbers 6 and 7. Therefore, when the Philips family divides the cat food, each cat gets a little more than 6 ounces but less than 7 ounces of food.

What is the area of the figure?

Express your answer as a mixed number in simplest form.

? m2

Answers

The area of this would be 1.69 or 1 69/100 in mixed number form.

What is the solution set to the inequality-3x 5.92-15.4 for x in the set (-10,-5, 0, 5, 10)?

Answers

I have attached an image of the question

Answer:

-10 , -5 , 0 and 5

Explanation:
The given inequality is:
-3x + 5.9 ≥ -15.4

We will need to isolate the x on one side of the inequality as follows:
First, we will subtract 5.9 from both sides of the inequality as follows:
-3x + 5.9 - 5.9 ≥ -15.4 - 5.9
-3x ≥ -21.3

Then, we will divide both sides of the inequality by -3. Remember that when we divide by a negative number, we flip the inequality sign as follows:
-3x / -3 ≥ -21.3 / -3
x ≤ 7.4

This means that x could be any value starting from -∞ till 7.4
The given set is (-10,-5, 0, 5, 10)
Now, we will check the given options, the correct ones would be those having a value of 7.4 or less.
This means that the correct options are:
-10 , -5 , 0 and 5

Hope this helps :)

Final answer:

The solution set to the given inequality '-3x < 5.92 - 15.4' is {5, 10}.

Explanation:

The student's question seems to be about solving an inequality to find which values from a given set satisfy it. While the inequality itself appears to be incorrectly written or has a typo, I'll assume it's meant to be '-3x < 5.92 - 15.4'.

We can begin by simplifying the right side of the inequality:

5.92 - 15.4 = -9.48

So the inequality becomes:

-3x < -9.48

To solve for x, we divide both sides by -3, remembering to reverse the inequality sign because we are dividing by a negative number:

x > 9.48 / 3

x > 3.16

Now we can compare this result to the set of numbers given: (-10, -5, 0, 5, 10).

The only numbers greater than 3.16 are 5 and 10.

Therefore, the solution set to the inequality is {5, 10}.

Mah problem, in class no substitute beed help

Answers

You need the greatest common factor of the two numbers.

First, we find the prime factorization of each number.

72/2 = 36
36/2 = 18
18/2 = 9
9/3 = 3
3/3 = 1

72 = 2^3 * 3^2

90/2 = 45
45/3 = 15
15/3 = 5
5/5 = 1

90 = 2 * 3^2 * 5

To find the GCF, use only common factors with the lower exponent.

Both 72 and 90 have 2 as a factor. 72 has 2^3, and 90 has 2. 2 has a lower exponent than 2^3, so we use 2.

Both 72 and 90 have 3 as a factor. The both have 3^2, so we use 3^2.

90 has 5 as a factor, but 72 does not, so 5 is not a common factor, so we do not use 5.

The GCF is the product of the factor we use.

GCF = 2 * 3^2 = 2 * 9 = 18

Answer: The greatest number of students he can place in a row is 18.

You have a $50 gift card to the same site. You want to buy an album with 16 tracks for $12.99 and then use the rest of the gift card for single tracks. How many songs can you buy with the gift card?

Answers

first you will subtract 12.99 from 50
50 - 12.99 = 37.01
now you need to divide 16 by 12.99 to find out how much it costs for a single song
16 divided by 12.99 = $1.23
now you will divide 37.01 divided by 1.23
37.01 divided by 1.23 = about 30 
this means youll get about 30 single tracks with your gift card.
let me know if you have any further questions
:)

Final answer:

After purchasing an album for $12.99 from the $50 gift card, the remaining balance is $37.01, which allows the purchase of 37 more single tracks, assuming each track costs $1.

Explanation:

To determine how many songs can be bought with a $50 gift card after purchasing an album for $12.99, we need to subtract the cost of the album from the total amount on the gift card. So, we have:

Total amount on gift card: $50Cost of album: $12.99

Subtracting the cost of the album from the gift card amount gives us:

$50 - $12.99 = $37.01

Assuming that each single track costs $1 as per the scenario provided, we can divide the remaining balance by the cost per single track:

$37.01 ÷ $1 per track = 37 tracks

This means that you can purchase 37 more single tracks with the remaining balance on the gift card.

2. Quadrilateral ABCD is inscribed in a circle. Find the measure of each of the angles of the quadrilateral. Show your work.

Answers

A cyclic quadrilateral is a quadrilateral whose vertices all touch the circumference of a circle.

Opposite angles in a cyclic quadrilateral add to 180 degrees. Quadrilateral ABCD is a cyclic quadrilateral.

< A+<C=180

Substituting <A and <B values given in figure:

x+2+x-2=180

Adding like terms:

2x=180

Dividing both sides by 2

x=90°

<A=x+2=90+2=92°

<C=x-2=90-2=88°

<D=x-10=90-10=80°

<B+<D=180

<B=180-80=100°

The angles of the quadrilateral ABCD are

<A=92°

<B=100°

<C=88°

<D=80°

What is the completely factored form of x2y – 2xy – 24y?

Answers

Factoring the expression we proceed as follows:
x^2y-2xy-24y
this can be simplified to:
x^2y-xy-xy-24y
=xy(x-1)-y(x-24)

Answer:

C: y(x + 4)(x – 6)

Step-by-step explanation:

I took the test on Edge -2022

Find the fuction h (x) =f(x) - g (x) if f (x)=3^x and g (x)= 3^2x - 3^x

Answers

if h(x) = f(x) - g(x)

then --> h(x) = 3^x - 3^2x - 3^x
             h(x) = -3^2x
         


To find h(x) = f(x) - g(x), we substitute and simplify the given functions. The result is h(x) = 2 × 3ˣ - 3²ˣ. This solution involves basic algebraic manipulation and exponent rules.

Let's start by defining the given functions:

f(x) = 3ˣg(x) = 3²ˣ - 3ˣ

We need to find h(x) = f(x) - g(x). Substitute the expressions for f(x) and g(x):

h(x) = 3ˣ - (3²ˣ  - 3ˣ)

Now simplify the expression inside the parentheses:

h(x) = 3ˣ - 3²ˣ  + 3ˣ

Combine like terms:

h(x) = 3ˣ+ 3ˣ - 3²ˣh(x) = 2 × 3ˣ - 3²ˣ

Thus, the function h(x) = 2 × 3ˣ - 3²ˣ is found by subtracting g(x) from f(x).

What is the solution set for 3x>6?

Answers

Isolate the x

divide 3 from both sides

3x/3 > 6/3

x > 6/3

x > 2 is your answer

Note: because you are not dividing by a negative number, you do not need to flip the sign

hope this helps
x>2 because you first divide 3 by 3, to cancel out the 3 and what you do to one side you do to the other. So you divide 6 by three which equal 2. This process is to isolate the x, so you can somewhat determine what x is. Therefore x is greater than 2, x>2

Determine the taylor series about the point x0=2 for the function 11−x. determine the radius of convergence of the series.

Answers

Try this solution, if it is possible check it in the other sources.
P.S. for the radius of convergence: it is clear that all the members of the series (except the 1st and the 2d ones) are '0'.

A Bird Is flying 5 m/s. How far will it travel if it flies for 3minutes

A. 15m
B. 5m
C. 900m
D. 36m

Answers

The bird is flying at 5m/s, so
1 sec = 5 m

It flies for 3 mins
3 mins = 3 x 6sec
3 mins = 180 sec
The bird flies for 180 seconds

1 sec = 5 m
180sec = 5 x 180 = 900m

The bird flew 900m in 3 mins (Answer C)

The left and right page numbers of an open book are two consecutive integers whose sum is 423.

Answers

211 and 212. this is bc x+1 and x+2 is equal to 2x+3=423 and if you solve for  it equals 210 so 210 +1 =211 and 210+2=213

Philip is going on a 400040004000-kilometer road trip with three friends. The car consumes 666 liters of gas per 100100100 kilometers, and gas costs \$1.50$1.50dollar sign, 1, point, 50 per liter.

Answers

 If Philip and his friends want to split the cost of gas evenly, how much should they each pay?
the amount of gas it consumes per 100 km = 6 l
the cost per litre = $1.50
the total distance of the trip = 4000 km
If 100 km consumes - 6 l
Then 1 km consumes - 6/100 l/km
therefore amount of gas for the whole trip of 4000 km = 6/100 l/km * 4000 km
the gas consumed = 240 l
cost of 1 l = $1.5
then the cost of gas for the whole ride = 240 l * $ 1.5
  cost = $ 360
there are 4 friends , cost of each friend = $ 360/4 = $ 90
cost each friend has to pay = $ 90

sin(76)cos(31)-cos(76)sin(31)

Answers

Evaluate sin (76) to get = 0.97029572
0.97029572 cos (31) - cos (76) sin (31)

Evaluate cos (31) to get 0.85716730
0.97029572 * 0.85716730 - cos (76) sin (31)

Multiply 0.97029572 by 0.85716730 to get 0.83170576.
0.83170576 - 1 * 0.24192189 sin (31)

Multiply 1 by 0.24192189 to get 0.24192189.
0.83170567  - 0.24192189 sin (31)
 
Evaluate sin (31) to get 0.51503807
0.83170576 - 0.24192189 * 0.51503807

Multiply  -0.24192189 by 0.51503807 to get -0.12459898.
0.83170576 - 0.12459898

Subtract 0.12459898 from 0.83170576 to get 0.70710678.

= 0.70710678

Hope this helps. Good luck:)



what is the product 4^3* 4^-3

Answers

Hey there! :D

Take care of the exponents. 

4^3= 4*4*4 

4^3= 64

4^-3

Make it a fraction to make the power positive. 

[tex] \frac{1}{4^3} [/tex]

Now, simplify. 

[tex] \frac{1}{64} [/tex]

64* 1/64= 1

The answer is 1. 

I hope this helps!
~kaikers

The product 4^3×4^(-3) is equal to 1.

Take care of the exponents.

4^3= 4*4*4

4^3= 64

=4^-3

What is the product?

The product meaning in maths is a number that you get to by multiplying two or more other numbers together.

Make it a fraction to make the power positive.

[tex]=\frac{1}{4^3}[/tex]

Now, simplify.

[tex]=\frac{1}{64}[/tex]

=64* 1/64= 1

Therefore, The product 4^3×4^(-3) is equal to 1.

To learn more about the product visit:

https://brainly.com/question/25922327

#SPJ2

I need some help what 9 + 10?

Answers

9 + 10 will equal 19
19, because if let's say you took 9 blocks, added 10, and counted them all, 19 would be the answer

Mrs. Bell has a rain gauge outside. On a very rainy day, the gauge measured 2.5 inches. The actual amount of rain that fell was 2.3 inches. To the nearest tenth, what is the percent error in Mrs. Bell's measurement?

Answers

The measurement error is defined as the difference between the measured value and the "true value".
 We have then that the error is given by:
 E = 2.5-2.3
 E = 0.2 inches
 The error percentage is:
 % E = (0.2 / 2.3) * 100 = 8.7%
 Answer:
 
The percent error in Mrs. Bell's measurement is:
 
% E = 8.7%

three friends are in the same algebra class. Their scores on a recent test are three consecutive odd intergers whose sum is 279. find each score

Answers

x= 1st integer
x+2= 2nd integer
x+4= 3rd integer

Add the integers together

x + (x + 2) + (x + 4)= 279
combine like terms
3x + 6= 279
subtract 6 from both sides
3x= 273
divide both sides by 3
x= 91 first integer

Substitute x=91 to find 2nd & 3rd integers

2nd Integer
=x+2
=91+2
=93

3rd Integer
=x+4
=91+4
=95

ANSWER: The three test scores are 91, 93 and 95.

Hope this helps! :)

the area of this circle is 72π m^2 what is the area of a 45° sector of this circle

Answers

A 45° sector is 1/8 of the area of the circle, so is (72π m^2)/8 = 9π m^2.

7b divided by 12=4.2 what is b

Answers

Final answer:

To solve for b in the equation 7b divided by 12 equals 4.2, multiply both sides by 12 and then divide by 7, resulting in b being equal to 7.2.

Explanation:

To solve the equation 7b ÷ 12 = 4.2 for b, we must isolate b on one side of the equation. We can begin by multiplying both sides of the equation by 12 to cancel out the division by 12 on the left side. This results in the equation 7b = 4.2 × 12. To find the value of b, we then divide both sides of the equation by 7:

Multiply both sides by 12: 7b ÷ 12 × 12 = 4.2 × 12Simplify: 7b = 50.4Divide both sides by 7: 7b ÷ 7 = 50.4 ÷ 7b = 7.2

Therefore, the value of b is 7.2.

Final answer:

To find the value of b in the equation 7b/12 = 4.2, multiply both sides by 12 and then divide by 7 to get b = 7.2. The value of b is 7.2.

Explanation:

The student is asking how to find the value of b in the equation 7b divided by 12 equals 4.2. To solve for b, you can follow these steps:

Write down the original equation: 7b / 12 = 4.2.Multiply both sides of the equation by 12 to eliminate the denominator: 12 * (7b / 12) = 12 * 4.2, which simplifies to 7b = 50.4.Divide both sides by 7 to solve for b: 7b / 7 = 50.4 / 7, which gives b = 7.2.

Therefore, the value of b is 7.2.

Write 4/10 as a fraction with a denominator of 100. Then write 4/10 as a decimal.
Would it be 4/100 or 40/100? The decimal would be 0.4 ?

Answers

4/10 = (4x10)/(10x10) = 40/100

4/10 = 0.4

Last summer we took an auto trip of 3427 miles . After we had driven 1578 miles , how many are left ?

Answers

There wold be 1,849miles left.
There are 1849 miles left to go!! Good luck!

Sam is training for an upcoming wrestling match. He trains for 3.5 hours each day Monday through Wednesday. He trains 2.5 hours on Thursday and Friday. How many hours will he train if he trains for six weeks

Answers

3.5 * 3 = 10.5
2.5 * 2 = 5

10.5 + 5 = 15.5 hours for 1 week

15.5 * 6 = 93 hours in 6 weeks

The system of equations 4x-y=4(x+1) , y = 6 has:
A. one solution
B. infinitely many solutions
C. no solution

Answers

The system of equations 4x-y=4(x+1) and y=6 has no solution.

To determine the solution(s) of the system of equations, let's analyze each equation:

Equation 1: 4x - y = 4(x + 1)

Equation 2: y = 6

To simplify Equation 1, we can distribute 4 on the right side:

4x - y = 4x + 4

By rearranging terms, we have:

- y = 4

Comparing Equation 2 with this result, we see that the two equations are contradictory. Equation 2 states that y = 6, while the modified Equation 1 states that y = -4. This means there is no value of y that can simultaneously satisfy both equations.

Thus, the system of equations has no solution.

Therefore, the correct answer is C. no solution.

To know more about system of equations, refer here:

https://brainly.com/question/30127282

#SPJ6

What is the right answer for this? Need this module done before tomorrow so If y’all could help that’ll be great

Answers

the simple interest is $60
Other Questions
Which type of cell is essential in fighting disease? Giving brainiest+points need explanation on this one my answer is 25 is it right? PLEASE HELP, HISTORY In this speech, Roosevelt termed, for the first time, journalists as muckrakers.Muck-rake- n. A rake for scraping up muck or dungMuckrake- v. To search out and publicly expose real or apparent misconduct of a prominent individual or businessSATURDAY, APRIL 14, 1906In Bunyan's Pilgrim's Progress you may recall the description of the Man with the Muck-rake, the man who could look no way but downward, with the muck-rake in his hand; who was offered a celestial crown for his muck-rake, but who would neither look up nor regard the crown he was offered, but continued to rake to himself the filth of the floor.In Pilgrim's Progress the Man with the Muck-rake is set forth as the example of him whose vision is fixed on carnal instead of on spiritual things. Yet he also typifies the man who in this life consistently refuses to see aught that is lofty, and fixes his eyes with solemn intentness only on that which is vile and debasing. Now, it is very necessary that we should not flinch from seeing what is vile and debasing. There is filth on the floor and it must be scraped up with the muck-rake; and there are times and places where this service is the most needed of all the services that can be performed. But the man who never does anything else, who never thinks or speaks or writes, save of his feats with the muck-rake, speedily becomes, not a help to society, not an incitement to good, but one of the most potent forces for evil.There are, in the body politic, economic and social, many and grave evils, and there is urgent necessity for the sternest war upon them. There should be relentless exposure of and attack upon every evil man whether politician or business man, every evil practice, whether in politics, in business, or in social life. I hail as a benefactor every writer or speaker, every man who, on the platform, or in book, magazine, or newspaper, with merciless severity makes such attack, provided always that he in his turn remembers that the attack is of use only if it is absolutely truthful. . . To assail the great and admitted evils of our political and industrial life with such crude and sweeping generalizations as to include decent men in the general condemnation means the searing of the public conscience. There results a general attitude either of cynical belief in and indifference to public corruption or else of a distrustful inability to discriminate between the good and the bad. Either attitude is fraught with untold damage to the country as a whole. The fool who has not sense to discriminate between what is good and what is bad is well-nigh as dangerous as the man who does discriminate and yet chooses the bad. There is nothing more distressing to every good patriot, to every good American, than the hard, scoffing spirit which treats the allegation of dishonesty in a public man as a cause for laughter. Such laughter is worse than the crackling of thorns under a pot, for it denotes not merely the vacant mind, but the heart in which high emotions have been choked before they could grow to fruition.In this speech, Roosevelt wants journalists to write honestly, but not focus so much on uncovering corruption that they are unable to see anything else. Which of the following lines best supports the main idea of the speech?A.) "In Pilgrim's Progress the Man with the Muck-rake is set forth as the example of him whose vision is fixed on carnal instead of on spiritual things."B.) "Yet he also typifies the man who in this life consistently refuses to see aught that is lofty, and fixes his eyes with solemn intentness only on that which is vile and debasing."C.) "...who never thinks or speaks or writes, save of his feats with the muck-rake, speedily becomes, not a help to society, not an incitement to good, but one of the most potent forces for evil."D.) "There should be relentless exposure of and attack upon every evil man, whether politician or business man, every evil practice, whether in politics, in business, or in social life." Which of the following most closely models the behavior of a sunspot? A. a freckle B. an eyelash C. a birthmark D. a lip Francis is a patient who no longer wants to be treated in the hospital. The doctor did not agree with Francis, but Francis left anyway. Which abbreviation would be in Franciss chart? ACLSDAMACBRDNR For a school group, a skating rink charges a flat fee of $50 for skates for the students to use the skating rink.For 40 Students the skating rink charges 180.For 75 students, the skating rink charges 293.75Which question represents the amount the skating rink charges for x students?A)y=3.25x+35B)y=3.25x+ 50C)y=4.50x+ 35D) y=4.50x+ 50 Triangle ABC was dilated and translated to form similar triangle A'B'C'. What is the scale factor of the dilation?A. 1/5B. 2/5C. 5/2D. 5/1 If a parabola has its vertex at (4, -2). One of its zeros is 1. What is the other zero? Jake needs to put gas in the delivery van. Regular gasoline is $3.20 per gallon. He only had a $ 20 bill on him. How many gallons can he buy What is the greatest value of the data represented by the box plot?Enter your answer in the box. PLZZZZ HELP ME!!!! U WILL GET 30 POINTS!!!!After a juvenile has been taken into custody, which of these is the next step in the judicial process that must be taken? A. adjudicatory hearing B. probable cause hearing C. a verdict must be rendered D. he/she must be released to the parent/guardian find the approximate surface area of a bowling ball with a raius of 5 inches A scientist is testing the effectiveness of Drug X on cancer. She gives a small amount of the drug to mice that have cancer. She gives each mouse a different amount from 1 to 10 grams, and then measures the size of the tumor in each mouse before the drugs and two weeks after the drugs. She gives one of the mice sugar instead of Drug X. What is her control in this experiment? Natasha wants to treat her friends to the movies. The tickets cost $11 each and she also wants to spend $21 worth of popcorn and candy for her friends to share. She can spend under $131. Write an inequality to represent how many people she can treat to the movies Convert -1.2 repeating as a mixed number Can you please answer this? If a pilot is converting standard time to UTC time and is given the time 1730 UTC, what would EST be? How could you beat restate this question to encourage yourself to ask questions rather than simply collect information Help please been stuck on this for a week.