James has $32 and earns $10 per week for his allowance. What is the initial value for the scenario described?
A.10
B.32
C.42
D.320

Answers

Answer 1
Your answer should be B.
Answer 2

This answer is confirmed!


Related Questions

Jorge and Mary are both filling cups with fruit punch in preparation for a party. After 3 minutes, Jorge had 53 cups left to be filled, and after 5 minutes, he had 25 cups left to be filled. Mary’s progress is shown in the table of values below. Assuming that both Jorge and Mary are filling cups at a constant rate, which statement is correct?


Mary’s Cup-Filling Progress
Time (minutes)

0.5

1

1.5

2

2.5
Cups Remaining

99

81

63

45

27

Jorge is filling 14 cups per minute, which is faster than Mary.
Jorge is filling 28 cups per minute, which is faster than Mary.
Mary is filling 18 cups per minute, which is faster than Jorge.
Mary is filling 36 cups per minute, which is faster than Jorge.

Answers

Answer:

Mary is filling 36 cups per minute, which is faster than Jorge.

Step-by-step explanation:

Lets get Jorge's time :

As the rate is constant, we can find the slope to know the number of cups he is filling per minute.

Slope is found using: [tex]\frac{y2-y1}{x2-x1}[/tex]

= [tex]\frac{53-25}{5-3}[/tex]

= [tex]\frac{28}{2}=14[/tex]

From the table lets get Mary's time:

[tex]\frac{99-81}{1-0.5}[/tex]

= [tex]\frac{18}{0.5}=36[/tex]

Another data: [tex]\frac{63-45}{2-1.5}[/tex]

=  [tex]\frac{18}{0.5}=36[/tex]

Therefore, we can see that Mary is filling 36 cups in a minute and Jorge is filling 14 cups.

Hence, the correct answer is : Mary is filling 36 cups per minute, which is faster than Jorge.

Answer:

Mary is filling 36 cups per minute, which is faster than Jorge.

Step-by-step explanation:

1.66666666667 rounded to the tenth

Answers

Hey there! :D

The tenth place is where the first 6 is, so:

1.666666666667= 

1.7 because 6>5

I hope this helps!
~kaikers
To round a number to the tenth, any number greater than or equal to 5 will round up and anything less than 5 round down.
So, the number after the tenths place is a 6 which is greater than 5, so you would round up.
So, your answer would be 1.7

Noah was asked to find the median of the following numbers.


115, 109, 117, 136, 127, 131


Noah’s work is shown below.


109, 115, 117, 127, 131, 136


mc006-1.jpg


What error, if any, did Noah make?


A)He forgot to put the numbers in order first.


B)He crossed off the high/low number pairs incorrectly.


C)He left out a number when putting the numbers in order.


D)He did not make any error.

Answers

D. Noah didn't make any error.

1. he makes the numbers in order
2. he didn't cross off the high/low number pairs incorrectly
3. he didn't leave out a number

Let a(−9, 4) and b(3, −12) be points in the plane. (a) find the slope of the line that contains a and
b.

Answers

the answer would be m= -4/3

Slope of the line = -4/3

What is slope?

The slope of a line is defined as the change in y coordinate with respect to the change in x coordinate of that line. The net change in y coordinate is Δy, while the net change in the x coordinate is Δx. So the change in y coordinate with respect to the change in x coordinate can be written as,

The slope of line is the measure of steepness or the direction of line the coordinate plane.

m = Δy/Δx

where, m is the slope

Given,

A = (-9,4)

B = (3, -12)

Slope of line AB = (y - y')/(x-x')

                           = -12-4/3 - -9

                           = -16/12

Slope of line AB = -4/3

Hence, -4/3 is the slope of the line.

Learn more about slope of the line here:

https://brainly.com/question/3605446

#SPJ2

In two or more complete sentences, define the key features of the graph below and explain how to write its equation using function notation.

Answers

The graph is a function of absolute value.
 This means that for each value of f (x) there are two possible values of x.
 The absolute value function is:
 f (x) = lxl
 y = f (x) - 2 shifts the graph 2 units down.
 y = f (x + 3) moves the graph 3 units to the right.
 Finally:
 The function that best fits this graph is:
 f (x) = l-x + 3l-2

Answer:

The function notation of the graph is f(x) = |x-3| - 2

Step-by-step explanation:

From the graph it is evident that it is the graph of the absolute value of the function i.e. f(x) = |x| and we know that 'Translation' is a transformation that shifts the graph of a function in any direction.

Now, as we can see that the graph is shifted towards the right of the y-axis at point x=3, this means that it is translated by 3 units to the right of y-axis.

Therefore, the function becomes f(x) = |x-3|.

Furthermore, it is also shifted downwards at the point x= -2, this means that it is translated by 2 units downward from the x-axis.

Hence, the new function is f(x) = |x-3| - 2.

It can also be seen from the figure below that the graph of above f(x) is same as that of the provided image.

CD←→ is tangent to circle A at point B.

What is the measure of ∠ABD?




45º

60º

90º

180º

Answers

I just took my quiz and the correct answer is 90.

The measure [tex]\angle ABD[/tex] is C. [tex]90^{\circ}[/tex]

Given,

CD is tangent to the circle A at point B.

We have to find the measure of [tex]\angle[/tex][tex]ABD[/tex].

Tangent:

We know that,

Tangent to a circle is the line that touches the circle at only one point. There can be only one tangent on a point to circle. The Tangent makes an angle of [tex]90^{\circ}[/tex] with the radius of the circle at the point of contact.

Hence [tex]\angle ABD[/tex] is [tex]90^{\circ}[/tex].The correct option is C. [tex]90^{\circ}[/tex]

For more details about tangent, follow the link:

https://brainly.com/question/1503247

If sec a = 5/4 and a is an angle in quadrant iv find the value of cos a

Answers

we know that
sec a = 5/4
sec(a)=1/cos(a)
then 
cos (a)=1/sec(a)
cos (a)=1/(5/4)=4/5---> is positive because the function cos is positive in IV quadrant

the answer is cos(a)=4/5

Each of two trapezoidal prisms has a volume of 120 cubic centimeters. the prisms have no dimensions in common. give possible dimensions for each prism.

Answers

To answer this question you need to know how to find the volume of a trapezoidal prism. You multiply the area of a trapezoid by the height of the prism. To begin answering this, you can start with 2 different factors of 120. I chose 4 and 6.

If the height of one trapezoid is 4, the area would need to be 30. I wrote out the formula for area of a trapezoid (h (b1+b2)/2) and solved for 30. I multiplied both sides by 2 and saw that I needed a 60 from the sun of my 2 bases and the height of the trapezoid base. I used 2 for the height and 20 and 10 as the 2 bases.

For the second trapezoid, I used 6 as the height of the prism. This left me with 20 as the area. I used the same formula above and found that I needed to get 40. I used 5 as the height of the trapezoid and 1 and 7 as the two base lengths. Hope this helps!!

OUCH MY BRAIN IS HURTING AFTER TRYING TO SOLVE THIS QUESTION

Answers

300° CCW is the same as 60° CW. N will show up where H is now.

The 3rd selection is appropriate.

What is the value of x in the triangle?

Answers

We can use SOH CAH TOA to solve this :)

We’re going to use Cosine because the angle and sides given are Adjacent and Hypotenuse- which goes with the CAH part of SOH CAH TOA.

Cos(18) = x/25

Multiply both sides by 25

25cos(18) = X = 23.776

So x = 23.776 cm

I hope this Helps!
You would multiply the sides of the triange by 25.

And that gives you...  x = 23.776 cm

Express 8.12 as a mixed number.

Answers

8.12 as a mixed number is 203/25
Hey there!

Let's keep our goal in mind. A mixed number is a whole number and a fraction together. SInce we already have our whole number, 8, we need to make .12 a fraction.

If we look at .12, we see that that 12 is in the hundredths place. When you go to whole numbers, you have tens, hundreds, and so on. When you go to fractions, it goes tenths, hundredths and so on.

That means that since the 12 is in the hundredths, it's 12 hundredths, or 12/100. 

That means our mixed number is 8 12/100


Hope this helps

PLEASE HELP ASAP!!!
The first figure is dilated to form the second figure.

Which statement is true?

The scale factor is 0.8.
The scale factor is 1.25.
The scale factor is 2.0.
The scale factor is 18.0.

Answers

The scale factor is 1.25. 

10/8=1.25.

Answer: The answer is (a) The scale factor is 1.25.

Step-by-step explanation:  We are given two figures in the question, where the second one is dilated from the first one. We are to find the scale factor here.

One side of the dilated figure is of length 10 inch and the original figure has a side of length 8 units.

Therefore, the scale factor is given by

[tex]S.F.=\dfrac{10}{8}=1.25.[/tex]

Therefore, the scale factor is 1.25 and (B) is the correct option.

Perpendicular lines AB and CD intersect at point E. If m∠AED = x + 20, what is the value of x?
A.) 160
B.) 110
C.) 90
D.) 70

Answers

the answer is D.) 70 because if the lines are perpendicular the the angle would have to equal 90* so 90=x+20

Nina has $5 bills and $10 bills in her wallet. she has a total of 7 bills with a value of $55. how many of each type of bill does she have? show all work to justify your answer.

Answers

the answer is 3 fives and 4 tens

When a standard six sided die is rolled, what is the probability of getting a 9?

Answers

It's not possible a standard die only has the numbers 1-6

Anybody have a real answer for the question?

Answers

based on the "tangent-chord angle theorem", since the arc made by that chord is 168°, the angle enclosed by both the chord and the arc is half that, namely ∡x is 168/2.

now, notice, ∡y and ∡x are "linear angles", therefore

x + y = 180

y = 180 - x.

Write a two-column proof
it says Given: the top number is 2x+6 and the bottom number is 96. Prove: x = 45
It's a little blurry sorry. Please help me I have never understood two-column proofs and they don't make sense to me
Thank you

Answers

Hello!

You just have to solve the equation and justify each step along the way:

2x + 6, 96       Given
96 = 2x + 6     Vertical angles are congruent
90 = 2x           Subtraction Property of Equality
45 = x             Division Property of Equality

And that's all there is to it! I hope this helps you. (:

What is the future value of $1,600 in 17 years assuming an interest rate of 10 percent compounded semiannually?

Answers

Let
F--------------------> future value
P--------------------> present value 
r --------------------> interest rate per year
m ------------------ > number of compounding periods per year
t -------------------->  time in years. 
we know that
P=$1,600
t=17 years
m=2
r=10%------> 0.10

F=P(1+i)^n
where
i=r/m   ---------> 0.10/2=0.05
and
n=m*t------------> 2*17=34

F=1600*(1+0.05)^34=8405.36

the answer is $8405.36

Find the retail price of a backpack that has a wholesale price of $25 and is marked up 40%. Multiply $25 and 40% in decimal form to find the markup amount. 25(0.40) = $10 Add the wholesale price to the markup amount. What is the selling price? $10 $15 $35 $65

Answers

$35 is your answer, just do 25(0.40) which gives you 10 so add that to your original 25+10=35

Answer:

35   35          35             35

Step-by-step explanation:

it 35

find the value of x

Answers

84 degrees is the answer

First, lets assign label to the interior angles of the triangle.
Since angle 130° and angle A are on the same straight line, they are supplementary angles; therefore:
[tex]130+A=180[/tex]
[tex]A=180-130[/tex]
[tex]A=50[/tex]

Next, angle B and angle 134° are also on the same straight line, so they are supplementary as well, which means:
[tex]B+134=180[/tex]
[tex]B=180-134[/tex]
[tex]B=46[/tex]

Now, to find angle C remember that the sum of the interior angles of a triangle is 180°; therefore:
[tex]A+B+C=180[/tex]
[tex]50+46+C=180[/tex]
[tex]C=180-50-46[/tex]
[tex]C=84[/tex]

Finally, we also know that angle [tex]x[/tex] and angle C are on the same line, so they are supplementary angles just like before; therefore:
[tex]x+C=180[/tex]
[tex]x+84=180[/tex]
[tex]x=180-84[/tex]
[tex]x=96[/tex]

We can conclude that the measure of our angle [tex]x[/tex] is 96°.

6 cards are drawn from a standard deck without replacement how many different 6 card hands are possible if the drawing is done without replacement

Answers

=52*51*50*49*48*47 divided by 1*2*3*4*5*6

14658134400 / 720

20358520

An initial deposit of $5325 was made into an account that compounds interest semi-annually. No other deposits were made. At the end of 13 years, the balance in the account had doubled. Find the interest rate on this account.

Answers

Answer: R = 5.404% per year

Formula: Where: r = n[(A/P)^1/nt - 1]

This is the first part of a three-part problem. express $18\sqrt 8$ in the form $a\sqrt b$, where $a$ and $b$ are integers and $b$ is as small as possible.

Answers

Answer:

[tex]18\sqrt{8}=36\sqrt{2}[/tex]

Where a=36 and b=2 with b is small.

Step-by-step explanation:

Given problem [tex]18\sqrt{8}[/tex]

We have to write the given problem in form of [tex]a\sqrt{b}[/tex], where a and b are integers and b is as small as possible.

Consider the given problem [tex]18\sqrt{8}[/tex]

8 can be written in factored form as 2 × 2 × 2

Substitute, in given problem, we have

[tex]18\sqrt{8}=18\sqrt{2 \times 2\times 2}[/tex]

This can be written as,

[tex]18\sqrt{2 \times 2\times 2}=18(\sqrt{4}\sqrt{2})[/tex]

We know [tex]\sqrt{4}=2[/tex] , thus,

[tex]18(\sqrt{4}\sqrt{2})=18\cdot 2\sqrt{2}=36\sqrt{2}[/tex]

Thus,[tex]18\sqrt{8}=36\sqrt{2}[/tex]

Where a=36 and b=2 with b is small.

A species of catfish, can generate up to 350 voltsWrite an inequality to represent the amount of electricity generated by the catfish

Answers

catfish≤350 because the catfish cannot generate more than 350 volts.

The inequality to represent the amount of electricity generated by the catfish, which can generate up to 350 volts, is:  [tex]\[ 0 \leq E \leq 350 \][/tex] where [tex]\( E[/tex]  represents the amount of electricity in volts.

This inequality indicates that the electricity generated by the catfish is at least 0 volts and at most 350 volts. The lower bound of 0 volts is included because the catfish cannot generate negative voltage, and the upper bound of 350 volts is the maximum it can generate.

If f(x)=x+7 and g(x)=1/x-13 what is the domain of (f*g)(x)
A. {x| x = 6}
B. {x| x = -6}
C. {x| x = -13}
D. {x| x = 13}

Answers

I think the answer is b

Answer:

The Answer is B

Step-by-step explanation:

If you do the math, this would be the conclusion you would come up with.

A theater charges $25 for adults and $15 for children. When the price of a child's ticket increases to $18 next year,the cost for a dance club to attend the theater will increase from $450 to $480. Write and solve a system of equations to find how many adults are in the dance club.

Answers

Given:
tickets for adults - 25
tickets for kids - 15
initial cost - 450
increase in tickets for kids to - 18
cost after increase - 480

let x be number of adults and y be number of kids

25x + 15y = 450
25x + 18y = 480

subtraction:

25x + 15y = 450
-25x - 18y = -480
 0      - 3y = - 30
         y = -30/-3
         y = 10

There are 10 kids.

25x + 15y = 450
25x + 15(10) = 450
25x + 150 = 450
25x = 450 - 150
25x = 300
x = 300/25
x = 12

There are 12 adults.

All in all there are 12 adults and 10 kids.

to check:
25x + 15y = 450
25(12) + 15(10) = 450
300 + 150 = 450
450 = 450

25x + 18y = 480
25(12) + 18(10) = 480
300 + 180 = 480
480 = 480

helppppppppppppppppppppppppppppppp

Answers

You must do in this case is composition of both functions:
 a (x) = 3x + 1
 b (x) = root (x-4)
 Making the composition
 b (a (x)) = root ((3x + 1) -4)
 Rewriting:
 b (a (x)) = root (3x-3)
 b (a (x)) = root (3 (x-1))
 Answer:
 The domain of the function is:
 x> = 1
 Equivalently:
 [1, inf)

What is the value of n?

Enter your answer in the box.

n =

Answers

If two chords intersect each other inside a circle, the products of their segments are equal.

18(n+1) = 9(n+7)
18n + 18 = 9n + 63
18n - 9n = 63 - 18
9n = 45
n = 45/9
n = 5

Answer:

n = 5

Step-by-step explanation:

This problem follows the theorem "If two chords intersect each other inside a circle, the products of their segments are equal."

To follow this theorem, you must multiply both segments of the chord with each other.

Do it to both chords.

The two chords are equal to each other. It should look like:

18*(n+1) = 9*(n+7)

[distributive property]

18n + 18 = 9n + 63

9n = 45

n = 5

how are solutions, roots, and x-intercepts of a quadratic related?

Answers

A quadratic equation has the form ax2+bx+c=0 and is represented by a parabola (graphically). The solution of a quadratic equation is based on find the roots, which are the x-intercepts of its graph. When it has double root, the vertex of the parabola is the intercept with the x axis. If the root is imaginary (the discriminant of a quadratic function is negative), it does not intercept the x axis. So, a quadratic equation can has: one root, two roots, or zero roots.

 You can solve a quadratic equation by factoring by applying a equation called "Quadratic formula", which is usually used when you can't factorize it. This formula is:

 x=(-b±√(b^2-4ac))/2a

Answer:

Step-by-step explanation:

The quadratic equation [tex]ax^2+bx+c=0[/tex]

The roots of quadratic equation is defined as that value when we substitute in the quadratic equation then we get zero.

Solution of quadratic equation is defined as that value of roots which substitute in the equation then we get zero.

x-intercept of the quadratic equation is defined as that  real  value of x on the x- axis  when we substitute in the equation then the value of equation becomes zero.

From the above definitions we can see that roots of quadratic equation can be imaginary or real but x- intercept value of equation is always a real value.

Solution is also called the value of roots but x- intercept is equal to roots when the value of roots is real.

Now, we can says that roots and solutions of quadratic equation are same when values of roots are real. But when the roots are imaginary then we can not find x- intercept in cartesian   coordinate plane .

A rectangular solid is dilated by a factor of 0.5.

How many times larger is the volume of the resulting solid than the volume of the original solid?



Enter your answer as a decimal in the box.

Answers

Answer:

0.125 took test

Step-by-step explanation:

Volume of the resultant solid will be 0.125 times of the original solid.

Volume scale factor of a rectangular solid:If the sides of a rectangle solid is dilated by a scale factor 'k',

        Volume of the solid will be given by the expression,

        Volume = (k)³(Volume of the original solid)

If a rectangular solid is dilated by a scale factor 'k' = 0.5

Volume of the resultant solid = (0.5)³(Volume of the original solid)

                                                = 0.125(Volume of the original solid)

       Therefore, volume of the resultant solid will be 0.125 times of the original solid.

Learn more about the dilation of a rectangular solid here,

https://brainly.com/question/2919998?referrer=searchResults

Other Questions
Quadrilateral ABCD is inscribed in a circle. Whats the measure of angle B Find the constant of variation k for the inverse variation. Then write an equation for the inverse variation. Y=4.5 when x = 3 The work function () for a metal is 7.4010-19 j. what is the longest wavelength of electromagnetic radiation that can eject an electron from the surface of a piece of the metal The size of a laptop monitor is usually measured along the diagonal. A rectangular monitor is 12 inches long and 7 inches tall. What is the length of the diagonal of this monitor, to the nearest tenth of an inch? Enter your answer, as a decimal, in the box. Graph the following inequality and then select the correct graph below.y x - 2 How was Uranus different from most other planets PLEASE HELP8.04b1. Eliminate the parameter.x = 5t, y = t + 8 A) y = 5x + 8B) y = x divided by five + 8C) y = 5x - 8D) y = x divided by five - 82. Eliminate the parameter.x = square root of x , y = 3t + 7 A) y = 3x2 + 7B) y = 3 square root of x + 7, x 0C) y = 3 square root of x - 7, x 0D) y = 3x2 - 73. Eliminate the parameter.x = t2 + 2, y = t2 - 4 A) y = x - 6, x 1B) y = x + 6, x 1C) y = x2 - 6, x 1D) y = x2 + 6, x 14. Eliminate the parameter.x = 4 cos t, y = 4 sin t In part two of Trifles,how does Glaspell use irony to illustrate the idea that women were often seen as less capable than men in the early twentieth century? Which lines in this excerpt from John Miltons Paradise Lost support the claim that Satan perceived women as being inferior to men?The image of their glorious Maker shon, Truth, Wisdome, Sanctitude severe and pure, Severe, but in true filial freedom plac't; Whence true autoritie in men; though both Not equal, as their sex not equal seemd;For contemplation hee and valour formd,For softness shee and sweet attractive Grace,Hee for God only, shee for God in him: Eugene knows the circumference of a circle is 125.6 meters. Does he have enough information to find the area? Heat may build up in the mantle as:1.weight of overlaying rock increases2.pressure of overlaying rock increases3.chemical reactions take place4.all of the above Scientist classify plants based on their height and how they reproduce The decomposition of dinitrogen tetraoxide into nitrogen gas and oxygen gas is shown by which balanced chemical equation? Which group of black soldiers served during peacetime, after the Civil War? A.Freedom Fighters B.54th Massachusetts Regiment C.Black Rangers D.Buffalo Soldiers When methanol, ch3oh, is burned in the presence of oxygen gas, o2, a large amount of heat energy is released. for this reason, it is often used as a fuel in high performance racing cars. the combustion of methanol has the balanced, thermochemical equation ch3oh(g)+32o2(g)co2(g)+2h2o(l)h=764 kj how much methanol, in grams, must be burned to produce 541 kj of heat? Find the range of (x) = 2x 5 for the domain {2, 1, 1, 2}. In Your Brain on Blue what is the author saying impacts your performance in the classroom or on the sports field? A.Colors B.Teachers C.Uniforms D.Work ethicWILL give BRAINLIEST!!!!!!!!!!!!!!!!!!!!!! please HELP me!!!!!!!!!!!!!!!!!!! the cultural revolution primarily controlled information in order to? A.cause social change B.keep the government in power C.encourage literacy levels D.help economic growth What two things did the Soviet Union do that helped bring about the Sino-Soviet split?Russia denied financial aid to China when its Great Leap Forward failed.Russia kept its treaty with India even though India was at war with China.Russia refused to help Red China as it developed a nuclear weapons program.Russia would not help China back the North Vietnamese attempt to unify Vietnam. What is a locally stored url, or the address of a file or internet page saved as a shortcut?