Mathematics High School

Which of the following is a polynomial function in factored form with zeros at 0, –3, and 4?

A. f(x) = x^3 + x^2 – 12x
B. f(x) = x(x – 3)(x + 4)
C. f(x) = x^3 – x^2 – 12x
D. f(x) = x(x + 3)(x – 4)

Answers

Answer 1
The answer is D.

Explanation:
You can find the zeroes of a polynomial function in factored form by setting each factor equal to zero and solve for [tex]x[/tex].

The polynomial function of answer A is not even factored, so we can rule that one out.

Lets set each one of the factors of answer B equal to zero, solve for [tex]x[/tex] and see what happens:
- [tex]x=0[/tex]
- [tex]x-3=0[/tex]
  [tex]x=3[/tex]
- [tex]x+4=0[/tex]
  [tex]x=-4[/tex]
As you can see, our zeroes are 0,3, and -4, so this is not the correct answer either.

The polynomial function of answer C is not even factored, so we can rule that one out as well.

Lets apply what we just learned to the factored polynomial of answer D:
- [tex]x=0[/tex]
- [tex]x+3=0[/tex]
  [tex]x=-3[/tex]
- [tex]x-4=0[/tex]
  [tex]x=4[/tex]
This time our zeroes are, 0, -3, and 4; therefore we can conclude that D is the correct answer.

Related Questions

Orlando bought a new couch for 2,736, using the furniture store's finance plan. He will pay $114 a month for 24 months. Which equation can Orlando use to find out how much money he still owes after each month of the plan?

Answers

x: months

y: debts after each month

y = $2736 - $114 * x

I hope this is self-explanatory.

Answer:

[tex]y = 2736 - 114x[/tex]

Step-by-step explanation:

It is given that the cost of the couch was $2,736. Orlando bought that couch using furniture store's finance plan. The plan says that he is supposed to pay $114 per month for a period of 24 months.

we are asked to determine the equation which can determine the total amount still due on orlando after x number of months.

Let the total number of month we are calculating = x

Payment per month = $114

Hence payment made in x months = $114x

Hence payment still owned by Orlando = $2736-$114x

Above equation gives us the dues on Orlando

create the equation of a quadratic function with a vertex of (5,6) and a y-intercept of -69

Answers

if the y-intercept is at -69, meaning the point is (0, -69), thus x = 0, y = -69

[tex]\bf ~~~~~~\textit{parabola vertex form} \\\\ \begin{array}{llll} \boxed{y=a(x- h)^2+ k}\\\\ x=a(y- k)^2+ h \end{array} \qquad\qquad vertex~~(\stackrel{}{ h},\stackrel{}{ k})\\\\ -------------------------------\\\\ vertex~(5,6)\quad \begin{cases} x=5\\ y=6 \end{cases}\implies y=a(x-5)^2+6 \\\\\\ \textit{we also know that } \begin{cases} x=0\\ y=-69 \end{cases}\implies -69=a(0-5)^2+6 \\\\\\ -75=25a\implies \cfrac{-75}{25}=a\implies a=-3 \\\\\\ therefore\qquad \boxed{y=-3(x-5)^2+6}[/tex]

The next term of the arithmetic sequence 39,60,81,102,123.....is

Answers

it is 144 just add 21
the next number is the previous number plus 21
 so the next number is 123 +21 = 144

Samantha has 3 times as many baseball cards as mark. mark has 12 baseball cards. write an equation that shows how many cards samantha has.

Answers

s= 3 x 12
hope this helped :)

A basketball player scored 2222 times during one game. hehe scored a total of 3030 ​points, two for each​ two-point shot and one for each free throw. how many​ two-point shots did hehe ​make

Answers

He scored 8 more points than shots, so must have made 8 2-point shots.

Patrick is constructing the circumscribed circle for △RST.



Which construction could be his first step?


Construct the perpendicular bisector of ST¯¯¯¯¯ .

Construct the angle bisector of ∠T .

Construct a copy of ∠S that is adjacent to ∠R .

Construct the angle bisector of ∠R .

Answers

To me, the answer would be the option A : 
Construct the perpendicular bisector of ST¯¯¯¯¯ .

Hope this helps !

Photon

A jug of juice has 7 cups of pineapple juice and 3 cups of orange juice. write the ratio of number of cups of pineapple juice to total number of cups of juice *

Answers

this ratio  would be 7:10

The radius of a circle is 10 feet. What is the angle measure of an arc 4​ feet long?

Answers

The angle measure is 22.9183 deg

Hope this helps u

Heidi's hair was 2/3 of a meter long. her grandfather cut off 1/6 of a meter of her hair. how long is heidi's hair now?

Answers

The answer to this is 1/2 of a meter long. 

gina is traveling to the beach 20 miles away from her house.On Ginas map her house and the beach are 4 inches apart what is the scale used for Ginas map

Answers

The scale is 5. because you can divide 2o by 4 to get that answer.

Gina is travelling to the beach 20 miles away from her house.

On Ginas map her house and the beach are 4 inches apart

That is a distance of 20 miles is represented by the Ginas map in 4 inches

Therefore, on Ginas map one inch will be = 20/4 miles = 5 miles

So, the scale used for Gina's map is 1 inch = 5 miles

Hope this helps..!!

Thank you :)

helppppppppppppppppppppppppppppppppppppppppppppppppppppppppp

Answers

What you must do in this case is to find the roots of the polynomial.
 We have then:
 x ^ 2 + 20x + 100 = 36
 Rewriting:
 x ^ 2 + 20x + 64 = 0
 The values of the roots are:
 x1 = -4
 x2 = -16
 Remember that the values of the roots are what make the polinome zero
 Answer:
 x1 = -4
 x2 = -16

A building that is 115 feet tall casts a shadow that is 190 feet long. determine the angle at which the rays of the sun hit the ground to the nearest degree.

Answers

The angle at which the rays of the sun hit the ground is equivalent to {β} = 31.22°.

What is the meaning of the angle of depression?

Its an angle that is formed with the horizontal line if the line of sight is downward from the horizontal line.

Given is that a building that is 115 feet tall casts a shadow that is 190 feet long

Assume that the angle of elevation or the angle at which the rays of the sun hit the ground is equivalent to {β}. Then, with respect to the question, we can write -

tan{β} = (height of building)/(length of shadow)

tan{β} = (115/190)

tan{β} = 0.606

{β} = tan⁻¹(0.606)

{β} = 31.22°

Therefore, the angle at which the rays of the sun hit the ground is equivalent to {β} = 31.22°.

To solve more questions on functions, expressions and polynomials, visit the link below -

brainly.com/question/17421223

#SPJ5

a triangular plot of land has boundary lines 45 meters, 60 meters, and 70 meters long. the 60 meter boundary line runs north-south. Is there a property for the boundary line that runs east-west

Answers

Final answer:

No, there is no property for the boundary line that runs east-west.

Explanation:

No, there is no property for the boundary line that runs east-west. This is because if we have a triangle with side lengths 45 meters, 60 meters, and 70 meters, and the 60 meter side runs north-south, then the other two sides must be at an angle to the north-south line. It is not possible for one of the sides to be parallel to the north-south line (east-west) because that would create a rectangle rather than a triangle.

which method is most efficient in solving a system of linear equations when the two equation have x-values with opposite coefficient values


A. GUESS AND CHECK
B. GRAPHING
C. SUBSTITUTION
D. ELIMINATION

Answers

Answer: D) Elimination

For example, consider the system of equations below
2x+3y = 9
-2x+6y = 18
Adding straight down will have the x terms (2x and -2x) add to 0x which is just 0. The x terms will go away. In this case, the 2 and -2 are opposite coefficient values for the x terms.

Use the quadratic function to predict f(x) if x equals 2. f(x) = −3x2 + 180x − 285

Answers

f (x) = -3x2 + 180x - 285
 For this case, the first thing to do is replace the value of x = 2 in the given function to know the result.
 We have to replace:
 f (2) = -3 * (2) ^ 2 + 180 * (2) - 285
 f (2) = 63
 Answer: 
 the value of pa for x = 2 is:
 f (2) = 63

What is the slope of a line perpendicular to the line y=3/4x+1

Answers

Answer: -4/3

The slope of the given line is 3/4. It's simply the value in front of the x. To be more specific, the equation given to us is in the form y = mx+b where m = 3/4 is the slope.

Flip the fraction and then the sign
flip the fraction: 3/4 ----> 4/3
Then flip the sign: 4/3 ----> -4/3
In other words, we take the negative reciprocal

Notice how the original slope 3/4 and the perpendicular slope -4/3 multiply to -1

Josie had a choice of 3 breads, 4 choices of meat, and 4 choices of cheeses to make a sandwich.
How many different sandwiches can she make?

24

36

48

60

Answers

3*4*4=48
she can make 48 different sandwiches

Answer:

The answer is 48

Step-by-step explanation:

For every different sandwich, she needs to choose one breat, one meat and one cheese.

For each choice of bread, there are 4 choices of meat and 4 choices of cheese. Also, for each meat, there are four choices of cheese. It means that for each bread there are 4(choices of meat)*4(choices of cheeses) = 16 possible combinations.

There are also 3 choices of breads. For each bread, there are 16 possible combinations. So, in all, there are 3*16 = 48 possible combinations.

The area of a parallelogram is 400m2 the base is 25m find the length of the height

Answers

HEIGHT=6400 DUE TO THE FACT THAT U ARE MULTIPLYING 400 TWICE, THEN DIVIDING BY 25.

*URGENT ALGEBRA 2* Anyone know these answers? Choices provided. Will award brainliest.

Answers

These are six questions and six answers

Question 1. Translate y = 2/x 3 units to the left and 4 units up.

Answer:
      
          2
y =  -------- + 4 <------- the fourth option
      (x + 3)

Explanation:

1) Given function:

y = f(x) = 2 / x

2) Translatiing 3 units to the left is making f(x + 3), so that implies:

y = 2 / (x + 3)

3) Translating 4 units up is making f(x + 3) + 4, so that implies:
      
          2
y =  -------- + 4
      (x + 3)

Which is the fourth option.


Question 2.  simplify

t^2 + 2t - 24
----------------
  t^2 - 36

Answer: fourth option

t - 4
------ , with t ≠ - 6 and t ≠ 6.
t + 6

Explanation:

1) Factor the numerator:

t^2 + 2t - 24 = (t + 6) (t - 4)

2) Factor the denominator:

t^2 - 36 = (t + 6) (t - 6)

3) Rewrite the fraction:

 (t + 6) (t - 4)
-------------------
(t + 6) (t - 6)

4) Cancel the factor t + 6 which is in both numerator and denominator, which you can do only y t + 6 ≠ 0 => t ≠ -6.

 t - 4
-------
 t - 6

That is the simplified expression, with the restrictions that t ≠ - 6  and t ≠ 6, because the denominator cannot be 0.

Question 3. Find the product of:

x^2 + 7x + 10     x^2 - 3x - 18
------------------ * ---------------------
      x + 3                x^2 + x - 2


Answer: the fhird option:


(x + 5) (x - 6)
------------------
        x - 1

with x ≠ -3, x ≠ - 2, and x ≠ 1.

Explanation:

1) Factor x^2 + 7x + 10

x^2 + 7x + 10 = (x + 5) (x + 2)

2) Factor x^2 - 3x - 18

x^2 - 3x - 18 = (x - 6)(x + 3)

3) Factor x^2 + x - 2

x^2 + x - 2 = (x + 2) (x - 1)

4) Rewrite the given expression using the factors:

  (x + 5) (x + 2) (x - 6) (x + 3)
--------------------------------------
     (x + 3) (x + 2) (x - 1)

5) Cancel the factors that appear on both the numerator and denominator:

 (x + 5) (x - 6)
------------------
        x - 1

The restrictions are those values of x that make any factor that is or was in the denominator: x ≠ -3, x ≠ - 2, and x ≠ 1.

Question 4. Simplify the complex fraction:

             n - 4
     ------------------
      n^2 - 2n - 15
--------------------------
             n + 1
          -----------
             n + 3

Answer: option 4.

       n - 4
------------------
(n - 5) ( n + 3)

Explanation

1) Factor n^2 - 2n - 15


n^2 - 2n - 15 = (n - 5)(n + 3)

2) rewrite the expression:

             n - 4
    ---------------------
      (n - 5) ( n + 3)
----------------------------
              n + 1
            ----------
              n + 3

3) Convert (n + 1) / (n + 3) into its reciprocal (n + 3) / (n + 1), and multiply instead of dividing.


             n - 4              n + 3
    ---------------------  * --------
      (n - 5) ( n + 3)      ( n + 1)

4) Cancel n + 3

       n - 4
------------------
(n - 5) ( n + 3)


That is the simplest form.

Question 5. Find the difference

Answer: second choice

 1 - n
--------
 n + 4

Explanation:


1) given:

n^2 + 3n + 2        2n
----------------- -   -------
n^2 + 6n + 8       n + 4

2) factor the two quadratic trinomials

n^2 + 3n + 2 = (n + 2) ( n + 1)

n^2 + 6n + 8 = (n + 4) (n + 2)

3) Rewrite the expression:

   (n + 2) (n + 1)          2n
-----------------------  -  -------
   (n + 4 ) (n + 2)       n + 4

4) cancel the factor n + 2

   n + 1          2n
-----------  -   --------
   n + 4         n + 4

5) subract the fractions. They have the same denominator.

  n + 1 - 2n           1 - n
--------------- =     ----------
    n + 4                n + 4

And that is the simples form.

Question 6.  Problem

Irina paints 1 room in 9 hours
Paulo paints 1 room in 8 hours

How long working together?

Answer:

x / 9 + x / 8 = 1, x ≈ 4.24 hours

Explanation:

1) In the time x, Irina will paint x / 9 parts of the room

2) Paulo will paint (in the same time) x / 8 parts of the same room

3) The total painted is 1 room.

So the equation is:

x / 9 + x / 8 = 1

4) The solution of that equation is:

[8x + 9x ] / (9*8) = 1

=> 8x + 9x = 72

=> 17x = 72

=> x = 72 / 17

=> x ≈ 4.24 hours

Each summer Primo Pizza and Pizza Supreme compete to see who has the larger summer profit. Let f ( x ) f(x) represent Primo Pizza's profit x x days after June 1. Let g ( x ) g(x) represent Pizza Supreme's profit x x days after June 1. Suppose Primo Pizza's profit each day is two times as large as the profit of Pizza Supreme. Express the function f f in terms of the function g
g.

Answers

For this case we have the following functions:
 f (x) = Primo Pizza's profit
 g (x) = Pizza Supreme's profit.
 According to the statement we have:
 "Primo Pizza's profit each day is two times as large as the profit of Pizza Supreme"
 Therefore, we can write one function in terms of the other in the following way:
 f (x) = 2g (x)
 Answer: 
 the function f in terms of the function g is:
 f (x) = 2g (x)
Final answer:

The profit of Primo Pizza is twice the profit of Pizza Supreme each day. Therefore, if g(x) represents the profit of Pizza Supreme x days after June 1, then f(x), representing Primo Pizza's profit, is given by f(x) = 2g(x). This means if Pizza Supreme's profit on a particular day is $500, Primo Pizza's profit on the same day is $1000.

Explanation:

In this problem, we are given that the profit of Primo Pizza (represented by the function f(x)) is two times larger than the profit of Pizza Supreme (represented by the function g(x)). This relationship between the two profits can be expressed as f(x) = 2 * g(x). So, if you know the profit of Pizza Supreme on a particular day (g(x)), you can determine the profit of Primo Pizza on that day by doubling the profit of Pizza Supreme.

For instance, if Pizza Supreme's profit 10 days after June 1st is $500 (so, g(10) = $500), then Primo Pizza's profit on the same day would be f(10) = 2 * g(10) = 2 * $500 = $1000. Thus, Primo Pizza is making twice the profit of Pizza Supreme each day.

Learn more about Functions here:

https://brainly.com/question/30721594

#SPJ3

A cylinder shaped drum is used to store used motor oil. The drum has a height of 3 ft and a radius of 1.5 ft. How many cubic feet of oil does the drum hold? Use 3.14 to approximate pi. Enter your answer as a decimal rounded to the nearest hundredth in the box.

Answers

The answer is 21.2 ft²
To do this we need to calculate the volume of the cylinder shaped drum.The volume (V) of the cylinder with height h and radius r is:V = π r² h
We have:π = 3.14r = 1.5 fth = 3 ft
Therefore:V = π r² hV = 3.14 * (1.5 ft)² * 3 ftV = 21.2 ft²
here you go

the gray is a sidewalk and the turquoise is grass. Both are squares. What is the area of the sidewalk?
A) 4 ft2
B) 36 ft2
C) 44 ft2
D) 48 ft2

Answers

D 48. I'm pretty sure that's it I'm sorry if I was late to answer your question. Tell me if it was right or wrong and what answer it was. It was my pleasure to help. :)

Answer:

C 44 ft2 i just took the test .

Step-by-step explanation:

The windows of a downtown office building are arranged so that each floor has six fewer windows than the floor below it. If the ground floor has 52 windows, how many total windows are on the first eight floors?

Answers

248 


windows on first floor = 52 

windows on 8th floor (52 - 6 * 7) = 10 

average windows = (52 + 10)/2 = 62/2 = 31 

8 floors * 31 average windows = 248.

Answer:

There are 248 windows on the first eight floors.

Step-by-step explanation:

As given:

The ground floor has 52 windows.

This question is based on arithmetic sequence:

a1 = 52

d = - 6 (each floor has six fewer windows than the floor below it)

[tex]a_n=a1+(n-1)d[/tex]

[tex]a_8 =a1+7d[/tex]

=> [tex]52+[7 \times (-6)][/tex]

=> [tex]52-42 =10[/tex]

We know:

[tex]S_n= n/2 \times (a1 +a _n)[/tex]

[tex]S_8 =8/2 \times(52+10)[/tex]

= 248

Therefore, there are 248 windows on the first eight floors.

The surface area of a box is 160. the length of the box is twice its width as well as 4 less than its height. how many units are in the height of the box? (the surface area of a box is the sum of the areas of all 6 of its rectangular faces.) aops

Answers

Width = n
Length = 2n
Height = 2n + 4
2 (n x 2n) = 4n^2
2 (n x (2n + 4)) = 4n^2 + 8n
2 (2n x (2n + 4)) = 8n^2 + 16n

4n^2 + 4n^2 + 8n + 8n^2 + 16n = 160
16n^2 + 24n = 160
(Divide everything by 8)
2n^2 + 3n = 20
2n^2 + 3n - 20 = 0
(2n - 5)(n + 4) = 0

n = 2.5 Or n = -4

However n can not be less than 0

So n = 2.5
Height =2n +4
=2(2.5) +4
=5+4
=9

Final Answer:

The height of the box is 9 units.

Explanation:

Let's denote the width of the box as w, the length as l, and the height as h. According to the problem, we have the following relationships:
l = 2w (the length is twice the width) and
l = h - 4 (the length is also 4 less than the height).

The surface area SA of a rectangular box is calculated by the formula:
SA = 2lw + 2lh + 2wh.

Given that the surface area is 160, we set up our equation:
160 = 2lw + 2lh + 2wh.

Now let's substitute the relations l = 2w and l = h - 4 into the surface area equation:
Since l = 2w, 160 = 2(2w)w + 2(2w)h + 2wh.

Simplifying the equation, we have:
160 = 4w² + 4wh + 2wh
160 = 4w² + 6wh

Now we use the fact that l = h - 4 to substitute for h:
h = l + 4
h = 2w + 4

Now substitute h back into the surface area equation:
160 = 4w² + 6w(2w + 4) ,

Expand the terms:
160 = 4w² + 12w^2 + 24w,

Combine like terms:
160 = 16w² + 24w

Now, we must solve for w. Let's move all terms to one side to solve the quadratic equation:
16w² + 24w - 160 = 0

Divide all terms by 8 to simplify:
2w² + 3w - 20 = 0

We can now attempt to factor the quadratic equation:
(2w - 5)(w + 4) = 0

This gives us two solutions:
2w - 5 = 0 or  w + 4 = 0

Solving the first equation for w:
2w = 5,[tex]\( w = \frac{5}{2} \)[/tex]

w = 5/2
We can disregard the second solution w + 4 = 0 for w, as it gives us a negative width, which isn't possible for a box.

Now that we have w, we can find h.
Using our earlier substitute for h:
h = 2w + 4 ,
[tex]h = 2 \cdot \frac{5}{2} + 4[/tex] ,
h = 5 + 4 ,
h = 9 .
Thus, the height of the box is 9 units.

Which of the following is not a method used to prove triangles congruent?

A) AAS Theorem
B) SSA Postulate
C) SAS Postulate
D) ASA Postulate

Answers

I'm pretty sure SSA postulate doesn't exist 

Answer:

B) SSA Postulate

Step-by-step explanation:

Two triangles are congruent if they are of the same shape and size.

Two triangles can be proved congruent by AAS ,SAS ,ASA ,SSS ,HL postulates.

Two triangles are congruent if two angles and one side of both the triangles are congruent that is AAS and ASA postulates.(option A and D)

The triangles can be congruent by SAS that is if two sides and included angle of two triangles are congruent then the triangles are congruent .(Optionc)

Option B that is SSA is not a congruence postulate.

The diameter of your bicycle wheel is 25 inches. How far will you move in two turns of your wheel? Use 3.14 for π.
A) about 39 inches
B) about 78 inches
C) about 157 inches
D) about 314 inches

Answers


[tex]circumference \: = 2\pi \: r [/tex]
diameter = 25 inches
radius = 25/2
= 12.5 inches

= 2(3.14)(12.5)
= 78.5 inches ( for a turn )

Two turns = 78.5 inches X 2
= 157 inches

C.

Answer: D) About 314 inches

Step-by-step explanation:

Since, the radius of the wheel = 25 inches

Also, the angle in one turns of the wheel [tex]= 2\pi[/tex]

⇒ The angle in 2 turn of the wheel [tex]= 4\pi[/tex]

Hence, the distance it will cover in two turns

[tex]= 4\pi\times 25[/tex]       ( Arc length = central angle × radius)

[tex]= 4\times 3.14\times 25[/tex]

[tex]=314.159265\approx 314\text{ inches}[/tex]

⇒ Fourth option is correct.

How do you represent 4/7 + 3/14 on a number line?
Please Help Asap!!

Answers

well u need common denominators so 3/14 easy number line and 4/7=8/14 multiply by 2

3, 12, 48, 192, 768, . . .
This sequence has a
A.] common difference of 4
B.] common ratio of 4
C.] common difference of [tex] \frac{1}{4}[/tex]
D.] common ratio of [tex] \frac{1}{4}[/tex]

Answers

The answer would be the sequence has a common ratio of 4.
The explanation for this would be:
To get the common ratio for get the simplest form of the two numbers, so 12/3 = 4 and 48/12 = 4So we know that their common ratio is 4.
To check:
3 x 4 = 12
12 x 4 = 48
48 x 4 = 192
192 x 4 = 768

Suppose that x and y vary inversely and x = 1 when y = 12. Write a function that models the inverse variation. Graph the function and find y when x = 20.

Write a function that models the inverse variation.

Answers

An inverse variation in its generic form can be for example:
 y = k / x
 We observe that we must find the value of k.
 For this, we use the following fact:
 "x = 1 when y = 12"
 Substituting we have:
 12 = k / 1
 Therefore k = 12
 Thus, the equation is:
 y = 12 / x
 For x = 20 we have:
 y = 12/20
 y = 6/10
 y = 3/5
 y = 0.6
 Answer:
 when x = 20, and is:
 y = 0.6
 See attached graph.

I WILL GIVE 40 POINTS FOR EACH QUESTION REALLY NEED HELP THERE ANOTHER POST FOR THE OTHER QUESTION IT WILL BE ANOTHER 40 AS WELL AND MARKED AS BRAIN~LEST AND STAR RATEING

Answers

The first page is S^2 

The fourth page is The last option 

The fifth page maybe the last one (im not sure)

Answer:The first page is S^2  

The fourth page is The last option  

The fifth page maybe the last one


Step-by-step explanation:


Other Questions
The balance of Chiaki's average balance checking account at the beginning of the last cycle was $100, and the only transaction for the cycle was a check that Chiaki wrote for $20, which cleared exactly halfway through the cycle. On what amount did Chiaki's checking account pay interest last cycle? Read the passage. excerpt from "The Masque of the Red Death" by Edgar Allan Poe There was a sharp cryand the dagger dropped gleaming upon the sable carpet, upon which, instantly afterwards, fell prostrate in death the Prince Prospero. Then, summoning the wild courage of despair, a throng of the revellers at once threw themselves into the black apartment, and, seizing the mummer, whose tall figure stood erect and motionless within the shadow of the ebony clock, gasped in unutterable horror at finding the grave-cerements and corpse-like mask which they handled with so violent a rudeness, untenanted by any tangible form. Refer to Explorations in Literature for a complete version of this story. Which statement best explains how word choice affects the tone of this passage? 1) By describing the tall figure, the passage creates a sense of terror and despair. 2) By describing a wild chase, the passage creates an exciting and thrilling tone. 3) Words like wild courage create a bold tone that reflects the attitude of the Prince. 4) Phrases like sharp cry and threw themselves create an energized tone. The ice rink sold 95 tickets for the afternoon skating session, for a total of $828. answer General admission tickets cost $10 each and youth tickets cost $8 each. How many general admission tickets and how many youth tickets were sold?I think it is 34 general and 61 youth Mark all that apply. Which of the following are examples of sound devices?alliterationsymbolismonomatopoeiarhyme According to the density profile shown here, at which depth would you find the coolest, saltiest waters?A. depth BB. depth AC. depth CD. You cannot tell from this graph Quadrilateral ABCD is inscribed in a circle. Whats the measure of angle B Find the constant of variation k for the inverse variation. Then write an equation for the inverse variation. Y=4.5 when x = 3 The work function () for a metal is 7.4010-19 j. what is the longest wavelength of electromagnetic radiation that can eject an electron from the surface of a piece of the metal The size of a laptop monitor is usually measured along the diagonal. A rectangular monitor is 12 inches long and 7 inches tall. What is the length of the diagonal of this monitor, to the nearest tenth of an inch? Enter your answer, as a decimal, in the box. Graph the following inequality and then select the correct graph below.y x - 2 How was Uranus different from most other planets PLEASE HELP8.04b1. Eliminate the parameter.x = 5t, y = t + 8 A) y = 5x + 8B) y = x divided by five + 8C) y = 5x - 8D) y = x divided by five - 82. Eliminate the parameter.x = square root of x , y = 3t + 7 A) y = 3x2 + 7B) y = 3 square root of x + 7, x 0C) y = 3 square root of x - 7, x 0D) y = 3x2 - 73. Eliminate the parameter.x = t2 + 2, y = t2 - 4 A) y = x - 6, x 1B) y = x + 6, x 1C) y = x2 - 6, x 1D) y = x2 + 6, x 14. Eliminate the parameter.x = 4 cos t, y = 4 sin t In part two of Trifles,how does Glaspell use irony to illustrate the idea that women were often seen as less capable than men in the early twentieth century? Which lines in this excerpt from John Miltons Paradise Lost support the claim that Satan perceived women as being inferior to men?The image of their glorious Maker shon, Truth, Wisdome, Sanctitude severe and pure, Severe, but in true filial freedom plac't; Whence true autoritie in men; though both Not equal, as their sex not equal seemd;For contemplation hee and valour formd,For softness shee and sweet attractive Grace,Hee for God only, shee for God in him: Eugene knows the circumference of a circle is 125.6 meters. Does he have enough information to find the area? Heat may build up in the mantle as:1.weight of overlaying rock increases2.pressure of overlaying rock increases3.chemical reactions take place4.all of the above Scientist classify plants based on their height and how they reproduce The decomposition of dinitrogen tetraoxide into nitrogen gas and oxygen gas is shown by which balanced chemical equation? Which group of black soldiers served during peacetime, after the Civil War? A.Freedom Fighters B.54th Massachusetts Regiment C.Black Rangers D.Buffalo Soldiers When methanol, ch3oh, is burned in the presence of oxygen gas, o2, a large amount of heat energy is released. for this reason, it is often used as a fuel in high performance racing cars. the combustion of methanol has the balanced, thermochemical equation ch3oh(g)+32o2(g)co2(g)+2h2o(l)h=764 kj how much methanol, in grams, must be burned to produce 541 kj of heat?